Is the tetrapeptide ala-glu-gly-lys a good buffer at ph 7.0? will it move in an electric field at ph 7.0?
What role does the oxidation agent play in a redox reaction
The essential oil found in cloves, eugenol, can be isolated by steam distillation because it is insoluble in water and has a measurable vapor pressure at 100 °c even though it has a much higher boiling point than water. use data from the table to calculate the volume of eugenol in 30 ml of distillate.
At which stage does a gas form in a gas formation reaction?
the reactants stage
the product stage
the liquid stage
the solid stage
Answer: b
Explanation:
4.05 kg + 567.95 g + 100.1 g add the correct value using the correct sig figs and or least precise degree of precision. When i did least degree of precision i got 4718.1g, do we need to convert the kg unit to grams before getting the least degree of precision? since i used 100.1 as dop and if i had converted first the dop of 4.05 or now 4050g the dop is now only to the tens place compared to being in the tenths place
To find the least degree of precision we swould model it after the kg amount or 4.05 kg or two decimal places. So that would add 0.56795 kg (0.57 kg) and then 0.1001 kg (0.1 kg) so that our answer would be 4.72 kg.
In the other hand, the greatest degree of precision would be to conver 4.05 kg to 4050 g so that 4050g + 567.95 + 100.1 g= 4718.05 grams or 4718 g.
what location on earth experiences the least change in the number of daylight hours throughout the year?
Which of the following represents a compound?
A) H
B) H-3
C)H2O
D) O-16
The oceanic crust is made primarily from this type of rock.
Answer:
Igneous rock basalt.
Explanation:
The ocean crust is made mostly of igneous rock basalt, which comes from lava and the movement of tectonic plates.
If acetic acid is the only acid that vinegar contains (ka=1.8×10−5), calculate the concentration of acetic acid in the vinegar. express your answer using two significant figures.
Give the structure corresponding to the name (s)−3−iodo−2−methylnonane.
The (s)−3−iodo−2−methylnonane belongs to organic compounds and consists of a nonane with an iodine atom attached to the third carbon and a methyl group attached to the second carbon.
Explanation:The structure corresponding to the name (s)−3−iodo−2−methylnonane is achieved by following the nomenclature system for organic compounds. Nonane is a carbon backbone with nine carbon atoms. The '2-methyl' indicates that there is a methyl, or CH3 group, attached to the second carbon from the end. The '3-iodo' indicates that there is an iodine atom attached to the third carbon from the end. Therefore, starting from one end of the nonane, we have CH3-CH2-CH(I)-CH(CH3)-CH2-CH2-CH2-CH2-CH3.
Learn more about Organic Compound Structure here:https://brainly.com/question/35316125
#SPJ3
How many grams of hydrogen in 4.50 mol H2SO4
How many grams of CO2 are used when 7.0 g of O2 are produced?
The question cannot be answered as posed because a specific chemical reaction and balanced equation are needed to relate the masses of O2 and CO2.
Explanation:To answer how many grams of CO2 are used when 7.0 g of O2 are produced, we assume the process is a typical combustion or respiration reaction, where CO2 is generated from O2, or vice versa. The balanced chemical equation for the combustion of carbon would typically be C + O2 → CO2. However, since we are given the mass of O2 produced, and not the mass of a carbon-containing fuel that reacts, we cannot proceed to calculate the mass of CO2 without additional information on the specific reaction involved, including the stoichiometry that defines the mass relationship between O2 and CO2. Therefore, we must have a balanced equation or a known reaction to relate the masses of O2 and CO2 produced in order to provide a specific answer.
Learn more about Chemical Reaction Stoichiometry here:https://brainly.com/question/30415532
#SPJ12
9.62 grams of [tex]\( \text{CO}_2 \)[/tex] are used when 7.0 grams of [tex]\( \text{O}_2 \)[/tex] are produced.
