A change in the allele frequency of a population over time is called

Answers

Answer 1
Final answer:

Evolution is the change in allele frequency of a population over time.

Explanation:

Evolution, in the context of biology and population genetics, refers to the change in allele frequencies within a population over successive generations. This change is a fundamental process that underlies the diversity of life on Earth.

Specifically, evolution is defined as a change in the frequency of alleles, which are different versions of a gene, within a population. This change reflects how the proportion of a particular allele within the population shifts relative to all the other alleles of the same gene that are present. These shifts in allele frequencies can occur due to various mechanisms, including natural selection, genetic drift, mutation, migration, and more.

Understanding the dynamics of allele frequency changes over time is central to the study of evolution and how species adapt to their environments and diversify.

Learn more about Evolution here:

https://brainly.com/question/32103283

#SPJ3


Related Questions

why does the complexity of gene regulation mirror the complexity of the organism in which it is found?​

Answers

Answer:

Organisms that are more complex, such as eukaryotes, have cells that are specialized for specific functions. Gene regulation needs to be more complex to produce these specialized cells for complex organisms. Please Mark Me Brainliest

Explanation:


Which of the following correctly lists the three major locations of freshwater on Earth in order, from greatest amount of water to least amount of water?
A. ice caps and glaciers, groundwater, surface water
B. surface water, ice caps and glaciers, groundwater
C. groundwater, surface water, ice caps and glaciers
D. surface water, groundwater, ice caps and glaciers

Answers

A. Option is correct

Ice caps and glaciers - 69%

Groundwater - 30%

Surface water - less than 1 %

Answer:

A. ice caps and glaciers, groundwater, surface water

Explanation:

Fresh water is a type of water, found in nature, in which there is no salt. It is water suitable for consumption (provided it is treated) for humans and animals. Fresh water is also used in agriculture. Only about 2.5% of the water found on our planet is sweet. It is mainly found in polar caps and glaciers, groundwater, surface water.

With the growth of the world population, fresh water has become increasingly scarce. Overuse, waste and water pollution are the main problems related to fresh water today.

As it is a precious and scarce mineral resource, society must be aware that, in order not to run out of water in the near future, it is necessary to avoid waste, use it rationally and do not pollute rivers, lakes and water sources.

DNA Sequence 5'- AGT AAC GGC AGA CTT CTC CAC AGG AGT CAG GTG CAC CAT -3' mRNA Sequence: 5'- ........................................................-3' Nucleotides: ACGTU

Answers

Answer:

5'- UCA UUG CCG UCU GAA GAG GUG UCC UCA GUC CAC GUG GUA -3'

Explanation:

As we know there are four nitrogenous bases  in DNA double helix, they are divided into two categories Purines and Pyrimidines.  

Purines:

Adenine (A) and Guanine (G)

Pyrimidines:

Cytosine (C) and Thymine (T)

Note: In case of RNA Thymine will be replaced with Uracil (U)

During Transcription, A DNA sequence is copied into messenger RNA (mRNA). As a first step the double helix molecule of DNA will unwind and one of the strands will be used as template. RNA polymerase moves along the template strand and synthesize mRNA.  

Final answer:

The complementary mRNA sequence to the given DNA sequence would be 5'- UCA UUG CCG UCU GAA GAG GUG UCC UCA GUC CAC GUG GUA -3'. This mRNA sequence is then decoded during the process of translation into a polypeptide chain with a specific sequence of amino acids.

Explanation:

The DNA sequence provided is a template strand from which the complementary mRNA sequence is transcribed. The transcription process follows the principle of base pairing but uses uracil (U) in RNA instead of thymine (T) in DNA. Thereby, adenine (A) pairs with uracil (U), thymine (T) pairs with adenine (A), cytosine (C) pairs with guanine (G), and guanine (G) pairs with cytosine (C) in the mRNA sequence.

So, the complementary mRNA sequence to the provided DNA sequence 5'- AGT AAC GGC AGA CTT CTC CAC AGG AGT CAG GTG CAC CAT -3' would be: 5'- UCA UUG CCG UCU GAA GAG GUG UCC UCA GUC CAC GUG GUA -3'.

