A wall clock has a circumference of 43.96 inches. What is the area of the clock?

Answers

Answer 1

find the radius:

r = C/2pi

r= about 7 (6.99645)

find the area:

A = pi(r)^2

A = about 153.78194 inches^2

Answer 2

Answer: The area of the circle in inches is A= 153.64 inches²

Step-by-step explanation:

This problem bothers on the calculations on shapes

In this Case a circle

The circumference of a circle is given by

C=2πr

Given that C =43.96 inches

We need to solve for the radius, because we also need the radius to solve for the area

43.96= 2*3.142*r

43.96=6.284r

r= 43.96/6.284

r=6.99 inches

Now back to the area of a circle which is given by

A=πr²

Substituting our value for Pi we have

A= 3.142*6.99²

A=3.142*48.89

A= 153.64 inches²


Related Questions

The average annual costs for owning two different refrigerators for x years is given by the two functions: f(x) = 850 + 62x /x and g(x) = 1004 + 51x /xIn the long run, the cost of the refrigerator modeled by will be the cheapest, averaging $ per year.

Answers

Answer:

part 1: After one year, the cost of the refrigerator modeled by f(x) is cheaper.

part 2: 14 years

part 3: g(x)

part 4: 51

hope this helps :)

Final answer:

To find the cheapest refrigerator in the long run, calculate the limit of the cost per year as x approaches infinity for both given functions and compare the results. The cost of the refrigerator modeled by f(x) will be the cheapest, averaging $62 per year.

Explanation:

The average annual costs for owning two different refrigerators for x years can be calculated using the given functions: f(x) = 850 + (62x / x) and g(x) = 1004 + (51x / x). To determine which refrigerator will be cheaper in the long run, we need to find the limit of the cost per year as x approaches infinity for both functions. Taking the limit as x approaches infinity for f(x), we get 62. Therefore, the cost of the refrigerator modeled by f(x) will be the cheapest, averaging $62 per year.

Learn more about Cost of owning refrigerators here:

https://brainly.com/question/29798290

#SPJ2

In the space below, provide the larger of the two positive integers that add to 10 and have the largest possible product.

Answers

Answer:

  5

Step-by-step explanation:

The integers 5 and 5 sum to 10 and have the largest possible product.

___

The two numbers will be x and (10-x). Their product is x(10-x), which describes a downward-opening parabola with zeros at x=0 and x=10. The maximum (vertex) of that parabola is halfway between the zeros, at x=5. Both integers have the same value: 5. Their product is 25.

If there is a requirement the integers be distinct, then 6 and 4 are the integers of choice. Their product is 24.

Given that the measure of ?x is 60°, and the measure of ?y is 90°, find the measure of ?z

Answers

Answer:

The measure of angle z is 30

Step-by-step explanation:

The angles of a triangle all add up to 180. So we can set these measures equal to 180 and solve for the unknown.

60 + 90 + z = 180

150 + z = 180

z = 30

HELP URGENT 20 PTS!!!! Describe how to sketch a normal curve with a mean of 50 and a standard deviation of 2. Indicate how you would label the horizontal axis at 1, 2, and 3 standard deviations from the mean

Answers

Answer:

Step-by-step explanation:

Draw a generic normal curve.  Subdivide the x-axis on each side of the center (mean) into four approx. = parts.

Label the mean with '50.'

1 std. dev. below the mean would be 50-2 = 48;

2 std. dev.                             would be 48-2= 46, and

3 std dev.                               would be 46 - 2 = 44

Do the same on the other side of the mean.  

The 3 corresponding values will be 52, 54 and 56.

What is the solution set?

Answers

❣ [̲̅R̲̅][̲̅e̲̅][̲̅f̲̅][̲̅e̲̅][̲̅r̲̅]

[̲̅T̲̅][̲̅h̲̅][̲̅e̲̅]

[̲̅A̲̅][̲̅t̲̅][̲̅t̲̅][̲̅a̲̅][̲̅c̲̅][̲̅h̲̅][̲̅m̲̅][̲̅e̲̅][̲̅n̲̅][̲̅t̲̅] ❣

❣❣... ℏ✺℘ḙ !т ℏḙℓ℘ṧ ʏ✺ṳ...❣❣

Answer:

The possible solution that is obtained from the system of equation are:

(1,3) and (6,13)

Step-by-step explanation:

We are asked to find the solution set of the given system of equation as:

[tex]y=x^2-5x+7-----------(1)[/tex]

and [tex]y=2x+1--------(2)[/tex]

We know that the solution of the system of equations is the possible set of x and y-values that satisfy both the equations.