One common reaction where [tex]\( \text{O}_2 \)[/tex] is produced and [tex]\( \text{CO}_2 \)[/tex] is consumed is photosynthesis:
[tex]\[ 6 \text{CO}_2 + 6 \text{H}_2\text{O} \rightarrow \text{C}_6\text{H}_{12}\text{O}_6 + 6 \text{O}_2 \][/tex]
From this balanced equation, we see that 6 moles of [tex]\( \text{CO}_2 \)[/tex] produce 6 moles of [tex]\( \text{O}_2 \)[/tex]. This means that 1 mole of [tex]\( \text{CO}_2 \)[/tex] produces 1 mole of[tex]\( \text{O}_2 \).[/tex]
Step-by-Step Solution:
1. Determine the molar mass of [tex]\( \text{O}_2 \)[/tex]:
[tex]\[ \text{Molar mass of O}_2 = 2 \times 16.00 \text{ g/mol} = 32.00 \text{ g/mol} \][/tex]
2. Calculate the moles of \( \text{O}_2 \) produced:
[tex]\[ \text{Moles of O}_2 = \frac{7.0 \text{ g}}{32.00 \text{ g/mol}} = 0.21875 \text{ moles} \][/tex]
3. Use the stoichiometry from the balanced equation:
From the balanced equation, the mole ratio between[tex]\( \text{CO}_2 \) and \( \text{O}_2 \) is 1:1.[/tex]
Therefore, the moles of [tex]\( \text{CO}_2 \)[/tex] used is the same as the moles of [tex]\( \text{O}_2 \)[/tex]produced:
[tex]\[ \text{Moles of CO}_2 = 0.21875 \text{ moles} \][/tex]
4. Determine the molar mass of [tex]\( \text{CO}_2 \)[/tex] :
[tex]\[ \text{Molar mass of CO}_2 = 12.01 \text{ g/mol} + 2 \times 16.00 \text{ g/mol} = 44.01 \text{ g/mol} \][/tex]
5. Calculate the grams of \( \text{CO}_2 \) used:
[tex]\[ \text{Grams of CO}_2 = \text{Moles of CO}_2 \times \text{Molar mass of CO}_2 \][/tex]
[tex]\[ \text{Grams of CO}_2 = 0.21875 \text{ moles} \times 44.01 \text{ g/mol} = 9.62 \text{ g} \][/tex]
If 50% of radioactive element remains after 4000 years what what is the half life
If a feather and an iron bar is released from a same height in a room without any air resistance, which one(s) will impact the ground first.
A) neither one, because without air resistance gravity is absent
B) iron bar
C) both
D) feather
Both a feather and an iron bar will impact the ground at the same time if released from the same height in a room without air resistance, demonstrating that gravity causes all objects to fall with the same acceleration, disregarding their mass.
Explanation:If a feather and an iron bar are released from the same height in a room without any air resistance, both the feather and the iron bar will impact the ground at the same time. The correct answer is C) both. This outcome occurs because in the absence of air resistance, all objects fall at the same rate due to gravity. This phenomenon was famously demonstrated on the Moon by astronaut David R. Scott in 1971, where, despite the Moon's lower gravitational acceleration of 1.67 m/s² compared to Earth's 9.81 m/s², both a hammer and a feather were shown to fall at the same rate when dropped from the same height. This validates that acceleration due to gravity is constant and does not depend on the mass of the objects involved.
Learn more about Free-fall in a vacuum here:https://brainly.com/question/28228808
#SPJ3
Why does ferrocene undergo the acylation reaction more readily than benzene?
Suggest a reason for why the phosphorus-containing side product from the horner-emmons wittig reaction is more water-soluble than the triphenylphosphine oxide side product obtained from the standard wittig reaction.
For each reaction, identify the precipitate or lack thereof bacl2 naoh
moles of hydrogen in 9.15×10−2 mol C4H10
There are three common functional groups in organic chemistry that are readily ionized by adjusting the ph of the aqueous solution during an extraction. name and write the chemical structure of these three functional groups and show each
If 150 g of phenacetin were dissolved in 100 ml of water, how much ether would be required to extract 90% of phenacetin in a single extraction?
