find the polynomial standard form of -5q^2(-q-5)​

Answers

Answer 1

Answer:

5q^3+25q^2

Step-by-step explanation:


Related Questions

Use the data to answer the Question below.
Size of shoe:8,7,8.5,6.5,5,11,15,8,8,7.5,6.5,8,14,12

Answers

Answer:

Step-by-step explanation:

Mean: 8 + 7 + 8.5 + 6.5 + 5 + 11 + 15 + 8 + 8 + 7 + 7.5 + 6.5 + 8 + 14 + 12 = 132 / 15 = 8.8

Median: You have to arrange the numbers first in ascending order.

5, 6.5, 6.5, 7, 7, 7.5, 8, 8, 8, 8, 8.5, 11, 12, 14, 15

The median is 8 because that is the middle value/number.

Mean Absolute Deviation:

Get the average/mean (1), find the deviation (2) to get MAD (3).

Step #1 Mean = 8.8

Step #2 To get the deviation, you subtract the mean from the values given.

8 - 8.8 = -0.8

7 - 8.8 = -1.8

8.5 - 8.8 = -0.3

6.5 - 8.8 = -2.3

5 - 8.8 = -3.8

11 - 8.8 = 2.2

15 - 8.8 = 6.2

8 - 8.8 = -0.8

8 - 8.8 = -0.8

7 - 8.8 = -1.8

7.5 - 8.8 = -1.3

6.5 - 8.8 = -2.3

8 - 8.8 = -0.8

14 - 8.8 = 5.2

12 - 8.8 = 3.2

Step #3 Get the summation from step #2, and get its average. Disregard the negative signs.

0.8 + 1.8 + 0.3 + 2.3 + 3.8 + 2.2 + 6.2 + 0.8 + 0.8 + 1.8 + 1.3 + 2.3 + 0.8 + 5.2 + 3.2 = 33.6 / 15 = 2.24 is the Mean Asolute Deviation

Median Absolute Deviation:

Get the median (1) and subtract it from the values (2). Get the median of the new values (3)

Step #1 Median = 8

Step #2

8 - 8 = 0

7 - 8 = -1

8.5 - 8 = 0.5

6.5 - 8 = -1.5

5 - 8 = -3

11 - 8 = 3

15 - 8 = 7

8 - 8 = 0

8 - 8 = 0

7 - 8 = -1

7.5 - 8 = -0.5

6.5 - 8 = -1.5

8 - 8 = 0

14 - 8 = 6

12 - 8 = 4

Step #3 Arrange the numbers in ascending order.

-3, -1.5, -1.5, -1, -1, -0.5, 0, 0, 0, 0, 0.5, 3, 4, 6, 7

The Median Absolute Deviation is 0 since it is the middle value/number.

It is important that you calculate this by yourself in case I did some careless mistakes.

The employees of a company have different hobbies.

14 men who like playing golf
6 women who like playing golf
2 men who like running
18 women who like running

Which of the following statements is correct?

A.
For every woman who likes running, 9 women like playing golf.
B.
For every woman who likes running, 7 women like playing golf.
C.
For every man who likes running, 3 men like playing golf.
D.
For every man who likes running, 7 men like playing golf.

Answers

Final answer:

Among the given options, statement D, which says 'For every man who likes running, 7 men like playing golf,' is the correct statement based on the numbers provided.

Explanation:

In order to determine which statement is correct, we would need to relate the numbers given in the question. So let's take a look.

We have 14 men who like playing golf and 2 men who like running. So for each man that likes running, there are 14/2 = 7 men who like playing golf.We have 6 women who like playing golf and 18 women who like running. So for each woman that likes running, there are 6/18 = 1/3 women who like playing golf. This does not match either statement A or B. So we can rule them out.

With this comparison, we can conclude that the correct statement is D. For every man who likes running, 7 men like playing golf.

Learn more about Ratio and Comparison here:

https://brainly.com/question/31815139

#SPJ12

Final answer:

The correct statement is option B: for every woman who likes running, 3 women like playing golf.

Explanation:

In order to determine which statement is correct, we would need to relate the numbers given in the question. To determine which statement is correct, we need to compare the ratio of women who like running to women who like playing golf.

There are 18 women who like running and 6 women who like playing golf.

Therefore, the correct statement is option B, which states that for every woman who likes running, 3 women like playing golf.