This mRNA sequence then goes through a process called translation where it is decoded into a polypeptide chain (a protein) with a specific sequence of amino acids. The three-nucleotide sequences also known as codons in mRNA each correspond to a specific amino acid in the peptide chain.

Learn more about mRNA transcription here:

https://brainly.com/question/15108803

#SPJ3

Which of the following has the greatest effect on reproductive potential?
A.Producing more at a time offspring
B.Reproducing more often
C.Having a longer life span
D. Reproducing earlier in life

Answers

The answer is D. ding ding ding

Answer:

A

Explanation:

Reproductive Potential is the relative capacity of a species to reproduce itself under optimum conditions. Being able to produce more offspring at a time will increase the potential offspring capacity. Hope this helps!

Which statement best compares pseudopods in sarcodina and flagella in dinoflagellates?

A.
Both pseudopods and flagella are used for reproduction, but only flagella are used for movement.
B.
Pseudopods are whip-like structures, while flagella are flat structures involved in photosynthesis.
C.
Both pseudopods and flagella are used for movement, but only pseudopods are used to engulf food.
D.
Pseudopods are permanent projections from a cell, while flagella can be retracted into the cell.

Answers

Answer:

Both psudopodes and flagella are used for movement, but only psudopodes are used to engulf food.

Final answer:

Both pseudopods and flagella are used for movement. Pseudopods are temporary and used to engulf food, while flagella are hair-like structures used for locomotion in dinoflagellates.

Explanation:

The question pertains to the comparison of pseudopods in sarcodina and flagella in dinoflagellates. The correct answer to the question is that both pseudopods and flagella are used for movement, but only pseudopods are used to engulf food. Pseudopods are temporary, foot-like extensions of the cytoplasm enabling sarcodina to move and capture prey. Conversely, flagella are long, hair-like structures that allow dinoflagellates to move through their aquatic environments. While flagella contribute to the locomotion of dinoflagellates, they are not involved in engulfing food.

3) Plant cells perform photosynthesis, which occurs in the

Answers

Answer:

Chloroplast

Explanation:

chloroplasts is the answer:)

Someone please help! I’ll mark a brainliest! :)

Answers

Answer:

Organs are made up of tissue.

Explanation:

Answer:

Organs are made up of tissue.

I need help ASAP please help me...​

Answers

Answer:

1. She woke up early

2. The sun would've not got to her nose.

3.  ( I dont understand this one. Also, Be posive on this! your homework is just as important as your video game! *This was super easy and you should be able to Read And get it correct. Hope this helps! <3)


Describe two roles that enzymes play in DNA replication. . . .


×║thank you║×



Answers

Answer:

The DNA enzyme helicase unzips the DNA strand so that one side can be used as a template to make a new strand. DNA polymerase is another enzyme that takes nucleotides from solution and bonds them to other nucleotides.

A drainage basin is the area of land where surface water is drained downhill into a body of water. A divide is A. a man-made fence that is built at the top of a drainage basin. B. a line halfway down the slope of a drainage basin. C. the low ground where two drainage basins meet. D. the high ground separating two drainage basins.

Answers

Answer:

Given that part of the definition of a geographical divide is that it's elevated above that which it's dividing, I'm going to say D.

Hope this helps!

Answer: The answer is D

Explanation:

The high ground separating two drainage basins

which atmospheric layer is least dense

Answers

The exosphere is the least dense layer of Earth's atmosphere because it is the farthest away from Earth and has the least amount of air molecules.

The exosphere is the least dense layer of Earth's atmosphere.

Here's why:

The atmosphere is made up of five layers: the troposphere, stratosphere, mesosphere, thermosphere, and exosphere.

As you move away from Earth's surface, the density of the atmosphere decreases. This is because gravity pulls the atmosphere towards Earth, so the closer you are to Earth, the more molecules there are to be pulled in.

The exosphere is the outermost layer of the atmosphere, and it is so thin that it is barely considered part of the atmosphere at all. The density of the exosphere is about 100,000 times less than the density of the air at sea level.

Because of its low density, the exosphere is very cold and has very little air pressure. In fact, the exosphere is so thin that satellites can orbit Earth within it without encountering much air resistance.

The question has eliminated one option exosphere that is only the correct answer.

