Gina invests $1,677 in an account paying 8.61% simple interest annually. How much interest has Gina gained after six years? a. $668.65 b. $240.65 c. $866.34 d. $2,543.34

Answers

Answer 1

Answer:

Option (c) is correct.

The interest gained by Gini in 6 years is $ 866.34

Step-by-step explanation:

Given: Gina invests $1,677 in an account paying 8.61% simple interest annually for 6 years.

We have to calculate the interest gained by Gina in 6 years.

Using formula for simple interest

[tex]S.I.=\frac{P\times I\times T}{100}[/tex]

Where,

S.I = simple interest

P is principal

R is interest rate

T is time  

Given : P = $ 1677

R = 8.61%

T = 6 years

Substitute, we get,

[tex]S.I.=\frac{1677\times 8.61\times 6}{100}[/tex]

Simplify, we get,

S.I. = $ 866.3382

Rounding off to nearest hundred  we get, Interest is $866.34

Thus, the interest gained by Gini in 6 years is $ 866.34

Answer 2

Gina has gained $866.34 in interest after six years.

To find the interest gained, we can use the formula: Interest = Principal * Rate * Time. In this case, the principal is $1,677, the rate is 8.61%, and the time is 6 years. Plugging these values into the formula, we get: Interest = $1,677 * 0.0861 * 6 = $866.34. Therefore, Gina has gained $866.34 in interest after six years.

Learn more about Simple Interest here:

https://brainly.com/question/32543341

#SPJ6


Related Questions

Vanessa deposited money into a bank account that earned 1.25% simple interest each year. After 1/2 year, she had earned $5.00 in interest on the account. If no other money was deposited into or withdrawn from the account, how much was her initial deposit? Uhh... I was just testing...oops

Answers

so the answer is 800. I guarantee you this will be the answer I promise

Final answer:

Vanessa's initial deposit in the bank, earning 1.25% simple interest per year, was $800. This is calculated using the simple interest formula, rearranged to solve for the principal based on the $5 interest earned in half a year.

Explanation:

To find Vanessa's initial deposit, we use the simple interest formula, which is Interest = Principal × Rate × Time. Given Vanessa earned $5.00 in interest in half a year (0.5 years) at a rate of 1.25% per annum, we can rearrange the formula to solve for the principal (initial deposit).

Using the given information: $5 = Principal × 0.0125 × 0.5, we can solve for the Principal as follows:

$5 = Principal × 0.00625
Principal = $5 ÷ 0.00625
Principal = $800

Therefore, Vanessa's initial deposit was $800.

what does the 2 represent in 12.789

Answers

(Tens digit)(Ones digit) . (tenths digit)(hundredths digit)(thousandths digit)
12.789
2 = (ones digit)

Hope this helps!
It is a whole number in the one digits place
:)

Determine if the equations are intersecting, parallel, or coincident. bx - ay = 2 ax + by = 3

Answers

The equations are parallel because the slopes of the two lines are equal. 
The equations are parallel

Answer:

Intersecting

Step-by-step explanation:

After having singled out y on one side of both equations you should have.

Y=b/a• x - 2/-a

And

Y= -a/b • x + 3/b

As you can see they have opposite reciprocals which is an intersection

70 is 25% of what number

Answers

I hope this helps you



70=?.25%


70=?.25/100


70=?.1/4


?=280

A new law requires that 12% of an individual's income be invested in the stock market. Your accounts show that you need to put $420 in the stock market this year. How much did you earn this year.
A $5,040 B $350 C $504** D $3,500

Answers

Final answer:

The problem can be solved by setting up the equation 0.12x = $420, where 'x' stands for your total income. Dividing both sides of the equation by 0.12 gives x = $3500 which is the total annual income. Thus, you earned $3,500 this year.

Explanation:

To solve this mathematical problem, you can set up an equation that represents the problem context. You know that 12% of your whole year's income equals $420. So if 'x' represents your total income, the equation becomes 0.12x = $420. To solve for 'x' (your total income), you would divide both sides of the equation by 0.12.

So, x = $420 ÷ 0.12. When you perform this calculation, you'll find that 'x' equals $3,500. Therefore, you earned $3,500 this year.

The answer to the problem is D. $3,500.