Learn more about Ratio of women who like running to women who like playing golf here:

https://brainly.com/question/19298845

#SPJ12

Keira goes shopping at a supermarket

Answers

Keira spends approximately $119.12 on food.

To find the fraction of Keira's total spending on petrol, we need to determine the total amount she spent on all items and then calculate the fraction spent on petrol.

Total amount spent on all items (T): We'll use algebra to find the total amount Keira spent.

Fraction spent on other items and clothes: Given Keira spends 1/9 of the money on other items and 1/5 of the money on clothes, we'll find the combined fraction spent on other items and clothes.

Fraction spent on petrol: Subtract the fraction spent on other items and clothes from 1 to find the fraction spent on petrol.

Amount spent on food: Subtract the amounts spent on petrol, other items, and clothes from the total amount to find the amount spent on food.

Total amount spent on all items (T): Let T represent the total amount spent.

Fraction spent on other items and clothes:

[tex]\[ \frac{1}{9} + \frac{1}{5} = \frac{5}{45} + \frac{9}{45} = \frac{14}{45} \][/tex]

Fraction spent on petrol:

[tex]\[ 1 - \frac{14}{45} = \frac{31}{45} \][/tex]

Amount spent on food:

  [tex]\[ \text{Amount spent on food} = T - (45 + \frac{1}{9} \times T + \frac{1}{5} \times T) \] \[ \text{Amount spent on food} = T - (45 + \frac{14}{45} \times T) \] \[ \text{Amount spent on food} = \frac{31}{45} \times T \][/tex]

Now, to find the value of T, we solve the equation:

[tex]\[ \frac{31}{45} \times T = 45 + \frac{14}{45} \times T \]\[ \frac{31}{45} \times T - \frac{14}{45} \times T = 45 \]\[ \frac{17}{45} \times T = 45 \]\[ T = \frac{45 \times 45}{17} \]\[ T \approx 119.12 \][/tex]

So, Keira spends approximately $119.12 on food.

The complete question is:

Keira goes shopping at a supermarket. the pie chart below shows information about the money she spends on petrol, clothes, food and other items. what fraction does she spend on petrol? if keira spends $45 on petrol, 1 9 of the money on other items and 1 5 of the money on clothes. how much money does she spend on food? $

Help anyone on these 3 problems

Answers

Answer:

5) a) complementary

6) b) supplementary

7) c) vertical angles

Step-by-step explanation:

5)

The sum of the complementary angles = 90 degrees

According to the graph, both angles add up to 90 degrees

Answer: a) complementary

6)

Straight angle is equal 180 degrees

The sum of the supplementary angles = 180 degrees

Answer: b) supplementary

7)

Vertical Angles are the angles opposite each other when two lines cross. The vertical angles are congruent.

Answer: c) vertical angles

Answer:

5. a) complementary; 6. b) supplementary; 7. c) vertical angles

Step-by-step explanation:

Question 5

The sum of the two angles is 90°.

The angles are complementary.

Question 6

x° + 62° = 180°

The angles are supplementary angles.

Question 7

The angles are opposite each other where the two lines cross.

∴ They are vertical angles.

Note: "Vertical" in this context doesn't mean "up-and-down." It means the angles share the same vertex (corner point).

The graph shown represents the rule y =x + 1.5

Answers

Answer:

Step-by-step explanation:

the fraction 7/9 produces a repeating decimal. True or false

Answers

Answer:

True

Step-by-step explanation:

anything over 9 that is not 9 is a repeating decimal

Answer:

True

Step-by-step explanation:

7/9 = 0.777777777778

fill in the table the coordinates of B with the information missing about the different transformations of ABC which of the following represents the correct sequence of coordinates to fill in the table above?​

Answers

Answer: C. (3,-2) (-6,-9) (-6,9) (-9,6) (9,6)

The coordinates of B with the information missing about the different transformations of ABC will be (3,-2) (-6,-9) (-6,9) (-9,6) (9,6).

What are coordinates?

It should be noted that coordinates simply mean a set of values that simply show an exact position.

In this case, the coordinates of B with the information missing about the different transformations of ABC will be (3,-2) (-6,-9) (-6,9) (-9,6) (9,6). This is important to determine the position of the points.

Learn more about coordinates on:

https://brainly.com/question/17206319

#SPJ2

what is one point that lies in the solution set of the system of inequalities graphed?​

Answers

(0,4) because its the coordinates where the lines intersect

Answer:

C) (-3,3)

Step-by-step explanation:

The solution set is the region of intersection of the blue shaded region and the red shaded region.