Or we may say the point of intersection of the graph that is obtained from both the equations.

We solve the system by substitution method as:

We put the value of y from equation (1) in equation (2) to obtain:

[tex]x^2-5x+7=2x+1[/tex]

which is further written by combining the like terms as:

[tex]x^2-5x-2x+7-1=0\\\\x^2-7x+6=0\\\\x^2-6x-x+6=0\\\\x(x-6)-1(x-6)\\\\(x-1)(x-6)=0[/tex]

Hence, we get the possible values of x as:

x=1   and x=6

Also the value of y when x=1 is:

   y=2×1+1=2+1  ( Putting the value of x in equation (2))

         y=3

when x=6 we have the value of y as:

          y=2×6+1

             y=13

Hence, the possible solutions are:

(1,3) and (6,13)

What is 32% of 82 ?????????????????????????/

Answers

Answer: 26.24

32% of 82

0.32 • 82 = 26.24

The sum of two numbers is 60. One number is four times as larger as the other. What are the numbers

Answers

The sum of two numbers is 60

The answer is

40 and 20

Wendy can ride her bike 0.7 miles in 6 minutes how many miles can she ride in 2.5 hours

Answers

Wendy can ride 17.5 miles in 2.5 hours

Answer:

17.5 miles

Step-by-step explanation:

[tex]\frac{miles}{min} = \frac{miles}{min} \\\\\\[/tex]

Convert hours to minutes

60 minutes = 1 hour

[tex]2.5*60=150[/tex]

2.5 hours = 150 minutes

[tex]\frac{0.7}{6} = \frac{x}{150} \\\\\\[/tex]

Cross multiply

[tex]0.7*150=6*x\\105=6x\\\frac{105}{6} =x\\17.5=x[/tex]

Find the area of the rhombus. Check answer please

Answers

Answer:

128 m²

Step-by-step explanation:

The area of the rhombus can be calculated using the diagonals

area = [tex]\frac{1}{2}[/tex] diagonal × diagonal

       = [tex]\frac{1}{2}[/tex] × 16 × 16 = 8 × 16 = 128 m²

Final answer:

The area of a rhombus can be found using the formula (diagonal1 * diagonal2) / 2.

Explanation:

To find the area of a rhombus, you can use the formula:

Area = (diagonal1 * diagonal2) / 2

Where diagonal1 and diagonal2 are the lengths of the diagonals of the rhombus.

For example, if one diagonal is 8 meters and the other diagonal is 6 meters, the area would be:

Area = (8 * 6) / 2 = 24 square meters

The diameter of kitty's bicycle wheel is 24 inches what is the radius of the wheel

Answers

Diameter is the distance all the way across a circle (going through the center), and radius is the distance from the center to the edge. This means that the radius is always half of the diameter. If the diameter is 24, the radius is 24/2 = 12 inches.

Answer:

12

Step-by-step explanation:

it would be half of 24 which is half of the wheel

a normal distribution with a mean of 15 and standard deviation 0f 5.95% its area is within ?

Answers

Answer:

Step-by-step explanation:

B

Final answer:

The normal distribution describes how the values of a variable are distributed. Given a mean of 15 and standard deviation of 5.95, the area within which values lie could be found using the properties of a normal distribution, which state that ~68% of data falls within one standard deviation of the mean, ~95% within two standard deviations, and ~99.7% within three standard deviations.

Explanation:

This question is related to the normal distribution in statistics. The normal distribution is a probability function that describes how the values of a variable are distributed. It is a symmetric distribution where most of the observations cluster around the central peak and the probabilities for values further away from the mean taper off equally in both directions. Extreme values in both tails of the distribution are similarly unlikely.