Learn more about Percentage here:

https://brainly.com/question/35647344

#SPJ12

What is the surface area of this design

Answers

6 × 8^2 = 384.
hope it helps

Answer:

[tex]384\ in^{2} \\[/tex]

Step-by-step explanation:

Hello

according to the graph the figure is a cube, which has 6 square faces of 8 inches each side,the total area will be equal to the area of ​​one of these faces multiplied by 6

Area of a square=side* side

Area of square= 8 in * 8 in

[tex]Area = 64\ in^{2}  \\[/tex]

Now, the total area is

[tex]Tarea=6*64\ in^{2} \\Tarea=384\ in^{2}[/tex]

1 in= 1 inch = 2.54 cm

have a fantastic day

Which expression is equivalent to 3(x + 4y)?




6x + 16y




3x + 12y




8x + 24y




x + 4y

Answers

Just distribute the 3. 3(x + 4y) = 3x + 12y

3x + 12y is the answer.

There are 132 people seated in the school auditorium for an assembly.  There are 6 rows in the auditorium, each with the same number of seats.  If the auditorium is completely filled, how many seats are there in each row?

Answers

You do 132 ÷ 6 which is 22, so that is the answer. This is because if you the auditorium is filled, then there are a total of 132 seats. If there are 6 rows, then there have to be 22 seats each row to make 132 seats. I hope this helps!
The answer is 22 seats in each row.

Explanation:
132÷6=22

Hope it helps!

A triangle has side lengths of 12 cm, 35 cm, and 37 cm. Classify it as acute, obtuse, or right.
acute
obtuse
right

Answers

when you draw triangle
the answer is so easy
it is acute
If a triangle has the side lengths of 12cm, 35cm, and 37cm then the triangle will be acute!

Wren bought a baseball card last year for $2.25. this year the price dropped to $.45. what was the percent of decrease in the price of the card?
a. 80%
b. 400%
c. 500%
d. 120%

Answers

The answer is A. 
80%
I hope this helps! :) 

Answer:

a. 80%

Step-by-step explanation:

The percent of decrease can be calculated as:

[tex]Percentage Decrease = \frac{Initial price - Final Price}{ Initial Price}*100 [/tex]

Then, replacing initial price for $2.25 and final price for $.45 we get:

[tex]Percentage Decrease = \frac{2.25 - 0.45}{2.25} *100[/tex]

percentage of decrease = 80%

Finally the percentage of decrease in the price of the card is 80%

Eric reflected parallelogram ABCD across the x-axis. If angle A is 125° and angle B is 55°, what is the degree measurement of angle A'?

Answers

the answer simple;
the degree measurement of angle A' = 125°



Answer:

Angle A= Angle A' = 125°

Step-by-step explanation:

We have given that : Eric reflected parallelogram ABCD across the x-axis.

                                  If angle A is 125° and angle B is 55°

To find :  Degree measurement of angle A'

Solution :

As it is reflected parallelogram , and by property of reflection it form congruent parallelogram

since it is congruent then measures of angle remain same

by this statement the measure of angle of parallelogram ABCD

remain same or equal to parallelogram A'B'C'D'

⇒Angle A= angle A' = 125°

Which of the following statements is true of chords?

A chord is a line segments.A chord connects two points on a circle.A chord can be a radius of a circle.A chord can be a diameter of a circle.A chord divides a circle into two regions

Answers

All of those are true, except the one about the radius.  Because alternate definition of diameter uses the idea of chord. So, both ends of a chord have to be on the circle, but one end of a radius is at the center, so a radius can't be a chord.

Factor -9x^2-36x-36 please.

Answers

Tricky Trinomial
-9x^2-36x-36
(-9x^2-18x)(-18x-36)
-9x(x+2)-18(x+2)
=(-9x-18)(x+2)
factor out -9
-9(x^2+4x+4)
what 2 numbers multiply to 4 and add to 4
 2 and 2

-9(x+2)(x+2)

What are odd numbers 1-35?

Answers

1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35
Is that what you meant.
Odd numbers between 1 and 35 are: 1, 3, 5, 7, 9, 11, 13, 15, 17, 19, 21, 23, 25, 27, 29, 31, 33, 35. So, you count every second number, because the remaining numbers are even numbers.

Is the number 53 a prime number or a composite number

Answers

composite number.........

