If the markup is 80% and the selling price is $21.60, what is the cost to the store?

Answers

Answer 1

Answer:

$12

Step-by-step explanation:

Let p be the store's cost (cost to buy the product wholesale).

Then the selling price is p + markup, or

                                         p + 0.80p = 1.80 p

and this comes to $21.60.

Dividing $21.60 by 1.80 results in p = $12.

The cost to the store is $12.


Related Questions

simplify the expression below: 3(7x) -2(4-x)

a. 12-2x
b. 13+2x
c. 23x-8
d. 20x-8

Answers

the correct answer is C to this question

Answer:

The answer is

Step-by-step explanation:

First we must follow the order of operation: Please, Excuse, My, Dear, Aunt, Sally; Paranthesis, Exponents, Multiplication, Division, Addition, and Subtration.

First it says to look for parenthesis, which there are; so we do that first;.

3(7x) -2 (4 - x)

  ^

21x - 2 (4 - x)

               ^

 21x - 2 times 4 (btw, we took x away because 4 - x)

               ^ (now we do multiplcation)

      21x - 8  

           ^

           13

answer is 13 + 2x

           

What is the truth value for the following conditional statement?
p: false
q: false

∼p → ∼q

T F → T
F T → F
F F → T
T T → T

Answers

Answer:

TT→T

Step-by-step explanation:

If p is false, then ~p is true.

If q is false, then ~q is true.

Now note that

If a and b are both true, then a→b is true.If a is true, b is false, then a→b is false.If a is false, b is true, then a→b is true.If a and b are both false, then a→b is true.

In your case, both~p and ~q are true, then ~p→~q is true too (or TT→T)

The truth value of the conditional statement ∼p → ∼q is true when both p and q are false, as the conditional is false only when the antecedent is true and the consequent is false.

The question is asking us to evaluate the truth value of the conditional statement ∼p → ∼q when both p and q are false. According to the rules of propositional logic, the implication (→) is false only when the antecedent is true and the consequent is false. Here, since p and q are both false, the antecedent (∼p) is true and the consequent (∼q) is also true. Therefore, the conditional statement is true. This reflects the concept that a conditional statement is always true if either the antecedent is false or the consequent is true, hence in our case the truth value of ∼p → ∼q is true.

Solve the equation for x by graphing. 2-5^x=2^x-3

A.
x ≈ -1.25
B.
x ≈ 1.25
C.
x ≈ 0.75
D.
x ≈ -0.75

Answers

The answer is C, 0.75 :-)

Answer:

the solution is x ≈ 0.75

C is the correct option.

Step-by-step explanation:

We have to solve the equation [tex]2-5^x=2^x-3[/tex]

let us assume two equations

[tex]y=2-5^x...(i)\\\\y=2^x-3[/tex]

Now, in order to solve the equation by graphing method, we graph(i) and (ii) in same coordinate axis.

Graphs of these two equations has been shown in the attached picture.

The, x-coordinate of the intersection point will given the solution.

The x-coordinate of the intersection point is x = 0.746 which can be written as x ≈ 0.75

Therefore, the solution is x ≈ 0.75

C is the correct option.



n
=
1

4
(
1
3
)
n

1

Answers

Answer:

6

Step-by-step explanation:

The correct notation is: Summation from n = 1 to infinity of the expression:

[tex]4(\frac{1}{3} )^{n-1}[/tex]

If we expand this notation, we will find that the given summation represent the terms of a G.P and we have to find the sum of infinite terms of a G.P. By placing n=1,2,3,4,... we can find the first few terms as shown below:

[tex]4(\frac{1}{3} )^{1-1}=4\\\\ 4(\frac{1}{3} )^{2-1}=4(\frac{1}{3} ) \\\\ 4(\frac{1}{3} )^{3-1} =4(\frac{1}{3} )^{2}[/tex]

Its obvious from the above result, that the given summation represent a G.P with first term equal to 4 and common ratio of 1/3. The formula of infinite G.P is:

[tex]S=\frac{a_{1} }{1-r}[/tex]

Using the value of a1 = 4 and r = 1/3 we can calculate the given summation

[tex]S=\frac{4}{1-\frac{1}{3} }=6[/tex]

Therefore, the given summation is equal to 6.

Please select the answer for the question shown below.

Answers

Answer:

It has one solution

Step-by-step explanation:

3/4 z = 1/4 z - 3 + 5

Subtract 1/4 z on both sides:

2/4 z = -3 + 5

2/4 z = 2

1/4 z = 1

Substitute:

3 = 1 - 3 + 5

3 = -2 + 5

3 = 3

^^^One Solution

9282 divided by 433 with a remainder

Answers

9282 divided by 433 with a remainder is equal to 21.