We plot the given points, and the only one that falls within the solution set is  (-3,3).

write 2 over 8 in simplest form

Answers

Answer:

1/4

Step-by-step explanation:

Divide the top and the bottom by 2 to get the simplest form.

2 / 2 = 1

8 / 2 = 4

2/8 = 1/4

The answer is 1/4 because 2 can be divided by itself and 8 can also be divided by 2 so 2/8=1/4

If one paperclip has the mass of 1 gram and 1,000 paperclips have a mass of 1 kilogram, how many kilograms are 8,000 paperclips?

A. 8 kg.
B. 80 kg.
C. 800 kg.
D. 8,000 kg.

Answers

Answer:

A. 8kg

Step-by-step explanation:

You don't really need any solution but if

1000 paperclips = 1 kg, then

8000 paperclips = 8kg

Final answer:

To determine the mass of 8,000 paperclips in kilograms, divide 8,000 by 1,000, since 1,000 paperclips weigh 1 kilogram. The result is 8 kilograms, making option A the correct answer.

Explanation:

The question concerns the mass of paperclips in grams and kilograms, which are units of mass in the metric system. To find out how many kilograms 8,000 paperclips would weigh, we need to use the given conversion that 1,000 paperclips have a mass of 1 kilogram. Here's the step-by-step calculation:

Since 1,000 paperclips weigh 1 kilogram, we can find out how many groups of 1,000 paperclips there are in 8,000 paperclips by dividing 8,000 by 1,000.

8,000 paperclips ÷ 1,000 paperclips/kg = 8 kg

Therefore, 8,000 paperclips have a mass of 8 kilograms.

The correct answer to the question is A. 8 kg.

Add. Simplify the answer and write as a mixed number if appropriate 4/5+ 3/10+ 1/2 =

Answers

Answer: 1 and 3/5

Step-by-step explanation: The common denominator is 10. So, in order for everything to have a denominator of 10, we need to multiply a few things.

4 x 2 = 8

5 x 2 = 10

1 x 5 = 5

2 x 5 = 10

With that out of the way, we can finally move on to figure out the answer.

8/10 + 3/10 + 5/10 = 16/10. The question asks to write as a mixed number, if necessary. And it is. So:

10 goes into 16 once, with 6 left over, so 1 and 6/10. the fraction can be reduced, so we do that. Because 2 goes into 6 (3 times), and 2 goes into 10 (5 times), that leaves us with a final answer of 1 and 3/5.

Final answer:

To add 4/5, 3/10, and 1/2, first find a common denominator, which is 10. Convert the fractions to 8/10, 3/10, and 5/10, add them to get 16/10, which simplifies to 1 6/10, and then further simplify to the mixed number 1 3/5.

Explanation:

To add the fractions 4/5, 3/10, and 1/2, we need a common denominator. The least common multiple of the denominators 5, 10, and 2 is 10. Thus, we convert each fraction to an equivalent fraction with a denominator of 10. The converted fractions are 8/10, 3/10, and 5/10.

Next, we add the numerators: 8 + 3 + 5 = 16. The sum of the fractions is 16/10, which simplifies to 1 6/10 by dividing 16 by 10. Finally, we can simplify the fraction 6/10 to 3/5 because both the numerator and the denominator can be divided by 2. Therefore, our final answer is 1 3/5.

Selena makes one million dollars annually and gets paid biweekly. What is her biweekly paycheck?

Answers

Answer:

Her biweekly paycheck is 38358.26

Step-by-step explanation:

As we know that there are 52.14 weeks in a year

So weekly paycheck will be 1000000 / 52.14 = 19179.13

Since she gets biweekly check so we multiply it with 2

19179.13 * 2 = 38358.26

Her biweekly paycheck is 38358.26

Which expression is equivalent to 30m2+12m+18?? Please help ASAP !

Answers

Answer:

c) 6(5m2+2m+3)

Step-by-step explanation:

Given expression = 30m2 + 12m + 18

The simplified form can be calculated by taking GCF

The GCF of 30m2, 12m and 18 is = 6

Therefore, the expression becomes

(6*5m2 + 6*2m + 6*3)

=> 6(5m2+2m+3) so option c is correct

−2x = 4y + 6 2(2y + 3) = 3x − 5 What is the solution (x, y) to the system of equations above

Answers

Answer:

(1;-2)

Step-by-step explanation:

x=-2y-3

2(2y+3)=-6y-9-5

10y=-20

y=-2

x=4-3=1

The price of a toy usually costing £50 is increased to £65
Work out the percentage increase.