Answer:

It's prime:)

Step-by-step explanation:

Simplify each given equation and show your work. Tell whether it has one solution, an infinite number of solutions, or no solutions, and identify each equation as an identity, a contradiction, or neither. Explain your answers.
(a)6x + 2(2x – 3) = 24 + 9x
(b)25 – 4x = 3(5 – x) + 10 – x
(c)4(x + 2) = 2x + 7 + 2(x – 10)

Answers

a) The answer is one solution, neither

6x + 2(2x - 3) = 24 + 9x
6x + 2 * 2x + 2 * (-3) = 24 + 9x
6x + 4x - 6 = 24 + 9x
10x - 6 = 24 + 9x
10x - 9x = 24 + 6
x = 30

b) The answer is infinity solutions, identity
25 – 4x = 3(5 – x) + 10 – x
25 - 4x = 3 * 5 - 3 * x + 10 - x
25 - 4x = 15 - 3x + 10 - x
25 - 4x = 25 - 4x
4x - 4x = 25 - 25
0x = 0

x can be any number, so an infinite number of solution

c) The answer is no solution, contradiction

4(x + 2) = 2x + 7 + 2(x – 10)
4 * x + 4 * 2 = 2x + 7 + 2 * x - 2 * 10
4x + 8 = 2x + 7 + 2x - 20
4x + 8 = 4x - 13
4x - 4x = - 8 - 13
0 = -13

this is contradiction

Which fraction shows a correct way to set up the slope formula for the line that passes through the points (3,7) and (5,7)?

Answers

The slope of a line through the points (3,7) and (5,7) is 0, indicating a horizontal line.

To calculate the slope of a line passing through two points, you can use the formula m = (y2 - y1) / (x2 - x1), where (x1, y1) and (x2, y2) are the coordinates of the two points. In this case, the points are (3,7) and (5,7). Using the slope formula, we get:

m = (7 - 7) / (5 - 3) = 0 / 2 = 0

So, the slope of the line that passes through these points is 0, which means the line is horizontal.

HELP!!

Lily just paid off a $400 loan. She had to pay $60 in interest at a simple annual interest rate of 5%. How many years did Lily have this loan?

A. 2
B. 3
C. 4.5
D. 5

Answers

I=prt,,60=400*0.05t,,t=3 ..................

Answer:  The correct option is (B) 3.

Step-by-step explanation:  Given that Lily  just paid off a $400 loan. She had to pay $60 in interest at a simple annual interest rate of 5%.

We are to find the number of years for which Lily had this loan.

Let n be the required number of years.

Also, P = $400, S.I. = $60 and r% = 5%.

Therefore, by the formula of simple interest, we have

[tex]S.I.=\dfrac{Prn}{100}\\\\\\\Rightarrow 60=\dfrac{400\times5\times n}{100}\\\\\\\Rightarrow n=\dfrac{60}{20}\\\\\\\Rightarrow n=3.[/tex]

Thus, the required number of years is 3.

Option (B) is CORRECT.

sin10+sin20+sin40+sin50=sin70+sin80.prove it

Answers

We are going to prove it like this:
Lets use the formula sinA+sinB=2sin(A+B/2)cos(A-B/2)
 Now we are going to take the left side of equation
sin10+sin40+sin50+sin20
 Arranging =(sin50+sin10)+(sin40+sin20)
Applying the above formula. =2sin(50+10/2)cos(50-10/2)+2sin(40+20/… =2sin(30)cos(20)+2sin(30)cos(10)
=2sin30{cos20+cos10}
Again using the formula
cosA+cosB= 2cos(A+B/2)cos(A-B/2)
=2sin30{2cos(20+10/2).cos(20-10/2)}
=2sin30{2cos(15).cos(5)}
=2(1/2){2cos15.cos5} as sin30=1/2
=2cos15.cos5
Taking right side of equation sin70+ sin80
Using the formula sinA+sinB
= 2sin(A+B/2)cos(A-B/2)
=2sin(70+80/2)cos(70-80/2)
=2sin75cos5
=2sin(90-15)cos5
=2cos15.cos5 Hope this helps

{-4y-11x=36
{20=-10x-10y

Answers

Solve this by method of elimination where you make one term equal and then cancel it out.

36=-4y-11x  (Equation 1)
20=-10x-10y (Equation 2)

Reorganize the terms.
36=-11x-4y (Equation 1)
20=-10x-10y (Equation 2)

Multiply Equation 1 by 5 and Equation 2 by 2 to make y equal.
180=-55x-20y
40=-20x-20y

Now subtract Equation 2 from Equation 1. It is a bit messy but it looks like:
180-40=-55x-(-20x)-20y-(-20y)
180-40=-55+20x-20y+20y
140=-35x

We have now removed y from the equation, so we can now solve for x. Divide each side by -35 to find x.