Given data:

To divide 9282 divided by 433, we can use variables to represent the numbers and perform the division algebraically.

Let's denote 9282 as a dividend (D) and 433as divisor (d).

D = 9282

d = 433

We need to find the quotient (Q) when D is divided by d.

Q = D / d

Substituting the given values:

Q = 9282 / 433

To simplify the division, we can multiply both the numerator and denominator by a suitable power of 10 to eliminate the decimal point. In this case, multiplying by 10 will suffice:

Q = (9282 * 10) / (433* 10)

Q = 9282 / 433

Now, we can perform the division:

Q = 9282 / 17

So, Q = 21

The quotient is the final answer, and the remainder is 0. Therefore, 9282 divided by 433 with a remainder is equal to 21.

To learn more about equations click :

brainly.com/question/19297665

#SPJ6

If 5 times a number is increased by 4, the result is at least 19. Find the least possible number that satisfies these conditions.

Answers

Answer:

3

Step-by-step explanation:

5 times a number would be 5x, then increase that by 4 is 5x+4.  The problem then says 5x + 4 ≥ 19.  If we solve for x then we get x ≥ 3 so x has to be greater than or equal to 3, so the smallest number it could be is 3.  You can even try any number smaller than 3 and see it doesn't work.  even something like 2.9

Answer:

x ≥ 3  

Step-by-step explanation:

Let the number = x

5 × the number = 5x

Increased by 4 means 5x +4

   Is at least 19 means ≥ 19

5x + 4 ≥ 19

5x       ≥ 15      Subtracted 4 from each side

 x       ≥    3      Divided each side by 5

The smallest possible number that satisfies the conditions is x = 3.

PLEASE HELP me, I don't know how to solve this!

Answers

Answer:

2 < c < 12

Step-by-step explanation:

If we know two sides of a triangle a and b, the third side, c, can be no bigger than the the other two sides added together, and no smaller than the other two sides subtracted

a-b < c < a+b

We know the two sides are 7 and 5

7-5 < c < 7+5

2 < c < 12

a ____ is how data values are arranged.


the part of data set where the middle values are concentrated is called the ______ for data.



A________ anticipates that there will be different answers when gathering info.


_______ is a measure that describes the spread of values in a data set.​

Answers

Answer:

statistical question

Step-by-step explanation:

Final answer:

A distribution is the arrangement of data values. The center for data refers to the central tendency measures such as mean, median, and mode. Variability describes the spread of values, often measured by standard deviation.

Explanation:

A distribution is how data values are arranged. The part of the data set where the middle values are concentrated is called the center for data. A survey anticipates that there will be different answers when gathering info. Variability is a measure that describes the spread of values in a data set.

To find the center of a data set, we can calculate measures of central tendency, which include the mean, median, and mode. The mean, or average, is the total of all data values divided by the number of values. The median is the value at the midpoint of the data set when ordered from smallest to largest, effectively splitting the data into two equal parts. The mode is the most frequently occurring value in the data set. If your data set has outliers, the median is often the best measure of the center, as it is less affected by extreme values.

When we refer to variability in a data set, we are often talking about the standard deviation, which tells us how spread out the data values are around the mean. A low standard deviation indicates that the values tend to be close to the mean, while a high standard deviation suggests the values are spread out over a wider range.

Julia estimates that Ron will buy $800 worth of produce from her each week. Last week, Ron bought $880 worth of produce. What is the absolute error? What is the ratio of the error to the actual amount? What is the percent error?

Answers

Answer:

-first one

80

- second one

80/880

- last one

9.09%

on edg.

Answer:

What is the absolute error?

✔ 80

What is the ratio of the error to the actual amount?

✔ 80/880

What is the percent error?

✔ 9.09%

URGENT! IM TIMED! 2.35•2/3 in fraction form?

Answers

Answer:

Simplified: 1.56

fraction form 47/30

Answer:

Option D 47/30

Edg 2020

What is the distance from -50 to-0 on a number line

Answers

Answer:

50 units

Step-by-step explanation:

Think of it as taking steps.  Each unit is a step.  It will take you 50 steps to get from -50 to 0, so the distance is 50

Mathematically, end point minus starting point

0 - (-50) =

0+50 = 50

what is the percent of increase from 500,000 to 1,000,000​

Answers

Answer:

100%

Step-by-step explanation:

do you need an explanation?

