HELP PLEASE, QUICKLY!!!!!
what is the lateral area of this regular octagonal pyramid?
149.3 cm
182.9 cm
211.2 cm
298.7 cm

HELP PLEASE, QUICKLY!!!!!what Is The Lateral Area Of This Regular Octagonal Pyramid?149.3 Cm182.9 Cm211.2

Answers

Answer 1

Answer:

The lateral area is [tex]298.7\ units^{2}[/tex]

Step-by-step explanation:

we know that

The lateral area of the regular octagonal pyramid is equal to the area of its eight triangular lateral faces

The lateral area is equal to

[tex]LA=8[\frac{1}{2}(b)(l)][/tex]

we have

[tex]b=6.6\ cm[/tex]

To find the slant height apply the Pythagoras Theorem

[tex]l^{2}=8^{2} +8^{2}\\l^{2}=128\\l=\sqrt{128}\ units[/tex]

Find the lateral area

substitute the values

[tex]LA=8[\frac{1}{2}(6.6)(\sqrt{128})]=298.7\ units^{2}[/tex]

Answer 2

The answer is 298.7 cm²


Related Questions

The house shown is a composite of more than one shape. Which of these methods would you use to find the volume of the house?

Answers

Answer:

find the area on one shape and the area of the other and add the shapes areas to get your answer

Step-by-step explanation:

Answer: Add the volume of a rectangular prism to the volume of a triangular prism.

Step-by-step explanation:

A. Find the volume of a pyramid.

Neither of the shapes shown are a pyramid and there should be two shapes added together.

B. Find the volume of a rectangular prism.

There should be two shapes being added together, however this is one of the shapes shown.

C. Add the volume of a rectangular prism to the volume of a triangular prism.

This is the answer because the bottom shape of the house is a rectangular prism since there are six faces all with four sides. The top shape is a triangular prism because two of the faces are triangles and the other three are rectangles. This shape would not be a pyramid because in order for it to be categorized that way it would need at least four triangular faces that connect at a point.

D. Add the volume of a rectangular prism and a pyramid.

The triangular prism is shown, however the shape used to represent the roof of the house would be classified as a rectangular prism.

To which real number subsets do the following real numbers belong?

0, 3, 7, 11, 15, 18
A.
irrational numbers and whole numbers
B.
integers and rational numbers
C.
natural numbers and irrational numbers
D.
integers and irrational numbers

Answers

pretty sure the answer is b

Final answer:

The real numbers 0, 3, 7, 11, 15, and 18 belong to the subsets of integers and rational numbers.

Explanation:

The real number subsets to which each of the given numbers belong are as follows:

0 is a whole number, an integer, and a rational number.3 is a whole number, an integer, and a rational number.7 is a whole number, an integer, and a rational number.11 is a whole number, an integer, and a rational number.15 is a whole number, an integer, and a rational number.18 is a whole number, an integer, and a rational number.

Therefore, the correct answer is B. integers and rational numbers.

Learn more about Real Number Subsets here:

https://brainly.com/question/37895658

#SPJ2

Which lines in the graph have a slope greater than 1 but less than 2?
line 1
line 2
line 3
line 4
line 5

Answers

I don't know the equation of each line but here is how you do it:

Arrange each of their equations such that it becomes y=mx + c, where m and c are constants (they don't change and cannot vary).

Then, m, representing the slope (or gradient) will help you find the answer. The answer will be the line which has an m with a value greater than 1 anf les than 2.

Otherwise, if you don't have their equations, you can find their gradient (or slope) through the equation (y1 - y2)/(x1 - x2) where (x1, y1) and (x2, y2) are points on the same line. Do this for each of them and find each of their gradients/slopes before comparing them and finding the answer

Sorry I can't say much though, I don't know the equations of your lines and therefore cannot help very much

Answer:

line 1  line 3

Step-by-step explanation:

I took the test

A car is traveling at a rate of 99 kilometers per hour. What is the car's rate in meters per second? How many meters will the car travel in 10 seconds?