List the three functions of kidney

Answers

Most notably, kidneys remove dangerous toxins and excess water from your blood and eliminate them through your urine. Kidneys also perform other amazing physiological feats, from regulating the amount of fluid in your body to controlling the salt content of that fluid. Here are three more amazing kidney functions.

1. Regulation of extracellular fluid volume. The kidneys work to ensure an adequate quantity of plasma to keep blood flowing to vital organs.

2. Regulation of osmolarity. The kidneys help keep extracellular fluid from becoming too dilute or concentrated with respect to the solutes carried in the fluid.

3. Regulation of ion concentrations. The kidneys are responsible for maintaining relatively constant levels of key ions including sodium, potassium and calcium.

Describe the three types of population distribution

Answers

Answer:

1. There are three type of population distribution namely uniform, random and clumped.

a) Uniform  distribution also know as a rectangular dispersal or distribution that has constant probability.  This is also a family of symmetric probability distributions.

b) Random distribution takes place where individuals are spaced at unpredictable spaces or distances from each other.

c) Clumped distribution is when individuals in a population are clustered together, making some patches with other organism or individuals.

Explanation:

hope it helps

List two species that are clear examples of genetic drift and speciation events.

Answers

Answer:

Cougar and cheetah

Explanation:

The cougar and the cheetah are a nice example of genetic drift and speciation. These two felids have a common ancestor that lived in North America. As the environment was changing, some individuals of the species started to occupy the forests, especially in the mountainous regions, while other individuals moved into the open grasslands where there was an open niche in the food chain. The cougar emerged from the ones that lived in the mountainous forests, remaining typically cat like, with lot of muscle tone, relatively short legs, and being an ambush predator. The cheetah emerged from the ones that started living in the grasslands. Unlike their cousins, these individuals experienced lot of changes, developing long legs, larger heart and lung capacity, losing their retractable claws, and becoming sprinters. As the conditions changed, the cheetah migrated, eventually reaching Eurasia and Africa, while the cougar spread across most of North America and South America.

Who examines and coordinates the cleanup of polluted sites?

Answers

Answer:

The Environment Protection agency examines and coordinates these sites.

Explanation:

How many people die of lung cancer every year?

a.
over 140,000.
b.
less than 10,000.
c.
less than 50,000.
d.
none of the above.

Answers

the most recent year for which we have statistics available, 157,423people -- 86,689 men and 70,734women -- died from lung cancer in the U.S. 

URGENT!!!
A small population of lizards lives on an island where the environment is changing quickly.Which BEST describes why the lizards may become extinct?
A.The lizards are not able to reproduce
B.The lizards are undergoing natural selection
C.The lizards do not have enough genetic variation
D.The lizards have to much overproduction

Answers

Answer: B

Explanation: The lizards are trying to adapt t the environment, therefore, it would be B.

I HOPE THIS HELPS!

Its B for the question hope this awnser helps you

the special reproductive structures known as sperm and egg are correctly referred to as​

Answers

Answer:

The correct answer is - gametes or sex cells.

Explanation:

Gametes are the sec cells that are produced by the gonad or reproductive gland or organs. Female gametes are called egg cells where as male gametes are known as sperm.

These gametes fuse to produce offspring of an individual. The process of fusing sex cells or gametes called fertlization.

Thus, the correct answer is - gametes or sex cells.

They are correctly referred to as Gametes

Gametes are reproductive cells formed during sexual reproduction towards producing a new organism which is termed zygote. Gametes in males and females bodies are different.

Further Explanation

However, the Male gamete is called sperm, and the female gamete is called egg or ovum. Usually, the male gamete is smaller than the female gamete. It also usually mobile. The male gamete has a long tail known as flagellum, which allows it to move towards the female gamete. On the other hand, the female gamete is always larger than the sperm and is not mobile unlike the male gametes.

Gametes can also be defined as identified sex cells which contain half the number of chromosomes of the parent. Fertilization takes place when a sperm and an egg connect, forming a single cell which is termed “zygote.” The zygote increases into an individual or more.  

However, Humans have forty-six (46) chromosomes resulting from a twenty-three (23) pairs.