140=-35x
-4=x

We have the equation 20=-10x-10y. Substitute -4 for x to solve for y.

20=-10x-10y
20=-10(-4)-10y
20=40-10y
-20=-10y
2=y

x=-4
y=2

Is 89 prime or composite

Answers

it is a prime number. 89=1×89 hope it helps

Answer:

Prime

Step-by-step explanation:

A prime number is a number that has only one factor. A composite number is a number that has more than one factor.

-kiniwih426

logx + log(3x-13) = 1

Answers

x = 5
Condense the left side.
log x(3x-13)=1
Put a base 10 on each side to clear the log.
x(3x-13)=10
3x^2-13x-10=0
Factoring you get x=5 and x=-2/3. The domain for log is x>0 so the -2/3 is an extraneous solution.

The solutions for [tex]\log x + \log (3\cdot x - 13) = 1[/tex] are [tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex], respectively.

In this question, we are going to solve for [tex]x[/tex] with the help of Logarithm Properties, which are described in the image attached below.

[tex]\log x + \log (3\cdot x - 13) = 1[/tex]

[tex]\log [x\cdot (3\cdot x - 13)] = 1[/tex]

[tex]\log (3\cdot x^{2}-13\cdot x) = 1[/tex]

[tex]10^{\log(3\cdot x^{2}-13\cdot x)} = 10^{1}[/tex]

[tex]3\cdot x^{2}-13\cdot x = 10[/tex]

[tex]3\cdot x^{2}-13\cdot x -10 = 0[/tex]

This is a Second Order Polynomial, which can be solved by Quadratic Formula:

[tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex]

The solutions for [tex]\log x + \log (3\cdot x - 13) = 1[/tex] are [tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex], respectively.

Please see this question related to Logarithm Properties for further details:

https://brainly.com/question/12983107

Tyrone’s hourly wage is $18 and his net pay is 72% of his earnings. Tyrone spends about $1,800 on his monthly expenses. If Tyrone works 40 hours per week and has no other sources of income, what is his total monthly cash inflow? (Hint: Assume that there are 4 pay periods per month.)

Answers

$2073.60 per month

===================

To calculate Tyrone's total monthly cash inflow, we need to determine his weekly and then monthly earnings.

Calculate weekly gross income:

$18/hour * 40 hours/week = $720/week

Calculate net pay per week:

$720/week * 72% = $518.40/week

Calculate monthly cash inflow:

$518.40/week * 4 weeks/month = $2073.60/month

Tyrone's total monthly cash inflow is $2073.60.

A side of the square is 4t. the area of the square is 400. what is the value of t?

Answers

A side is 4t so A=400=16t^2 by definition. Thus t=5 which produces an area of 400 since [4 (5)]^2=20×20=400.

The value of the variable 't' will be 5.

What is the area of the square?

All the sides of a square are congruent. Let a be the side length of the square. Then the area of the square is the square of the side length of the square.

Then the area of the square will be

Area of the square = a² square units

A side of the square is 4t. the area of the square is 400. Then the value of the variable 't' will be

400 = (4t)²

(4t)² - 20² = 0

(4t - 20)(4t + 20) = 0

t = -5, 5

Thus, the value of the variable 't' will be 5.

More about the area of the square link is given below.

https://brainly.com/question/1658516

#SPJ6

mr. and mrs. boyce bought a house for 96000 in 1995. real estate values in their area increase approximately 4% each year. what was the value of the house in 2007?

Answers

Use this formula:
[tex]P(t) = P_0 (1 + r)^t[/tex]
[tex]P(12 years) = (96000) \cdot (1.04)^{12}[/tex]
[tex]P(12) = 153699[/tex]
Final answer:

The Boyce's house bought for $96,000 in 1995, increased approximately 4% yearly. By applying the compound interest formula, the house's value in 2007 would be approximately $139,254.09.

Explanation:

We need to use the compound interest formula to calculate the value of Boyce's house in 2007 because the house price increase is compounded annually. The formula is P(1 + r/n)^(nt). Here, P is the initial amount (i.e., the original house price), r is the annual interest rate (the rate of increase in house value), and n is the number of times interest is compounded yearly. T is the number of years the money is invested.

However, as we deal with annual compounding, the formula simplifies to P(1 + r)^t. In this case, P = $96,000, r = 4% or 0.04, and t = 2007 -1995 = 12 years.