Answers

Answer:

The answer is 16.5 meters in 10 seconds

Step-by-step explanation:

First you divide 99 by 60 seconds

When you get 1.65 you multiply it by 10 second.

When you multiply 1.65 by 10 second you get 16.5 meters in 10 seconds

The car is traveling at a rate of 27.5 meters per second.

The car will travel 275 meters in 10 seconds.



First, find how many meters per hour it is traveling. There are 1,000 meters in one kilometer, so there are 99,000 meters in 99 kilometers.

Now, find how many meters per minute the car is traveling by dividing 99,000 by 60 to get 1,650 meters per minute.

Finally, divide by 60 again to find the number of meters per second. 1,650 divided by 60 is 27.5, so the car is traveling at a rate of 27.5 meters per second.

To answer the second question, multiply the number of meters per second by the number of seconds to get the number of meters. 27.5 meters per second times 10 seconds is 275 meters in 10 seconds.

If sin A = 0.31, cos A = 0.95, sin B = 0.47, and cos B 0.88, what is sin(A+B)?

Answers

Answer:

option B

0.72

Step-by-step explanation:

Given in the question,

sin A = 0.31

cos A = 0.95

sin B = 0.47

cos B = 0.88

To solve sin(A+B) we will use trigonometry identities

Compound-angle formulae

sin(A + B) = sin A cos B + cos A sin B

Plug values in above formula

(0.31) (0.88)+ (0.95) (0.47)

0.2728 + 0.4465

0.7193

≈ 0.72

Answer:

0.72

Step-by-step explanation:

Use the sum formula for the sine function:

sin (A + B) = sin A cos B + cos A sin B

Insert the givens into the above formula:

sin (A + B) = (0.31)(0.88) + (0.95)(0.47)

                 =  0.7193, or approx 0.72

18-5w+7w-4=28 does any one knows that answer​

Answers

Answer: w=7

All work is shown in the attached sheet! :)

It took Joe 3 hours swimming at a speed of 12 miles per hour to swim along the Charles River. If Jennifer is swimming the same path along the Charles River at a speed of 9 miles per hour, how long will it take her to complete her swim?

Answers

Answer:

4 hours

Step-by-step explanation:

3 x 12 = 36

36/9 = 4

Answer:

4 hours

Step-by-step explanation:

3 x 12 = 36

36/9 = 4

What is the surface area of the figure?

Answers

i believe the answer is B but im not sure

Answer:

582 ft²

Step-by-step explanation:

2(6x15)= 180

2(9x9)=  162

  (9x4)=   36

  (6x4)=   24

3(15x4)= 180  

            582 ft²

             648 ft²

The slope of the line passing through the points (-2,6) and (6,4) is

Answers

Answer:

[tex]-\frac{1}{4}[/tex]

Step-by-step explanation:

[tex]rule of slope = \frac{y^2-y^1}{x^2-x^1}[/tex]

4 - 6 = -2

6 - -2 = 8

-2 ÷ 8 = -0.25 (-1/4)

Answer:

The slope is [tex]-\frac{1}{4}[/tex]

Step-by-step explanation:

Let [tex](x_1,y_1)=(-2,6)[/tex] and [tex](x_2,y_2)=(6,4)[/tex].

The slope of the line passing through these two points is given by;

[tex]m=\frac{y_2-y_1}{x_2-x_1}[/tex]

We substitute the values to obtain;

[tex]m=\frac{4-6}{6--2}[/tex]

[tex]m=\frac{-2}{8}[/tex]

[tex]m=-\frac{1}{4}[/tex]

What is 45,728 rounded to The nearest hundred

Answers

45,700

You either go up from 5-9 or down for 1-4.

Example:

56,891 to the nearest hundred.

An 8 is in the hundreds place so it will either be 56,800 or 56,900 depending on if you go up or down. Start at the ones place. The number is 1 so you take that down. Then you have 56,890. Next you go to the tens place. A 9 would go up so you then have 56,900. You are now in the hundreds place so you have solved the problem.