Formation

Gametes are formed by a process in which cells are divided into more parts called Meiosis. The division process results into four daughter cells which are called haploid. A set of chromosomes is usually located in Haploid Cells.  

Fertilization is the connection of the male and female gametes which leads to zygote formation.

LEARN MORE:

What are gametes https://brainly.com/question/2569962

KEYWORDS:

gametesfertilizationhaploidzygotemeiosisspermeggovum

When an animal uses two kinds of signals together to obtain a response,
there is a communication

Answers

Answer:

When an animal uses two kinds of signals together to obtain a response,  there is a communication Cycle.

Explanation:

Communication is the process in which one organism transmit the information to another organism (receiver) causing any kind of change in behavior of receiver. Usually communication is done between two organisms of same species however there are special type of communication that can be done between different species.

Animals uses different sources of communication called signals for example,  

Visual signals

Auditory signals

chemical signals

Tactile signals

When an animals uses two types of signals to get the responce it is called a communication cycle.

which of the following is the best way to address this problem

Answers

Final answer:

To address a problem in design and interface, one should define the problem, utilize problem-solving strategies and tools, and methodically work through solutions. An analytical approach to design challenges in Computers and Technology enhances user interaction and satisfaction while preventing future issues.

Explanation:

Addressing design and interface challenges can often be approached methodically through steps and utilizing the right tools. Firstly, identify the core problem, which can include user interface issues, lack of intuitive design, or poor user experience. After pinpointing the problem, consider problem-solving strategies relevant to the field of Computers and Technology, such as:

Planning out the interface with a focus on simplicity and intuitionEngaging with tools that assist in interface design and usability testingSequentially approaching the problem-solving process, tackling one issue at a timeSeeking evidence-based methods to support your chosen approachEmploying a preventive mindset to avoid future issues by thorough testing and iteration

By adopting these strategies, you can ensure that the approach to addressing the problem is systematic and yields effective solutions that enhance the overall design and functionality of your product. A thoughtful, analytical approach to problem-solving in technology can improve user satisfaction and prevent recurring problems.

How does studying the DNA of different types of organisms provide evidence that all life on earth is related? ​

Answers

All DNA of creatures is made from the same materials, and is largely the same. (Humans are less than 5% different than primates genetically)

Studying DNA of different species reveals that all life on Earth shares a common ancestor, due to universal genetic similarities. Genomics has enabled the construction of the 'tree of life' illustrating these relations. Molecular evidence, such as genome comparisons, helps us understand the evolutionary connections among diverse organisms.

Studying the DNA of different organisms provides evidence that all life on Earth is related because all extant life shares a common ancestor. This is visible in the fundamental similarities at the molecular level, such as the universal genetic code, the use of DNA to store genetic information, and the usage of similar molecular building blocks. Genomics and genetics have made it possible to construct the 'tree of life', a diagram illustrating the relationships among organisms by examining nucleic acid sequences that they have in common. This shows the deep connections across all living organisms, from the molecular level to larger structures and functions.

The genomes of various organisms show that they share a high degree of similarity in DNA sequences which code for proteins and other molecules. Through detailed analyses of these genetic codes, scientists have been able to determine homologies that imply a common ancestor. As evolution progressed, the genetic code established early in Earth's history evolved into the diverse life forms observed today. Additionally, molecular evidence of evolution, such as the comparison of genomes, sheds light on how evolution occurs and the relationships among species.

When a light wave is absorbed by an object what happens to the absorbed light energy

Answers

Answer:

The frequency of the incoming light wave is at or near the energy levels of the electrons in the matter. The electrons will absorb the energy of the light wave and change their energy state.

Explanation:

Final answer:

Absorbed light energy is typically converted into heat or another form of energy by the object absorbing it. Objects appear colored due to the reflection of certain wavelengths, while those absorbed contribute to energy transformation within the object.

Explanation:

What Happens to Absorbed Light Energy

When a light wave is absorbed by an object, the absorbed light energy is converted into other forms of energy, typically heat. This transformation is a result of light interacting with matter. For instance, pigment molecules in plants absorb visible light for photosynthesis, while materials like glow-in-the-dark plastics can absorb light energy and later re-emit it as phosphorescence. The energy from light that's absorbed can also contribute to an object's temperature increase.