Inserting these values, we get 96000(1 + 0.04)^12 = $139,254.09 (rounded to the nearest cent).

So, according to the 4% annual increase rate, Boyce's house would be worth approximately $139,254.09 in 2007.

Learn more about Compound Interest here:

https://brainly.com/question/14295570

#SPJ2

Which of the binomial is a factor of this trinomial x2-7x-44?

Answers

I hope this helps you



x^2-7x-44

x -11



x +4



(x-11)(x+4)

A basketball team averages 98 points in its first three games.How many points must it score in the next game in order to have 100 point average overall?

Answers

The basketball team must score 106 points in the next game to have a 100-point average overall.

To determine how many points the basketball team must score in the next game to have a 100-point average overall, we need to consider the total points scored in the first three games and the desired average.

The team has already played three games and has an average of 98 points. To find the total points scored in these three games, we multiply the average by the number of games:

Total points in the first three games = 98 points/game * 3 games = 294 points.

To have a 100-point average overall, the team needs to score a total of 100 points per game multiplied by the total number of games played, including the next game.

Let's represent the number of points needed in the next game as "x."

(294 points + x points) / (3 games + 1 game) = 100 points/game.

Simplifying the equation:

(294 + x) / 4 = 100.

Cross-multiplying and solving for "x":

294 + x = 400.

x = 400 - 294.

x = 106.

To learn more about average click on,

https://brainly.com/question/31340101

#SPJ2

a culture contains 1500 bacteria initially and doubles every 30 mins. a) find a function that models the number of bacteria at time t. b) find the number of bacteria after 2 hours. c) after how much time will there be 4000 bacteria ...?

Answers

Thank you for posting your question here at brainly. I hope the answer will help you. Feel free to ask more questions here.

Below are the answers:

a. An = Ao • 2^(t/30) 
b. An = 1500 • 2^(60*2/30) or An = 24000 
c. 4000 = 1500 • 2^(t/30) 
or 4000/1500 = 2^(t/30) 
or ln(40/15) = (t/30) ln(2) 
or t = 30* ln(8/3) / ln(2) 
or t ~ 42.45 min

Find the least residue of 7^5 mod 50 without using a calculator.
so far I have 7=7 mod 50 7^5 = 7^5 mod 50 7^2 = 49 7^3=343 since 7^2=(-1)mod50 and 7^3=(-43)mod50 it follows that 7^6=7^2 * 7^3 = (-1)(-43) = 43 feel like this is wrong though could somebody please explain where I have made an error?

Answers

7^1 = 7 (mod 50)
7^2 = 49 = -1 (mod 50)
7^3 = 7^2*7 = (-1)*7 = -7 (mod 50)
7^4 = (7^2)*(7^2) = (-1)*(-1) = 1 (mod 50)
7^5 = (7^4)*7 = 1*7 = 7 (mod 50)

So 7^5 = 7 (mod 50)

In other words, if we divided 7^5 over 50, the remainder would be 7. We don't need to worry about the quotient. 

At 9:00 on Saturday morning, two bicyclists heading in opposite directions pass each other on a bicycle path.The bicyclist heading north is riding 4 km/hour faster than the bicyclist heading south. At 10:15, they are 40 km apart. Find the two bicyclists’ rates.

Answers

let x be the speed of bicyclist A (heading north)
     
y be the speed of bicyclist B (heading south)
 
since A is 5km/hr faster than B
 
x = y + 5 -----equation 1

time = 9 to 10:45 = 1.75hours since the distance is 47.25km then,
 
x(1.75) + y(1.75) = 47.25 ---equation 2

substitute equation 1 to 2 (y+5)(1.75) + 1.75y
 
= 47.25 1.75y +8.75 + 1.75y
 
= 47.25 3.5y
 
= 47.25 - 8.75 3.5y

= 38.5

y = 11km/hr
 
substitute to equation 1
 
x = y + 5 x

= 11 + 5 x

= 16km/hr

The speed of Bicyclist A (heading north) is 16 km/h.

The speed of Bicyclist B (heading south) is 11 km/h.

Given:

- Let x be the speed of bicyclist A (heading north).

- Let y be the speed of bicyclist B (heading south).

- Bicyclist A is 5 km/h faster than Bicyclist B, so [tex]\(x = y + 5\)[/tex] (Equation 1).

- Time from 9:00 to 10:45 is 1.75 hours.

- The total distance covered by both bicyclists during this time is 47.25 km.