Given a normal distribution with a mean of 15 and a standard deviation of 5.95, we are asked to find the area within which the values lie. Using the properties of a normal distribution, we know that:

Approximately 68% of the data falls within one standard deviation of the mean (mean ± 1*standard deviation). Approximately 95% falls within two standard deviations (mean ± 2*standard deviation). Approximately 99.7% falls within three standard deviations (mean ± 3*standard deviation).

So, if we wanted to find the area within one standard deviation of the mean, for instance, we would calculate the values of (mean - standard deviation) and (mean + standard deviation), which would represent the range within which approximately 68% of the data lies.

Learn more about Normal Distribution here:

https://brainly.com/question/34741155

#SPJ3

The College Board reported the following mean scores for the three parts of the Scholastic Aptitude Test (SAT) (The World Almanac, 2009): Critical Reading 502 Mathematics 515 Writing 494 Assume that the population standard deviation on each part of the test is = 100. What is the probability a sample of 90 test takers will provide a sample mean test score within 10 points of the population mean of 502 on the Critical Reading part of the test (to 4 decimals)? Round z value in intermediate calculation to 2 decimals places. What is the probability a sample of 90 test takers will provide a sample mean test score within 10 points of the population mean of 515 on the Mathematics part of the test (to 4 decimals)? Round z value in intermediate calculation to 2 decimals places.

Answers

Answer:

For the Critical Reading part: P = 0.6578

For the Math part: P = 0.6578

Step-by-step explanation:

See attached photo for solutions

Final answer:

The probability that a sample of 90 test takers will provide a sample mean test score within 10 points of the population means of 502 (Critical Reading) and 515 (Mathematics) on the SAT is approximately 68.26% for both.

Explanation:

To calculate the probability for each section of the SAT, we use the formula for the z score: z = (X - μ) / (σ / sqrt(n)). In this case, X is the sample mean, μ is the population mean, σ is the population standard deviation, and n is the sample size.

For the Critical Reading section, μ = 502, X is between 492 and 512 (502 ±10), σ = 100, and n = 90. When we input these values into the formula, we get a z value of -1 (for 492) and 1 (for 512) approximately. We then use a z-table to find the probability associated with these z-values. The probability for z = -1 is 0.1587 and for z = 1 is 0.8413. To find the probability that the sample mean lies within these z values, we subtract the lower probability from the higher one, which gives us 0.6826 or 68.26%.

The same steps are applied to the Mathematics section where μ = 515. The resulting probability also comes to around 68.26% that a sample mean test score will be within 10 points of the population mean.

Learn more about Probability Calculation here:

https://brainly.com/question/33780340

#SPJ2

If you were to create a histogram from the data shown in this stem-and-leaf plot, how many data points would be contained in the bar from 95-105?

A) 3
B) 4
C) 5
D) 6

Answers

Answer:

the answer is A, 3

Step-by-step explanation:

Answer:

3

Step-by-step explanation:

Stem Leaf Plot : A special table where each data value is split into a "stem" (the first digit or digits) and a "leaf" (usually the last digit).

So, In the Given Stem leaf plot the numbers are :

100,101,90,93,94,94,95,81,86,87,89,70,72,76,69,56,58,49

Arrange in ascending order

49,56,58,69,70,72,76,81,86,87,89,90,93,94,94,95,100,101

Now we are supposed to find how many data points would be contained in the bar from 95-105

49,56,58,69,70,72,76,81,86,87,89,90,93,94,94,95,100,101

So, we can see there are 3 data points are contained in bar from 95 -105.

Hence 3 data points are contained in bar from 95 -105.

Shelly biked 21 miles in 4 hours (part A) what is Shelly's average speed in miles per hour (part B) at the same rate how many hours will it take Shelly to bike 42 miles.

Answers

A) Divide total miles by total time:

21 miles /  4 hours = 5.25 miles per hour.

B) Divide miles by miles per hour:

42 miles / 5.25 miles per hour = 8 hours.

Issac has 21 marbles and 7 blue marbles he wants to place them in identical group without any marbles left

Answers

Answer:

It would be 3 groups because 21/7 = 3

MARK AS BRAINIEST PLEASE

Determine the relationship between the quantities of the given graph.