Answers

Percentage increase is 30% increase.

The value of the percentage increase would be 30 percent.

Used the concept of the percentage that states,

A number or ratio that can be expressed as a fraction of 100 or a relative value indicating the hundredth part of any quantity is called a percentage.

Given that,

The price of a toy usually costing £50 is increased to £65.

Hence, the increased price is,

£65 - £50 = £15

So, the percentage increase would be,

[tex]P = \dfrac{\£15}{\£50} \times 100\%[/tex]

[tex]P = \dfrac{1500}{50}\%[/tex]

[tex]P = 30\%[/tex]

Therefore, the percentage increase is 30%.

To learn more about percentage visit:

https://brainly.com/question/24877689

#SPJ7

find the solution of the following system of equations by graphing y=-2x-1 y=-x-1​

Answers

Answer:

(0,-1)

Step-by-step explanation:

The solution to the system of linear equation is (0, -1)

What is the solution to the system of equations?

To solve for the system of linear equations, we can use substitution method;

y = -2x - 1 ...eq(i)

y = -x - 1 ...eq(ii)

Equate both equations

-x - 1 = -2x - 1

-x = -2x

This shows it can not be solved by any other means except graphically.

To solve this equation graphically, we can plug in the equations and then find the point of intersection;

Kindly find the attached graph below

The solution to the system of equation is (0,-1)

Learn more on system of linear equations here;

https://brainly.com/question/28866068

#SPJ2

What is the measure of the angle RUS?

Answers

Answer:

the answer is 90 degrees

Step-by-step explanation:

angle PT=18

180-39-23-28=90

Answer:

Step-by-step explanation:

90

Please help... What is the exact volume of the sphere?
56.3⎯⎯π ft³
274.625π ft³
366.16⎯⎯π ft³
1464.6⎯⎯π ft³

Answers

Answer:

[tex]\large\boxed{V=366.16\pi\ ft^3}[/tex]

Step-by-step explanation:

[tex]\text{The formula of a volume of a sphere:}\\\\V=\dfrac{4}{3}\pi R^3\\\\\text{We have}\ R=6.5\ ft.\ \text{Substitute:}\\\\V=\dfrac{4}{3}\pi(6.5)^3=\dfrac{4}{3}\pi(274.625)=\dfrac{1098.5}{3}\pi\approx366.16\pi\ ft^3[/tex]

Find the surface area of a cylinder with a height of 9 inches and base radius of 4 inches.

Answers

The surface area of the cylinder is 326.56 square inches.

For the surface area (SA) of a cylinder, you can use the formula:

SA = 2π[tex]r^2[/tex]+ 2πrh

where:

r is the radius of the baseh is the heightπ is a mathematical constant approximately equal to 3.14

Given that the height (h) is 9 inches and the base radius (r) is 4 inches, you can substitute these values into the formula:

SA = 2 × 3.14 × [tex](4)^2[/tex]+ 2 × 3.14 × 4 × 9

SA = 2 × 3.14 × 16 + 2 × 3.14 × 36

SA = 100.48 + 226.08

SA = 326.56

Therefore, the surface area of the cylinder is

326.56 square inches.

Please help me

A wooden fruit crate will hold 62 pounds of fruit. The crate already has 18 pounds of fruit inside of it. Which inequality represents the solution set that shows the pounds of fruit, p, that can be added to the crate?
A) p ≥ 44
B) p ≤ 44
C) p ≤ 80
D) p ≥ 80

Answers

Answer:

b

Step-by-step explanation: 62-18 is 44 and 44 is greater than 18

Answer:

B) p ≤ 44 is your ANSWER

Step-by-step explanation:

There are 100 calories in 8 fluid ounces of orange juice and
140 calories in 8 fluid ounces of pineapple juice. Tia mixed 4 fluid ounce
of each juice. Write and solve an equation to find the number of calories
in each fluid ounce of Tia's juice mixture.