From the equation for time and distance, we have:

[tex]\[ x \times 1.75 + y \times 1.75 = 47.25 \][/tex]

Substituting Equation 1 into this equation:

[tex]\[ (y + 5) \times 1.75 + y \times 1.75 = 47.25 \]\[ 1.75y + 8.75 + 1.75y = 47.25 \]\[ 3.5y + 8.75 = 47.25 \]\[ 3.5y = 38.5 \]\[ y = \frac{38.5}{3.5} \]\[ y = 11 \text{ km/h} \][/tex]

Substituting the value of y back into Equation 1:

[tex]\[ x = 11 + 5 \]\[ x = 16 \text{ km/h} \][/tex]

Thus, the correct answer is:

- The speed of Bicyclist A (heading north) is 16 km/h.

- The speed of Bicyclist B (heading south) is 11 km/h.

Question :

At 9:00 on Saturday morning, two bicyclists heading in opposite directions pass each other on a bicycle path.The bicyclist heading north is riding 4 km/hour faster than the bicyclist heading south. At 10:15, they are 40 km apart. Find the two bicyclists’ rates.

Other Questions
Factor the GCF first and then factor the trinomial: 2x2 + 20x + 50 A. 2(x + 5)(x + 5) B. 2(x + 5)(x + 10) C. 2(x + 2)(x + 25) D. prime Factor the GCF first and then factor the trinomial: 2x2 + 20x + 50 A. 2(x + 5)(x + 5) B. 2(x + 5)(x + 10) C. 2(x + 2)(x + 25) D. prime Is it true or false that as part of the gentleman's agreement China's Government agreed to limit immigration of unskilled workers to the United States. Mr.Thomas puts up a fence posts from one end of a field to the other equal distance apart. There are 27 posts. The width of each post is 10 cm . The distance between the 2 posts is 30 meters. Find the length of the fence what is an appropriate data display for the distribution of teachers by age? what's 34.6 times 10 to the second power in scientific notation What is.the reminder of 6 divided 75 ryan makes 6 backpacks he uses 3/4 of cloth to make each backpack what is the total amount cloth ,in yards ryan use to make all 6 backpacks If only a mother has achondroplasia, what are the chances a child will also have the condition? Saying that you are sad when you are really miserable is an example of _____ a)slanting. b)jargon. c)understatement. d)irony. Which sentence is NOT written in passive voice?A)Mrs. McGreevy's pop quizzes caused many of her students to have failing grades in chemistry.B)All of the students in Mrs. McGreevy's chemistry class were failed by her because of her pop quizzes.C)The students were injured by the chemicals released in Mrs. McGreevy's latest chemistry lab.D)The chemistry class Mrs. McGreevy teaches was filled with students by the counselors who overstuffed her class attendance list. 1. Which of the following is NOT a true statement about ATP?A. ATP consists of ribose, adenine, and three phosphate groups.B. ADP is produced when ATP releases energy.C. ATP provides energy for the mechanical functions of cells.D. Used ATP is discarded by the cell as waste. Which scientists law about the ratios of masses of elements in a compound did John Daltons work on the atomic structure help to explain?DemocritusJ. J. ThomsonErnest RutherfordJoseph Proust The sarbanes oxley act was passed toA.) prevent fraud at public companies B.) replace all of the old accounting procedures with new onesC.) Improve the accuracy of the company's financial reporting D.) both a and c A highway makes an angle of 6 with the horizontal. This angle is maintained for a horizontal distance of 5 miles.To the nearest hundredth of a mile, how high does the highway rise in this 5-mile section? Show the steps you use to find the distance. How many free credit score reports are you legally to each year? Write a problem that requires multiplying two decimals to find the answer. The product must have two decimals places. As a factor of production how is capital created?a. by adding land to entrepreneurshipb. by adding human labor to landc. by removing land from services.d. by using labor to create services Since the description of the presidency given in Article II is sketchy, it has been used as _____ of presidential powers.A. a blueprintB. a specificationC. an explanationD. an outline The Causes of World War I were: Militarism, Alliances, Imperialism, and Nationalism. Which one of these was the biggest contributor to the start of the war? Please answer in 3-4 sentences, and explain. PLEASE HELP ME!!!! I WILL GIVE BRAINLYEST :)Which was a belief of the early Federalist Party? A.The United States should become allies with France. B. The United States should have a small federal government. C. The United States should not have a national bank. D.The United States should not take sides in foreign wars. Steam Workshop Downloader