Answer:

45,700

Step-by-step explanation:

Go to the hundreds place and look at the number behind it. It's a 2. If you are rounding and the number behind it is 4 or less, you would keep it the same. If the number behind it is 5 or more, then you would round up. So, the answer is 45,700.

What is the quotient for the equation above?

Answers

Answer:

The correct answer option is C. 73.75.

Step-by-step explanation:

We are to perform division where 29.5 is the dividend while 0.4 is the divisor.

To make this division somehow easier, we can multiply both the dividend and the divisor by 10 to avoid the decimals.

So multiplying both the values with 10, we get:

[tex] \frac { 295 } { 4 } [/tex]

Now dividing 295 by 4, we get a quotient of 73.75.

Help me please guys

Answers

For 7A)

The sum of -4 can not be both positive as from the set of rules (+)(+) can only make postive and -4 is decleared as negative

For 7B)

The sum of -4 can not be both negative as both negative (-)(-) is equivalent to a positive and the integer is -4 meaning it can not be negative

The reasonable answer to this would be two different numbers

It could be negative and positive

Or positive and negative

Nothing else

solve n^2+16n=17 by completing the square ​

Answers

Answer:

305 or N=1

Step-by-step explanation:

N=17, correct?

so what you do first is rewrite the equation:

17^2+16

which will equal:

305

if not and the equation is N^2+16=17

then you have to subtract the 16 first from 17

n^2=1

now you divide or whatever you call it XD

/n^2=/1

so the answer to N=1

Find all the zeros of the function f(x) = x^3 -2x^2 +16x -32

Answers

Answer:

Real zeros: x = 2All zeros: x = 2, x = -4i and x = 4i

Step-by-step explanation:

[tex]f(x)=x^3-2x^2+16x-32\\\\\text{The zeros:}\\\\f(x)=0\Rightarrow x^3-2x^2+16x-32=0\\\\x^2(x-2)+16(x-2)=0\\\\(x-2)(x^2+16)=0\iff x-2=0\ \vee\ x^2+16=0\\\\x-2=0\qquad\text{add 2 to both sides}\\\boxed{x=2}\\\\x^2+16=0\qquad\text{subtract 16 from both sides}\\x^2=-16<0\qquad\text{no real solutions}\\\\\text{In the set of the complex numbers}\\x^2=-16\to x=\pm\sqrt{-16}\\\boxed{x=-4i\ \vee\ x=4i}[/tex]

what is more 500 mL of water or 0.75 L of water​

Answers

it is 0.75 L because the L are more than a mL

Answer:

Step-by-step explanation:

0.75

William is drafting his fantasy basketball team. He needs to select one player for each position. The following table shows how many players are available for each position.
Position Number of players
Point guard 101010
Shooting guard 121212
Small forward 777
Power forward 222
Center 999
How many different teams could William draft?

Answers

Answer: 15120

Step-by-step explanation:

10×12×7×2×9=15120

Answer: 15120

Step-by-step explanation:

Given: The number of players at point guard = 10

The number of  players at shooting guard = 12

The number of  players at small forward = 7

The number of  players at power forward = 2

The number of  players at center = 9

Then, the number of different teams William could draft is given by :-

[tex]10*12*7*2*9=15120[/tex]

Hence, William could draft 15120 different teams.

17. Solve the equation. Show your work. 3x – 10 = 5x + 32

Answers

3x - 10 = 5x + 32

3x - 10 + (-5x + 10) = 5x + 32 + (-5x + 10)

-2x = 42

-0.5(-2x) = -0.5(42)

x = -21

Answer:

x = -21

Step-by-step explanation:

[tex]3x-10=5x+32\qquad\text{add 10 to both sides}\\\\3x-10+10=5x+32+10\\\\3x=5x+42\qquad\text{subtract 5x from both sides}\\\\3x-5x=5x-5x+42\\\\-2x=42\qquad\text{divide both sides by (-2)}\\\\\dfrac{-2x}{-2}=\dfrac{42}{-2}\\\\\boxed{x=-21}[/tex]

Last Labor Day, I weighed 135 pounds. I have gained x pounds. Write an expression for my current weight

Answers

Answer:

135+x

Step-by-step explanation:

thi is because yoou gained x so you add that to your weight

Hello there!