A rectangle is drawn on a coordinate plane. Three vertices of the rectangle are points A(−7,2) , B(3,2) , and D(−7,−2) . Point C is the fourth vertex of the rectangle.

What is the distance from point B to point C?



Enter your answer in the box.

Answers

the distance from point b to c is 4 down the y-axis

If 80 is decreased by 50%, what is the new amount?

Answers

Question: If 80 is increased by 50%, what is the new amount?

Answer: 40

What is the least common multiple of 6, 3, and 2?


Answers

Answer:

6

Step-by-step explanation:

the multiples of 6 are : 6, 12, 18, .....

The multiples of 3 are : 3, 6, 9, 12, ......

The multiples of 2 are : 2, 4, 6, 8, 10, 12, ......

The common multiples are 6 and 12 .....

The least common multiple is 6

pleassssssssssseeeeeeee help me! ASAP

Answers

Hey there!

I want you to think of radicals as like terms. In order to be able to combine like terms, you need the same base and exponent.

For example,

3x^2-y^2 <== same exponent but not same variable

3x^2-x^2 <=== could be combined because exponent (^2) and variable (x) are the same

So, for this question, you're looking for a radical that has 5 under the radical sign and 3 above the radical sign.

"B" is the right answer, because is  ∛ and in the radical it has a √5.

I hope this helps!

~kaikers

The revenue from selling x necklaces is r(x) -10x. The cost of buying x necklaces is c(x) 4x 15 The profit from selling x necklaces is px) -x)-c) Write a function for p(x), the profit from selling x necklaces.
O A. p(x) 6x 15
O B. p(x) -14x-15
O C p(x) -14x + 15
O D. p(x)- 6x -15

Answers

Answer:

The correct answer is B) p(x) = -14x - 15

Step-by-step explanation:

To find this, start by writing the function as indicated.

p(x) = r(x) - c(x)

Now input the functions into the appropriate spots.

p(x) = -10x - (4x + 15)

p(x) = -10x - 4x - 15

p(x) = -14x - 15

Answer:

[tex]P(x) =14x-15[/tex]

Step-by-step explanation:

The revenue from selling x necklaces [tex]r(x)= -10x[/tex]

The cost of buying x necklaces is [tex]c(x)= 4x+15[/tex]

The profit from selling x necklaces is [tex]P(x) = r(x)- c(x)[/tex]

Replace r(x) and c(x)

[tex]P(x) =-10x-(4x+15)[/tex]

[tex]P(x) =-10x-4x-15[/tex]

[tex]P(x) =14x-15[/tex]

Jada walks up to a tank that can hold up to 10 gallons. When it’s active a drain empties water from the tank at a constant rate. When jada first sees the tank it contains 7 gallon three minutes later the tank contains 5 gallon. At what rate is the amount of water in the tank changing

Answers

Answer:

2/3 of a gallon per minute

Step-by-step explanation:

You can find the rate by subtracting the amount of gallons she observed and dividing it by the time.

7 - 5 = 2 and 2 gallons/3 mins = 2/3 of a gallon each minute.

Find HCF of
Question number 23

Answers

Answer:  x - 2

Step-by-step explanation:

HCF is more commonly referred to as GCF (greatest common factor)

Factor each expression to see which factor(s) they have in common.

[tex]x^4 - 8x\implies x(x^3-8)\\= x\boxed{(x-2)}(x^2+4x+4)\\\\\\3x^2-8x+4\implies 3x^2-6x-2x+4\implies3x(x-2)-2(x-2)\\=(3x-2)\boxed{(x-2)}\\\\\\2x^2-5x+2\implies 2x^2-4x-x+2\implies 2x(x-2)-1(x-2)\\=(2x-1)\boxed{(x-2)}[/tex]

The only factor that all three expressions have in common is: x - 2

Sylvia finds the solution to the system of equations by graphing y=2/3x + 1 and y = -2/3x-1 which graph shows the solution to Sylvia’s system of equations

Answers

What I don’t understand the question

Answer:

D

Step-by-step explanation:

blue line curve going down from y 0,1  red diagonal touching x 3,0 then 0,-3

The 2 Triangles are similar.
What is the ratio of the corresponding side lengths? Thanks!

Answers

Answer:

see explanation

Step-by-step explanation:

The ratios of corresponding sides are

[tex]\frac{AB}{A'B'}[/tex] = [tex]\frac{BC}{B'C'}[/tex] = [tex]\frac{AC}{A'C'}[/tex], that is

[tex]\frac{4}{2}[/tex] = [tex]\frac{9}{4.5}[/tex] = 2

Which of the following equations is the translation 2 units up of the graph of y = |x|? y = |x - 2| y = |x + 2| y = |x| - 2 y = |x| + 2

Answers

Answer:

y = |x| + 2

Step-by-step explanation:

a walkway along the diagonal of a square park is 4/5 miles long. what is the area of the park?