Answers

Number of calories in 8 ounces of orange juice = 100

Number of calories in 1 ounce of juice = [tex]\frac{100}{8}[/tex]

Number of calories in 4 ounces of juice = [tex]\frac{100}{8}*4=50[/tex] calories

Number of calories in 8 ounces of pineapple juice = 140

Number of calories in 1 ounce of juice = [tex]\frac{140}{8}[/tex]

Number of calories in 4 ounces of pineapple juice =

[tex]\frac{140}{8}*4=70[/tex] calories

Now the mixture has 50+70 = 120 calories in 8 ounce.

So, 1 ounce of mixture has = [tex]\frac{120}{8}= 15[/tex] calories.

Final answer:

To find the number of calories in Tia's juice mixture, we set up an equation based on the given information. Solving the equation, we find that there are 4 calories in each fluid ounce of Tia's juice mixture.

Explanation:

To find the number of calories in Tia's juice mixture, we can set up an equation based on the information provided. Let's say x represents the number of calories in each fluid ounce of orange juice, and y represents the number of calories in each fluid ounce of pineapple juice. Since Tia mixed 4 fluid ounces of each juice, the total number of calories in the mixture would be 4x + 4y. We know that there are 100 calories in 8 fluid ounces of orange juice and 140 calories in 8 fluid ounces of pineapple juice. We can set up the equation:

100 calories = (8/4)x

140 calories = (8/4)y

Simplifying the equations, we have:

25x = 100

35y = 140

Solving for x and y, we find:

x = 4

y = 4

Therefore, there are 4 calories in each fluid ounce of Tia's juice mixture.



Learn more about Calories in Juice Mixture here:

https://brainly.com/question/12386274

#SPJ3

Can someone please solve this problems? Please!

Answers

1. Answer:  [tex]\bold{\dfrac{188}{3}}[/tex]

Step-by-step explanation:

[tex]\dfrac{y_4-y_1}{x_4-x_1}=\dfrac{128-316}{4-1}=\large \boxed{-\dfrac{188}{3}}\\\\\\\text{The negative sign represents "decrease".}[/tex]

2. The parent graph is y = | x |

a)  Shifted down 3 units

b) vertex = (0, -3)

c) Equation: y = | x | - 3

3. The parent graph is y = x²

a) Shifted right 1 and down 1 unit

b) vertex = (1, -1)

c) Equation: y = (x - 1)² - 1

what is the value of the expression?
2 1/4 divided by 1 2/5

Answers

Answer:

45/28

Step-by-step explanation:

Convert them to mixed fractions

(2 * 4 + 1) / 4 ÷ (1 * 5 + 2) / 5

8 + 1 / 4 ÷ 5 + 2 / 5

9/4 ÷ 7/5

Flip the second fraction and flip the sign - to multiply.

9/4 × 5/7

9 × 5 = 45

4 × 7 = 28

45/28

This could be left as a fraction or converted to a number:

1.60714285714

Answer:

The Answer is 1 17/28

Step-by-step explanation:

1) turn the mixed fraction into a regular fraction

2 1/4 divided by 1 2/5 = 9/4 divided by 7/5

2) Then Multiply

9/4 X 7/5= 45/28 (Straight across)

3) Simplify 45/28

Give you 1 17/28

Hopes this helps!

I don't understand what im supposed to find? Isnt the math correct?​

Answers

Answer:

Step-by-step explanation:

Yes the math is correct. But the A part asks for the interest. The interest is 795.96 and that is what her account is worth. She thinks the interest is 3795.96, but it's not. She's added the bare principle in a second time.

Account amount = 3795.96

Interest = 795.96

what is the volume of a sphere with the radius of 3 cm round to the nearest cubic centimeter​

Answers

Answer:

Step-by-step explanation:

(4/3)*[tex]\pi[/tex]*r^3

V = 113,04

Best regards

find the total area of this object

Answers

There are 2 triangles.

Area of a triangle is 1/2 x base x height = 1/2 x 4 x 3 = 6 square units each.

6 x 2 = 12 square units.

There is 1 rectangle 3 x 10 = 30 square units.

There is 1 rectangle 5 x 10 = 50 square units.

5 is the hypotenuse of the triangle found by using the Pythagorean theorem.

There is 1 rectangle 4 x 10 = 40 square units.

Total surface area = 12 + 30 + 50 + 40 = 132 square units.

What is the value of the y coordinate of the solution to the systems of equations x+2y=9 and x-y=3

Answers

Answer:

y = 2

Step-by-step explanation:

(1) x  + 2y = 9

(2) x  -   y = 3

Subtract (2) from (1)

3y = 6

 y = 2

The y-coordinate is y = 2.