Answers

D

The time worked is directly proportional to the wages. This means as the wages increase, the hours of work increases.

The less role game uses a number cube with the number 2,4,6,8,10 and 12 there are prices for rolling any number less than 6 how likely is it to role a number less than 6

Answers

Answer:

1/3.

Step-by-step explanation:

To roll a number less than 6 it must be 2 or 4 (2 numbers). There are 6 numbers on the cube.

So the probability = 2/6

= 1/3.


In a town’s study of its stray cats, a sample of stray cats had a mean weight of 7.3 lb. The study had a margin of error of 1.1 lb.
What is the interval estimate for the mean weight of the town’s stray cats in the form (lower limit, upper limit)?

Show your work:

Answers

Answer:

(6.2, 8.4)

Step-by-step explanation:

Mean weight of the cats = u = 7.3 lb

Margin of Error = E = 1.1 lb

The interval estimate is calculated by subtracting and adding the margin of error to the mean value as shown below:

( u - E, u + E)

Using the given values, we get:

(7.3 - 1.1, 7.3 + 1.1)

(6.2, 8.4)

Thus, the interval estimate for the mean weight of the town’s stray cats is (6.2, 8.4)

Condense the following logs into a single log:

[tex]5log_{b} x - 6log_{b} y[/tex]

Answers

Answer:

[tex]logb(X^5 / Y^6)[/tex]

Step-by-step explanation:

Given in the question an expression

5logbX - 6logbY

To Condense the following logs into a single log we will use logarithm rules

1) log power rule

5logbX = logbX^5

6logbY = logbY^6

2)log qoutient rule

ln(x/y) = ln(x)−ln(y)

logbX^5 - logbY^6 = [tex]logb(X^5 / Y^6)[/tex]

Answer:

[tex]5\log_b(x)-6\log_b(y)=\log_b(\frac{x^5}{y^6})[/tex]

Step-by-step explanation:

The given logarithmic expression is  [tex]5\log_b(x)-6\log_b(y)[/tex]

We apply the rule: [tex]n\log_b(M)=\log_b(M^n)[/tex]

This implies that;

[tex]5\log_b(x)-6\log_b(y)=\log_b(x^5)-\log_b(y^6)[/tex]

We now apply the rule; [tex]\log_a(M)-\log_a(N)=\log_a(\frac{M}{N} )[/tex]

[tex]5\log_b(x)-6\log_b(y)=\log_b(\frac{x^5}{y^6})[/tex]

Given: 2x + 11 = 15 Prove: x = 2 Statements Reason 1. 2x + 11 = 15 1. Given 2. 2x = 4 2. 3. X = 2 3. Division Property of Equality

Answers

Answer:

Statements                       Reasons

1. 2x + 11 = 15                    1. Given

2. 2x = 4                            2. Subtraction Property of Equality

3. X = 2                              3. Division Property of Equality

Step-by-step explanation:

An equation can be solved and its solution proven using algebraic theorems and properties. To create a proof, form two columns. Label one side Statements and the other Reasons.

Begin your proof listing the any information given to you. List as the reason - Given.

Then list the next step which here would be to subtract by 11 on both side. The reason is Subtraction Property of Equality. Subtraction is the inverse of addition. Inverse axiom is another acceptable reason.

Then divide both sides by 2. The reason is Division Property of Equality or Inverse axiom once again. See the proof below.

Statements                       Reasons

1. 2x + 11 = 15                    1. Given

2. 2x = 4                            2. Subtraction Property of Equality

3. X = 2                              3. Division Property of Equality

Timmy has a box which is 3" wide, 4" long, and 2" high. Paul has a box whose dimensions are three times as wide, long, and high. How much more volume does Paul's contain?

Answers

Final answer:

The volume of a rectangular box is calculated by multiplying its dimensions. Timmy's box has a volume of 24 cubic inches. Paul's box, with dimensions three times larger, has a volume of 5832 cubic inches which is 5808 cubic inches more than Timmy's.