A concentrated solution in water will always contain a strong or weak electrolyte true or false
Which of the following is the correct formula for barium (II) sulfate?
what is the definition of tributary
A tributary is a smaller stream or river that flows into a larger one, contributing to its volume and influencing its navigability, ecosystem, and flooding potential.
Explanation:The definition of a tributary is a stream or river that flows into a larger stream, river, or lake. These smaller watercourses contribute to the flow of the larger one, which is often referred to as the mainstem or parent river. Tributaries do not flow directly into the sea. They provide additional water volume to their parent river, which can then affect the river's ability to navigate, its ecosystem, and potential for flooding. For example, the Missouri River is a tributary of the Mississippi River because it flows into it.
A sample of a pure compound containing C, H, and N, weighing 1.00 g, yields 2.84 g of carbon dioxide and 0.677 g of water when it reacts with excess oxygen. What is the simplest formula of the compound?
Find the current through the 30.0 ω resistor.
Without the total voltage or detailed circuit configuration, it's not possible to determine the current through the 30.0 ω resistor. An example using Ohm's law has been provided for a hypothetical scenario.
Explanation:To find the current through the 30.0 ω resistor, we would need to apply Ohm's law, which states that I = V/R, where I is the current, V is the voltage, and R is the resistance. However, the provided information is insufficient to determine the current, as we are not given the total voltage across the resistor or the configuration of the circuit (whether it is series, parallel, or a combination).
If the 30.0 ω resistor were the only resistance in the circuit and the voltage across it was provided, we could directly use Ohm's law to calculate the current. For example, if the voltage was 10 V, the current would simply be I = 10V / 30.0ω = 0.333 A.
Without additional information, such as the configuration of the circuit and the total voltage, we cannot accurately calculate the current. The problem might be missing details or might require knowledge about the rest of the circuit to solve.
Learn more about current through a resistor here:https://brainly.com/question/30905506
#SPJ3
One radioactive isotope of calcium has an atomic mass number of 47. How many neutrons are in the calcium-47 nucleus?
Answer: The number of neutrons in the given isotope are 27.
Explanation:
Atomic number is defined as the number of electrons or number of protons that are present in a neutral atom. It is represented as Z.
Z = Atomic number = Number of electrons = Number of protons
Mass number is defined as the sum of number of protons and number of neutrons present in an atom. It is represented as A.
A = Mass number = Number of protons + Number of neutrons
Number of neutrons = Mass number - Atomic number
We are given an isotope having representation: [tex]_{20}^{47}\textrm{Ca}[/tex]
Atomic number or number of protons = 20
Mass number = 47
So, number of neutrons = 47 - 20 = 27
Hence, the number of neutrons in the given isotope are 27.
Which equation best expresses the relationship between pressure and volume for gas?
Volatile liquids with lower boiling points often give better results than those with higher boiling points. suggest a reason for this.
Determine the density of a 23.4g block that when placed in 25.00mL of water causes the water to rise to a level of 28.70mL?
How many liters of water are required to dissolve 1.00 g of barium sulfate?
To dissolve 1.00 g of barium sulfate, we would need 1 L of water.
Explanation:In order to calculate the amount of water needed to dissolve 1.00 g of barium sulfate, we need to use the molar mass of barium sulfate and the concept of molarity.
The molar mass of barium sulfate (BaSO4) is 233.43 g/mol. We can use this to convert the mass of barium sulfate to moles.
Once we know the number of moles of barium sulfate, we can use the molar ratio between barium sulfate and water to calculate the volume of water needed. The balanced equation for the dissolution of barium sulfate in water is:
BaSO4 (s) + H2O (l) → Ba2+ (aq) + SO42- (aq)
Based on this equation, 1 mole of barium sulfate dissolves to give 1 mole of water. Therefore, to dissolve 1.00 g of barium sulfate, we would need 1 L of water.
Learn more about dissolving barium sulfate in water here:https://brainly.com/question/5383482
#SPJ12