Moreover, the absorption of light depends on the wavelengths of light and the material it interacts with. Objects appear colored because they reflect certain wavelengths while absorbing others. For example, a red apple appears red because it reflects red wavelengths and absorbs others.

What are the two main reasons archaea and bacteria belong to different domains

Answers

Final answer:

Archaea and bacteria are placed in different domains due to their distinct evolutionary histories and structural differences, specifically the composition of their cell walls and membranes.

Explanation:

The two main reasons why archaea and bacteria belong to different domains are their distinct evolutionary histories and structural differences. Archaea and bacteria are both unicellular prokaryotic organisms, but they evolved separately from each other and hence have different genetic makeup and metabolic pathways.

Structurally, the most notable difference is the composition of their cell walls and membranes. Bacteria usually have a cell wall composed of peptidoglycan, while archaea have cell walls made of a similar substance called pseudo peptidoglycan or other polymers. Additionally, they incorporate different lipid molecules into their cell membranes. These distinctions place these organisms into the separate domains of Bacteria and Archaea.

Learn more about Archaea and Bacteria here:

https://brainly.com/question/13022264

#SPJ3

How are natural resources classified
As renewable or no renewable
As naturally occuring or manufactured
As good for the environment or bad for the environment
As readily available or not

Answers

Answer:

As renewable or no renewable

Explanation:

The natural resources are classified as renewable or no renewable. The renewable natural resources are the ones that are constantly present, caused by the nature, and they can not be spent. Some of these natural resources are the wind, and the sunlight. The no renewable resources are the ones that are in limited amounts, thus they can be spent. Some of these natural resources are the oil, natural gas, and coal. The no renewable natural resources though are much more used than the renewable ones. The reason for this is that tend to produce more energy, and also are relatively cheap. The renewable natural resources are on the rise when it comes to their usage, and lot of nations make a lot of effort to make them their primary source of energy, but it seems that that will take a while.

Answer:

As renewable or nonrenewable

Explanation:

Which branch of Earth science is most likely to focus on the formation of rocks and minerals?

Answers

Geology is the study of solid Earth. Geologists study how rocks and minerals form.

Examples: The way mountains rise, or the way mountains erode.

Answer:

geology

Explanation:

Geology is the study of the solid Earth. Geologists study how rocks and minerals form. The way mountains rise up is part of geology. The way mountains erode away is another part

What is a blastula?——————————

Answers

The blastula (from Greek βλαστός (blastos), meaning "sprout") is a hollow sphere of cells, referred to as blastomeres, surrounding an inner fluid-filled cavity called the blastocoele formed during an early stage of embryonic development in animals.

Answer:

An early stage of embryonic development having a hollow mass of cells.

Explanation:

During embryonic development, blastula represents a development stage, characterized by a hollow mass of cells. These cells are known as blastomeres. Inside the ball of cells, a fluid-filled cavity is present, known as segmentation cavity or blastocoel.

In mammals, blastula is called as blastocyst, including humans.

Which is a scientific claim

Answers

A scientific claim is a claim made by scientists but doesn't really answer a question.

Answer: (D [I think]) Placing half filled one gallon jugs of water out on the lawn prevents moles from occupying the space underground

Explanation:

Let’s face it y’all just wanna pass a unit test or a quiz

PLEASE HELP

Changes in environmental conditions always result in new ecosystems and loss of biodiversity characterized by an increase in the number of some species, the evolution of new species, and the extinction of some species.
Use what you have learned from the lesson, as well as reliable and reputable resources, to evaluate this claim.

Answers

The statement is a short one, but it manages to sum up what happens in nature in a simplified manner.

All the species have evolved to a certain type of environment, thus being perfectly well adapted to certain living conditions, and developing traits that are advantageous for the survival in that particular environment. But the Earth is constantly changing, and those changes result in changes of the environment, sometimes gradually, sometimes very quickly. The loss or change of environment always has huge impact on the species. Some go extinct, especially the ones that have been too specialized, while the more opportunistic and less specialized species often manage to survive. The ones that manage to survive face a new environment, so they evolve in a way that is advantageous for them to survive in the new environment, thus giving rise to new species. Other species may already have the required traits for the new environment but have been living in different area, so they will gradually move in this new environment as it suits them, thus having a situation where the ecosystems will eventually be totally changed and unrecognizable from the predeceasing ecosystems.