An equation you could use is: 135 + x = y

This is because you gained x pounds, and you are adding that on to you original weight of 135 pounds, giving you a total of y ponds.

I hope this helps and have a great day!

add or subtract ( -2x^2-4x+13)+(12x^2+2x-25) show your work

Answers

First we need to simplify:

(-2x^2-4x+13 + (12x^2+2x-25) to get (−2x+12x​​ )+(−4x+2x)+(13−25).

Simplify to get [tex]10x^2 - 2x - 12[/tex]

There is your answer^

Thanks for using Brainly!

True or false: both functions and relations can be represented by mapping diagrams

Answers

Answer:

Step-by-step explanation: the answer is true

The given statement is true. Both functions and relations can be represented by mapping diagrams is true statement.

Mapping diagrams: A mapping diagram is a visual representation that shows the relationship between the elements of a domain and the corresponding elements in a co-domain or range.

Functions: A function is a specific type of relation where each element in the domain is mapped to exactly one element in the co-domain. In a mapping diagram for a function, each element in the domain is represented by an arrow pointing to its corresponding element in the co-domain.

Representing functions with mapping diagrams: To represent a function using a mapping diagram, follow these steps:

Identify the elements in the domain and co-domain of the function.

Draw a set of arrows from each element in the domain to its corresponding element in the co-domain.

Make sure that each element in the domain has only one arrow pointing to it from the co-domain, indicating the one-to-one mapping characteristic of functions.

Relations: A is a more general concept that describes any set of ordered pairs consisting of elements from a domain and co-domain. A relation can have multiple outputs for a single input, unlike a function.

Representing relations with mapping diagrams: To represent a relation using a mapping diagram, follow these steps:

Identify the elements in the domain and co-domain of the relation.

Draw arrows from each element in the domain to all the corresponding elements in the co-domain, representing the multiple outputs or mappings.

In summary, mapping diagrams can be used to represent both functions and relations. Functions have a one-to-one mapping, whereas relations can have multiple mappings for a single input. Mapping diagrams provide a visual way to understand and represent the relationships between the elements of a domain and co-domain.

Therefore, the given statement is true. Both functions and relations can be represented by mapping diagrams is true statement.

Learn more about mapping diagrams here:

https://brainly.com/question/29081249

#SPJ2

Plz help!!!!!!!!!!!!

Answers

Answer:

-8

Step-by-step explanation:

(-32)^(3/5) is equivalent to (-2^5)^(3/5) and applying exponent rules then simplifying you can get your answer.

Answer:

Step-by-step explanation:

Let's just see what happens if we do

(-32)^(1/5)

That means what number do you start with that when multiplied 5 times gives you - 32?

The answer is - 2

-2 * - 2 * -2 * -2 * -2 = -32

Now when you have a root sign that goes to the 1/5 power, you can take out 1 of the factors and throw the other 4 away.

[tex]\sqrt[5]{-2 * - 2 * - 2 * -2 * -2} = - 2[/tex] take one - 2 from under the root sign and throw the other 4 away

That's not the answer. We have one more step.

What is -2 to the 3rd power.

(-2)^3 = - 8

So the answer is -8

[tex]\sqrt[5]{- 32}^3 = -8[/tex]

Mila reads at a rate of 2 paragraphs per minute.
After reading for 3 minutes, she had read a total of 6 paragraphs.

Answers

Yes this is true because if she can read 2 paragraphs every minute you would multiply 2 by 3 since that’s how many minutes she read for.

2 paragraphs x 3 minutes = 6 paragraphs

Hope this helps.

Answer:

Yes this is true because if she can read 2 paragraphs every minute you would multiply 2 by 3 since that’s how many minutes she read for.