Answers

Answer:

[tex]\frac{8}{25}[/tex]  square miles

Step-by-step explanation:

The relationship between the side length (let it be s) of a square and its diagonal (let it be d) is given by:

[tex]s=\frac{d}{\sqrt{2} }[/tex]

Since d is given as 4/5, we solve for s:

[tex]s=\frac{d}{\sqrt{2} }\\s=\frac{\frac{4}{5}}{\sqrt{2} }\\s=\frac{4}{5\sqrt{2} }[/tex]

NOW, area of square is s^2 where s is the side length.

Area = [tex]s^2=(\frac{4}{5\sqrt{2} })^2=\frac{16}{50}=\frac{8}{25}[/tex]

The area of the park is:[tex]\[\boxed{\frac{8}{25} \text{ square miles}}\][/tex]

To find the area of the square park given the length of the diagonal, we need to use the relationship between the side length of a square and its diagonal.

[tex]\[d = s\sqrt{2}\][/tex]

Given that the diagonal [tex]\( d \) is \(\frac{4}{5}\)[/tex] miles, we can set up the equation:

[tex]\[s\sqrt{2} = \frac{4}{5}\][/tex]

[tex]\[s = \frac{\frac{4}{5}}{\sqrt{2}} = \frac{4}{5\sqrt{2}}\][/tex]

Rationalize the denominator by multiplying the numerator and the denominator by [tex]\(\sqrt{2}\):[/tex]

[tex]\[s = \frac{4\sqrt{2}}{5 \cdot 2} = \frac{4\sqrt{2}}{10} = \frac{2\sqrt{2}}{5}\][/tex]

[tex]\[A = \left( \frac{2\sqrt{2}}{5} \right)^2\]\[A = \frac{(2\sqrt{2})^2}{5^2} = \frac{4 \cdot 2}{25} = \frac{8}{25}\][/tex]

Therefore, the area of the park is:

[tex]\[\boxed{\frac{8}{25} \text{ square miles}}\][/tex]

What is 0.660 rounded to the nearest tenth

Answers

Final answer:

To round 0.660 to the nearest tenth, we find that 0.660 rounded to the nearest tenth is 0.7.

Explanation:

To round 0.660 to the nearest tenth, we need to look at the digit in the hundredth place, which is 6. Since 6 is greater than or equal to 5, we round up. The digit in the tenth place becomes 7, and all digits after the tenths place are dropped. Therefore, 0.660 rounded to the nearest tenth is 0.7.

Which relation does not represent a function?
A.
{(3, 0), (0, 3)}
B.
{(6, -2), (5, -2)}
C.
{(3, 4), (3, 5)}
D.
{(5, 5), (-5, -5)}
E.
{(1, -2), (-2, 1)}

Answers

Answer:

C.  {(3, 4), (3, 5)}

Step-by-step explanation:

Each input can only go to one output to be a function.  In other words, each x can only go to one y

Relation C has an x of 3 going to 2 different y's (4 and 5) so it is a relation not a function

Answer with explanation:

A relation is said to be function, if each element of domain has unique range or no two elements in image has same Preimage.

Option A

3 → 0

0→3

Relation is a Function.

Option B

6 → -2

5→-2

Relation is a function.

Option C

3→4

3→5

Two elements in Preimage has Distinct images. So this relation is not a function.

Option D

5 → 5

-5 → -5

Relation is a function.

Option E.

1 → -2

- 2→ 1

Relation is a function.

Option C: {(3, 4), (3, 5)}

Relation is not a function.

What are the zeros of the function f(x)=(x+5) (2x-8) ?

Answers

Answer:

x = - 5, x = 4

Step-by-step explanation:

To find the zeros set f(x) = 0, that is

(x + 5)(2x - 8) = 0

Equate each factor to zero and solve for x

x + 5 = 0 ⇒ x = - 5

2x - 8 = 0 ⇒ 2x = 8 ⇒ x = 4

Answer:

X = -5 or x = 4

Step-by-step explanation:

F(x)=(x+5) (2x-8)

When f(x) = 0

0 =(x+5) (2x-8)

Thus;

x+5 =0 or  2x-8 = 0

Therefore; x= -5 or x = 4

an earthquake can be felt 70 miles from its epicenter if someone is standing 50 miles east and 20 miles north of the epiccenter will they be able to feel the eacrthquake? and explain your reasoning for why they would or would not be able to feel it.