Answer:

Changes in environmental conditions like floods or forest fires, always result in new ecosystems and loss of biodiversity characterized by an increase in the number of some species, the evolution of new species, and the extinction of some species. If humans are hunting for predators like jaguars, this would affect the food chain and cause a loss of biodiversity. The prey would survive and reproduce more because there would be fewer predators to eat them. Therefore, the population can increase. Species can also evolve to fit the environmental conditions. For example, if there is a major drought in an area, some organisms could adapt and evolve to the drought. However, the organisms that can't evolve would die and would also cause a loss of biodiversity. Environmental conditions like climate change affect many organisms. One pine tree species went extinct because of climate change. The seeds couldn't grow and reproduce in the weather, so the organism gradually went extinct.

What's the correct order of the thunderstorm life cycle, from its beginning to its end?

A. Maturity, dissipation, development
B. Development, maturity, dissipation
C. Maturity, development, dissipation
D. Development, dissipation, maturity

Answers

Answer :The correct order of the thunderstorm life cycle, from its beginning to its end is Development, maturity, dissipation- B.

B.) Development, maturity, dissipitation

What is the process of ovulation

Answers

Answer:

Ovulation is the release of an egg, or ovum, which may then be fertilized by a sperm cell or dissolved during menstruation. The ovulation process is defined by a period of elevated hormones during the menstrual cycle. ... This is the period of fertility and usually lasts from 24 to 48 hours.

Explanation:

Other Questions
Solving for matrices Which of the following statements describes alkenes and alkynes but not alkanes?A. They are aromatic compounds. B. They are unsaturated. C. They are saturated.D. They are hydrocarbons. Which equation represents the graphed function? (0,3) (1,1) I say trapezoidal prism. Am I right! Thanks Which term means giving the winner of the popular vote in a state all of the state's electoral votes? A group of related words, with a subject and predicate, that acts to modify a noun or pronoun is called an ________ clause. Which expression is 5 times as large as the expression 345+23 In the morning, the temperature starts out around 50 F. As the day goes on, the temperature rises first slowly, then more quickly. It stays constant for an hour before dropping slowly. Select the graph that best represents this description How did the British officers such as Lafayette aid America in the Revolutionary war What is the equation of a vertical line passing through the point (-4,7)? The volume of a cube is 1953.1 25 cm find the length of the side round your answer to the nearest 10th I NEED ANSWER BY TODAY1. (1) I stood offstage. (2) I felt nervous. (3) I was prepared for the audition. (4) Still, I felt nervous. (5) I always do. (6) It doesn't matter whether the part is large or small, whether I know the director or not, or whether I am having a good day or a bad one. (7) I always feel nervous before I go onstage. (8) Then I actually step onstage, and I relax. Which sentence in the paragraph uses parallel structure?a. sentence 1b. sentence 3c. sentence 5d. sentence 62. Use your understanding of the Latin root -aud- to choose the meaning of the phrase an audible sigh.a. a sigh that shows sad feelingsb. a sigh showing fear or anxietyc. an easily heard sighd. a sigh that hides other emotions3. udging from the meaning of the Latin root -script-, choose the place where you would most likely find a postscript.a. in the stage directions of the written version of a dramatic playb. at the end of a letter, after the body and signaturec. in a sidebar of warnings about how to operate heavy machineryd. as part of the instructions in a computer manual The perimeter of a basketball court is 84 meters and the length is 6 meters longer than twice the width. what are the length and width? Find the perimeter of a triangle with sides measuring 5 centimeters , 9 centimeter, and 11 centimeters Freddy does not know why his wife seems so angry and upset. he decides not to say anything to her, according to rebt, freddy express 45 minutes as a fraction of 1 hour Simplify dont show your work got it Which of the following is csc(-166) equal to?csc(14)-csc(14)-csc(-14)csc(166) What is the approximate measure of this angle? Why was the Tennis Court Oath a significant event of the French Revolution? Steam Workshop Downloader