2 paragraphs x 3 minutes = 6 paragraphs

Hope this helps.

Step-by-step explanation:

What is (f+g)(x)? f(x)=x^2-36 g(x)=x^3+2x^2-10

Answers

Answer:

x³ + 3x² - 46

Step-by-step explanation:

note that (f + g)(x) = f(x) + g(x)

f(x) + g(x)

= x² - 36 + x³ + 2x² - 10 ← collect like terms

= x³ + 3x² - 46

The number of eggs in the refrigerator e decreased by 2 equals 18. What’s the equation?

Answers

E-2=18 should be your answer

✧・゚: *✧・゚:*    *:・゚✧*:・゚✧

                  Hello!

✧・゚: *✧・゚:*    *:・゚✧*:・゚✧

❖ The correct answer is e - 2 = 18.

e is being decreased by 2 so we represent this as, -2. The problem says it equals 18 so therefore, the equation will be written as e - 2 = 18

~ ʜᴏᴘᴇ ᴛʜɪꜱ ʜᴇʟᴘꜱ! :) ♡

~ ᴄʟᴏᴜᴛᴀɴꜱᴡᴇʀꜱ

Find The angle of CBD

Answers

Answer:

Angle CBD is 125°.

Step-by-step explanation:

Remember that the sum of all the interior angles of a triangle is 180°.  We know two of these angles from the diagram for problem #3:  67° amd 58°.  Thus, angle ABC is 180° less the sum of 67° and 58°, or 180° - (67° + 58°), which comes out to 180° - 125°, or 55°.

This 55° and angle CBD are supplementary angles.  In other words, 55° + <CBD must sum up to 180°.  Subtracting 55° from 180° yields 125°.

Angle CBD is 125°.

Answer:

125°

Step-by-step explanation:

We know that ∠CBD = ∠ACB + ∠CAB           [ External Angle of a                                                                                         Triangle theorem]

∠CBD = 58° + 67° = 125°

two numbers total 66 and have a difference of 22. Find the two numbers​

Answers

♫ - - - - - - - - - - - - - - - ~Hello There!~ - - - - - - - - - - - - - - - ♫

x + y = 66

y - x = 22 (rearrange for y)

y = x - 22 (substitute this into the top equation)

x + (x - 22) = 66

2x - 22 = 66

Add 22 to both sides

2x = 88

x = 44

The two numbers are 44 and 22

Hope This Helps You!

Good Luck (:

Have A Great Day ^-^

↬ ʜᴀɴɴᴀʜ

Answer:

The solution is x= 44 and y =22

Step-by-step explanation:

See the image

A rectangular prism has a length of 11 centimeters, a width of 9 centimeters, and a height of 3 centimeters. Its volume is _______ cubic centimeters.

Answers

Answer:

297

Step-by-step explanation:

To find V or Volume to multiply all of the number so 11 time 9 times 3 equals 297. So V = 297

State a true conclusion.
1) All rabbits like lettuce.
2) My pet is a rabbit. Conclusion:

Answers

I think it would be: "My pet rabbit likes lettuce."

I believe it would be 2) my pet is a rabbit.

The diameter of a pizza is 12 inches. What is its area?​

Answers

Answer: 113.0973  [tex]in^{2}[/tex]

Step-by-step explanation:

If the diameter of the circle is 12", then the radius is 6" (half the diameter), and the area "A" is (approximately) 3.14 * 6^2 or about 113.04 sq. in. The calculation is approximate because 3.14 is a rounded value for pi. But the correct answer is 113.0973 not 113.04 because it's giving you the answer compared to SQUARE, but we need the answer in Inches. So that was just an example.

* Hopefully this helps:) Mark me the brainliest:)

The area is approximately 113.097 square inches.