Explanation:

The volume of a rectangular box is found by multiplying its length, width, and height. In Timmy's case, the volume is 3" * 4" * 2" which equals to 24 cubic inches. Paul's box has dimensions that are three times larger, which means the volume is (3 * 3") * (3 * 4") * (3 * 2")  = 27 * 36 *6 = 5832 cubic inches. The difference in volume is 5832 - 24 which equals to 5808 cubic inches, so Paul's box has 5808 cubic inches more volume than Timmy's.

Learn more about volume here:

https://brainly.com/question/13338592

#SPJ12

Lines a and b are perpendicular. The slope of line a is −2. What is the slope of line b?

Answers

b= 1/2

perpendicular slopes are those that are opposite signs and reciprocal of the original given slope

Answer:

1/2

Step-by-step explanation:

When two lines whose scopes are m₁ and m₂ are perpendicular, then the product of the scopes of both lines is -1.

Therefore,

If m₁ is the scope of line a and m₂ is the scope of line b then,

m₁m₂ = -1 and m₁ = -2

-2m₂ = -1

m₂ = -1/-2 = 1/2

The slope of line b is 1/2.

Mars inc. says that until very recently yellow candies made up 20% of it's milk chocolate m&m's, red another 20%, and orange, blue, and green 10% each. the rest are brown. on his way home from work the day he was writing these exercises, one of the authors bought a bag of plain m&m's. he got 29 yellow ones, 23 red, 12 orange, 14 blue, 8 green, and 20 brown. is this sample consistent with the company's stated proportions? test an appropriate hypothesis and state your conclusion.

Answers

No.The company ratio is yellow:red:(orange+blue+green):brown as 2:2:1:5 while the packet's ratio is 29:23:34:20

Equivalent expression

Answers

Answer:

The answer is C. 9^-2

Step-by-step explanation:

Don’t know but not the first one

A bag of flour weighs 15 pounds. A shopkeeper has one bag of flour. She sells 1.065 pounds of flour every day. How much flour is left after 8 days?

Answers

1 bag = 15 p
1.065p each day

7 days = 1.065 * 7= 7.45
15-7.45=7.54

Simplify 13 2
the 2 is tiny so I think it's 13 to the power of 2

Answers

Answer: 169

Step-by-step explanation:

You just multiply 13 by 13

When simplifying 13 to the power of 2, you multiply 13 by itself, resulting in 13 x 13, which equals 169. This is known as squaring a number.

The question you've asked involves exponents, which is a way to express repeated multiplication of the same number. When you write 13 with a tiny 2 next to it, you're indicating that 13 should be multiplied by itself once, which is what squaring a number means. In other words, 13 to the power of 2 is 132, which is 13 × 13.

Let's simplify 132:

Multiply 13 by itself: 13 × 13.Calculate the product: 169.

So, 132 equals 169. This process is using an integer power, which involves multiplying the base (in this case, 13) by itself as many times as indicated by the exponent (in this case, 2). This can apply to any number, where for example 53 (5 cubed) equals 5 × 5 × 5, which is 125.

(3Q) Evaluate the logarithm.

Answers

Answer:

a. 5/3

that's your answer

ANSWER

[tex]a. \: \frac{5}{3} [/tex]

EXPLANATION

The given logarithm is

[tex] log_{8}(32) [/tex]

Rewrite both the base and the number as a power to base 2.

[tex]log_{8}(32) = log_{ {2}^{3} }( {2}^{5} ) [/tex]

Use the following property:

[tex] log_{ {a}^{q} }( {a}^{p} ) = \frac{p}{q} [/tex]

This implies that,

[tex]log_{8}(32) = log_{ {2}^{3} }( {2}^{5} ) = \frac{5}{3} [/tex]

IF QR IS TANGENT TO O, FIND X.

Answers

[tex] \tan(60°) = \frac{x}{OR} \\ \Leftrightarrow x = OR \tan(60°) = OP \sqrt{3} = 12 \sqrt{3} [/tex]

In the below system, solve for y in the first equation. x − 3y = −6 2x − 7y = 10

Answers

Answer:

[tex]y=\frac{1}{3}x+2[/tex]

Step-by-step explanation:

The given system of equation is;

[tex]x-3y=-6...(1)[/tex]

and

[tex]2x-7y=10...(2)[/tex]

To solve for y in the first equation; we add [tex]-x[/tex] to both sides.