The graphs of the two equations intersect at (5, 2).

Answer:

6

Step-by-step explanation:

Minus both from each other;

x=2y=9

x-y=3

x cancels, 2y-y= y; 9-3=6

Therefore; y=6

The formula for the circumference of a circle C equals two pi R where are is the radius and see is the circumference equation solve for our is our equals C over two pi find the radius of the circle that has a circumference of 16 pi

Answers

Answer:

8

Step-by-step explanation:

The question is basically "Find the radius of the circle that has a circumference of 16π"

The formula for circumference of a circle is given as  [tex]C=2\pi r[/tex]

Where

C is the circumference

r is the radius

Plugging in 16π into C and solving for r gives us the radius. Shown below:

[tex]C=2\pi r\\16\pi = 2\pi r\\r=\frac{16\pi}{2\pi}\\r=8[/tex]

the radius is 8

need help, what’s the answer?

Answers

Step-by-step explanation:

This is a simple angle problem, and what we need to do is subtract 73-44. This is because if we subtract the angles we already have, we will get the angle that we are trying to solve. The answer would be 29.

Catherine has $400 in her checking account. She writes a check for $600. What is the balance in her account?
–$1,000
–$200
$1,000
$200

Answers

Answer:

-200

Step-by-step explanation:

400 - 600 = -200

Answer:

-200

Step-by-step explanation:

600-400=-200

Other Questions
After the gaps between the firm's labor supply and labor demand are identified, a firm should ________. develop and implement action plans conduct a workforce analysis identify its business strategy articulate its talent philosophy and strategic staffing decisions The primary advantage quick-service restaurants have over other restaurant types is URGENT! Which of the following correctly expresses sin(2)sin(6) as a product?Select the correct answer below:2sin(4)cos(2)2sin(2)cos(4)2sin(2)cos(4)2sin(2)sin(4) What are some ideas that i would put for a visual project (power point) on NRA civil rights issues. please idc if you guys get political as long as i can put them in the power point. Identify Cause and Effect How did World War I affect the role of women in society? Subtract 6 ounces from 3 pounds.5 lb., 7 oz.6 lb., 3 oz.2 lb., 10 oz.2 lb., 13 oz. Which type of function is the result of adding a quadratic function and a linear function?A. a linear functionB. a quadratic functionC. a rational functionD. a cubic function PLZ HURRY IT'S URGENT!!!!This is the equation for the formation of sodium chloride from sodium bromide. Cl2 + 2NaBr Br2 + 2NaCl Which are the reactants and the products in this reaction? A. The reactants are Cl2 (chlorine) and NaBr (sodium bromide). The products are Br2 (bromine) and NaCl (sodium chloride). B. The reactants are Br2 (bromine) and NaCl (sodium chloride). The products are Cl2 (chlorine) and NaBr (sodium bromide). C. The reactants are Cl2 (chlorine) and Br2 (bromine). The products are NaBr (sodium bromide) and NaCl (sodium chloride). D. The reactants are NaBr (sodium bromide) and NaCl (sodium chloride). The products are Cl2 (chlorine) and Br2 (bromine). Compro caf en la plaza de comida en Cuba. Yo pago el caf con _____________. (1 point)pesosdlareseurosbolvares Choose the best mode of transportation. Para ir a Panam, debes viajar en _____. carro avin tren taxi Let u= ln x and v=ln y. Write ln(x^3y^2) in terms of u and v. Hey can someone answer this ASAP Select the correct answer. Which European country Established colonial rule in parts of South America? The number of births that occur in a period of time in a given area is called? Birth rate death rate life expectancy During the colonial era, Britains policy of mercantilism primarily affected the economy and commerce of the thirteen colonies. culture and society of the thirteen colonies. religious institutions of the thirteen colonies. politics and government of the thirteen colonies. Help ASAP!!!!!!!!!!!!!!!!!!! If the Laffite family deposits $8500 in savings account at 6.75% interest, compounded continuously, how much will be in the account after 25 years Which function is represented by the graph f(x)= -|x|+4f(x)= -|x|-4f(x)= -|x+4|f(x)= -|x-4| Es triste que t _____ las costumbres locales que no entiendes A. Juzgues B. Juzgue C. JuzgaD. Juzgas Length of the missing leg is:Pythagorean theorem - Integers - Find the missing legPLEASE HELP(need to show work)Im so confused!! Steam Workshop Downloader