To find the area of a pizza with a diameter of 12 inches, we follow these steps:

First, find the radius of the pizza. The radius is half of the diameter. So, radius = diameter / 2 which gives: radius = 12 inches / 2 = 6 inches.Next, use the formula for the area of a circle: A = πr². Here, π (pi) is approximately 3.14159.Substitute the radius into the formula: A = π × (6 inches)² = π × 36 square inches.Finally, calculate the area: A = 3.14159 × 36 ≈ 113.097 square inches.

Therefore, the area of the pizza is approximately 113.097 square inches.

Solve –3(2 – 5w) = 9w + 66 for w.

Answers

Let's solve your equation step-by-step.

−3(2−5w)=9w+66

Step 1: Simplify both sides of the equation.

−3(2−5w)=9w+66

(−3)(2)+(−3)(−5w)=9w+66(Distribute)

−6+15w=9w+66

15w−6=9w+66

Step 2: Subtract 9w from both sides.

15w−6−9w=9w+66−9w

6w−6=66

Step 3: Add 6 to both sides.

6w−6+6=66+6

6w=72

Step 4: Divide both sides by 6.

   6w

    6

=    72

     6

w=12

Answer:

w=12

Other Questions
How do I find and what is the x? TRUE OR FALSE? earth revolves around the sun tilted on its axis Bonita said that the product of 5/6 1 2/3 is 7/ 3. How can you tell that her answer is wrong? During the 1945 conference in Potsdam,Question 14 options:Churchill replaced Clement Atlee as prime minister of Britain.the Big Three decided that Poland, Bulgaria, and Romania would be independent.Stalin reneged on his pledge to enter the war against Japan in the Pacific.the Big Three formalized the plan to divide Germany into four zones of occupation. Disuss the difference between fixed expenses and variable expenses as they relate to a budget? in the figure PQ is parallel to RS. the length of RP is 6 cm; the length of PT is 18 cm; the length of QT is 21 cm; what is the length of SQ? what is the definition of positive effect 535 invenstment compounded continuosly for 10 years at 6 percent A candle is placed 40cm in front of a convex mirror with a focal length of 20cm, as shown on the diagram. What is the distance from the lens to the image? X-10 explain why mental disorders should be viewed like any other physical illness.why it important not to stigmatize someone with a mental disorders . the point slope form of the equation of a line that passes through (8,4) and (0,2) is y-4=1/4(-8) what is the slope intercept form of the equation for this line. After the gaps between the firm's labor supply and labor demand are identified, a firm should ________. develop and implement action plans conduct a workforce analysis identify its business strategy articulate its talent philosophy and strategic staffing decisions The primary advantage quick-service restaurants have over other restaurant types is URGENT! Which of the following correctly expresses sin(2)sin(6) as a product?Select the correct answer below:2sin(4)cos(2)2sin(2)cos(4)2sin(2)cos(4)2sin(2)sin(4) What are some ideas that i would put for a visual project (power point) on NRA civil rights issues. please idc if you guys get political as long as i can put them in the power point. Identify Cause and Effect How did World War I affect the role of women in society? Subtract 6 ounces from 3 pounds.5 lb., 7 oz.6 lb., 3 oz.2 lb., 10 oz.2 lb., 13 oz. Which type of function is the result of adding a quadratic function and a linear function?A. a linear functionB. a quadratic functionC. a rational functionD. a cubic function PLZ HURRY IT'S URGENT!!!!This is the equation for the formation of sodium chloride from sodium bromide. Cl2 + 2NaBr Br2 + 2NaCl Which are the reactants and the products in this reaction? A. The reactants are Cl2 (chlorine) and NaBr (sodium bromide). The products are Br2 (bromine) and NaCl (sodium chloride). B. The reactants are Br2 (bromine) and NaCl (sodium chloride). The products are Cl2 (chlorine) and NaBr (sodium bromide). C. The reactants are Cl2 (chlorine) and Br2 (bromine). The products are NaBr (sodium bromide) and NaCl (sodium chloride). D. The reactants are NaBr (sodium bromide) and NaCl (sodium chloride). The products are Cl2 (chlorine) and Br2 (bromine). Steam Workshop Downloader