[tex]-3y=-6-x[/tex]

We now divide through by -3;

This implies that;

[tex]y=\frac{1}{3}x+2[/tex]

Identify the graph of the equation. What is the angle of rotation for the equation?

xy=-2.5

Answers

Answer:

It is B. hyperbola, 45 degrees.

SteIt is p-by-step explanation:

If we rotate the standard form  x^2 - y^2 = 1 through 45 degrees we get xy = 1/2.

xy = -2.5 comes from x^2 - y^2 = -5  being rotated 45 degrees.

Answer:

The correct option is b

Step-by-step explanation:

The given equation is

[tex]xy=-2.5[/tex]

It can be written as

[tex]xy+2.5=0[/tex]              .... (1)

The general forms of conic is

[tex]Ax^2+Bxy+Cy^2+Dx+Ey+F=0[/tex]             .... (2)

From (1) and (2), we get

[tex]A=0,B=1,C=0,D=0,E=0,E=2.5[/tex]

[tex]B^2-4AC=1-4(0)(0)=1>0[/tex]

Since the value of B²- 4AC > 0, then it is hyperbola.

The formula form angle of rotation is

[tex]\tan 2\theta=\frac{B}{A-C}[/tex]

[tex]\tan 2\theta=\frac{1}{0-0}[/tex]

[tex]\tan 2\theta=\infty[/tex]

[tex]\tan 2\theta=\tan (90^{\circ})[/tex]

[tex]2\theta=90^{\circ}[/tex]

[tex]\theta=45^{\circ}[/tex]

The angle of rotation is 45°. Therefore the correct option is b.

Other Questions
Given: LM KN, KL NMLP = h1 = 5, MQ = h2 = 6 Perimeter of KLMN = 42 Find: Area of KLMN Please help me with this Find the distance between the points (5.5) and (3.7). Round your answer to the nearest tenth, if necessary. The length of a rectangle is 12 in. and the perimeter is 56 in. Find the width of the rectangle. PLEASE HELP!!If the measure of a central angle is 28, then to find the measure of its arc, you would need to do which of the following?Nothing, they are equal.Multiply the angle measure by 2.Divide the angle measure by 2. What do the words "We the People" in the beginning of the U.S. Constitution mean? What does it say about the authority of the U.S. Government? Which political organization was MOST associated with the "iron curtain" countries? A)OPEC B)NATO C)Warsaw Pact D)United Nations The transformation (x,y) (x+4,y-3 is performed on the segment AB.The imgae is the line segment AB where point A=(3,-3) and point B =(5,-3).What are the coordinates of A and B in the line segment AB The experimental probability of spinning a number greater than 3 is What does the quote the only way to get through a bigots door is to break it mean susan gets sick often and misses school as a result? which habit should she adopt? Coffee shops that reward customers with one free cup of coffee after every ten coffee purchases are using a ___________ reinforcement schedule. What company was credited with developing the first smartphone? the product of-5 and a number is greater than 35 or less than 10 Please help!!! Will mark brainliest!!! how is health care a problem in today's society 5 50/100 - 2 72/100= What is Hrxn for the following chemical reaction? CS2(g)+2H2O(l)CO2(g)+2H2S(g) You can use the following table of standard heats of formation (Hf) to calculate the enthalpy of the given reaction. Element/ Compound Standard Heat of Formation (kJ/mol) Element/ Compound Standard Heat of Formation (kJ/mol) H(g) 218 N(g) 473 H2(g) 0 O2(g) 0 H2O(l) 285.8 O(g) 249 CS2(g) 116.7 H2S(g) 20.60kJ C(g) 71 CO2(g) 393.5kJ C(s) 0 HNO3(aq) 206.6 Express the standard enthalpy of reaction to three significant figures and include the appropriate units. View Available Hint(s) Why are publicly traded corporations required to release financial reports on a regular basis?A. because shareholders are entitled to transparencyB. so the government can determine the corporate taxes owedC. so owners know when it is time to hire a new board of directorsD. because it would be impossible to raise financial capital otherwise Find the slope of the line. 5x 2y = 7 Steam Workshop Downloader