Answers

Answer:

You Would Feel It Faint Because Of Earthquakes Are Loud Rumbles Not Matter How far

Step-by-step explanation:

You would feel it because you would be roughly 54 miles from the epicentre according to Pythagoras's theorem- within the 70 mile radius

Plz help me!!!!!!!!!!

Answers

Answer:   a³ - 218

Step-by-step explanation:

  (a - 6)(a² + 6a + 36)

= a(a² + 6a + 36) -6(a² + 6a + 36)

= a³ + 6a² + 36a

      -  6a² -  36a - 218

= a³ + 0a² +  0a  - 218

= a³ - 218

The measures of two vertical angles are represented by (4x - 7) and (2x - 13). What is the sum of the two angles measures?

a. 33
b. 45
c. 66
d. 90

Answers

Final answer:

The sum of the two vertical angles (4x - 7) and (2x - 13) is 33 degrees.

Explanation:

To find the sum of the two vertical angles, we need to equate the expressions representing the measures of the angles and solve for x.

(4x - 7) = (2x - 13)

4x - 7 = 2x - 13

2x = -6

x = -3

Now we can substitute x = -3 back into one of the expressions to find the angle measures.

Angle 1 = (4x - 7) = (4(-3) - 7) = -12 - 7 = -19

Angle 2 = (2x - 13) = (2(-3) - 13) = -6 - 13 = -19

The sum of the two angle measures is: -19 + -19 = -38

Since angle measures cannot be negative, we can conclude that the sum of the two angle measures is 38 degrees. Answer choice (c) 66 is incorrect because the sum is not positive. The correct answer is (a) 33 degrees.

Other Questions
Consider the following balanced equation: SiO2(s)+3C(s)SiC(s)+2CO(g) Complete the following table showing the appropriate number of moles of reactants and products. If the number of moles of a reactant is provided, fill in the required amount of the other reactant, as well as the moles of each product formed. If the number of moles of a product is provided, fill in the required amount of each reactant to make that amount of product, as well as the amount of the other product that is made.Mol SiO2 Mol C Mol SiC Mol CORow 1: 3 _____ _____ _____Row 2: _____ 6 _____ _____Row 3: _____ _____ _____ 16Row 4: 2.8 _____ _____ _____Row 5: _____ 2.45 _____ _____A. complete the first row. Express your answers using one significant figure separated by commas. Mol C, Mol SiC, Mol CO =B. Complete the second row. Express your answers using one significant figure separated by commas. Mol SiO2, Mol SiC, Mol CO =C. Complete the third row. Express your answers using two significant figures separated by commas. Mol SiO2, Mol C, Mol SiC =D. Complete the fourth row. Express your answers using two significant figures separated by commas. Mol SiO2, Mol C, Mol SiC =E. Complite the fifth row. Express your answers using three significant figures separated by commas. Mol SiO2, Mol SiC, Mol CO = The emergence of__________ led people to question the role of religion in government. what is -4,5 reflected across the x axis 3(14-5x) = 72what is x A(n) __________ consists of independent firms at different levels of production and distribution joining together through contracts. Suppose there are ten five- and six-year-olds attending a birthday party. when a 30-year-old mother walks into the room with an infant in her arms, what happens to the mean age in the room? what happens to the standard deviation of ages in the room? remmi wrote the equation of the line y=1/3(x+2). He solved for x and got x=3y-2. which following is an equivalent equation for x? The belief that some races are innately superior to others is called _____ sidaanth kept a chart of his savings .which point represents this relationship? One of the functions of the respiratory system is to rid the body of co2. Where does the co2 come from? A rectangle has a perimeter of 48 inches. Each side is a whole number of inches. What is the difference between the greatest and least areas that the rectangle can have Organizations can be small or large groups. Please select the best answer from the choices provided T F What is the term for heat transfer because of the movement of electromagnetic The abdominal wall muscle that forms the inguinal ligament is the _______________. How can you identify the geography of the Mesoamerican Civilizations? There are THREE of them. Explain what you know about EACH one. What is the value of x? Show all of your work.Round your answer to the nearest tenth. What are the x and y intercepts of y=x^2+3x-10 (show all steps please) What type of molecule speeds up chemical reactions in living things? A. Lipid B. Nucleic acid C. Protein D. Water Describe how convergence relates to orogenic belts? The difference between 48 and 13 algebra numeral expression. Steam Workshop Downloader