in the movie The Martian why does Watney need to move away from the HAB?

Answers

Answer 1
Its gonna blow!!! jk running out of oxygen

Answer 2
Final answer:

While the movie The Martian portrays a strong windstorm forcing Mark Watney to move away from the HAB, in reality, Mars' thin atmosphere makes such forceful windstorms unlikely. Watney's movements away from the HAB are more a result of seeking survival solutions than escaping the aftermath of a storm. The movie creatively explores human survival and ingenuity on Mars, though it takes liberties with Martian atmospheric science.

Explanation:

In the movie The Martian, the protagonist Mark Watney, played by Matt Damon, is stranded on Mars due to a strong windstorm that forces his crew to evacuate, thinking him dead. This premise raises intriguing questions about the possibility of such windstorms on Mars. Although the depiction of Mars in the film is largely accurate, astronomers have pointed out that the Martian atmosphere is too thin for windstorms to possess the force shown in the movie. Thus, the scenario dramatized in the film, including the necessity for Watney to move away from the HAB (Habitat Module), stems more from creative license than from scientific accuracy. However, this fictional setup serves as a backbone for exploring human ingenuity and survival in extraterrestrial environments.

Watney's decision to move away from the HAB at different points in the story is driven more by narrative needs and his strategies for survival, such as finding a way to communicate with Earth or traveling to the Ares 4 landing site, rather than by the windstorm's aftermath. The challenges Watney faces and overcomes highlight a powerful message about resilience and the capacity to innovate under dire circumstances.


Related Questions

a 727 jet needs to attain a speed of 200 mph to take off. if it can accelerate from 0 to 200 mph in 30 seconds, how long must the runway be? (assume constant acceleration) ...?

Answers

Thank you for posting your question here at brainly. I hope the answer will help you. Feel free to ask more questions here.

Since v = dx/dt = 200t

I took the integral of dx = integral of 200t dt

and I got x = 100t^2 + C

So I plugged in 0.5 as t and got x = 25

So x = 25 miles
Final answer:

Using the equations of motion, the length of the runway required for the 727 jet to take off can be determined. By calculating the acceleration and using the distance formula, we find that the runway must be at least 44.7039 meters long.

Explanation:

To determine the length of the runway required for the 727 jet to take off, we can use the equations of motion.

First, convert the speed from mph to m/s: 1 mph = 0.44704 m/s.Next, calculate the acceleration of the jet using the formula:acceleration = change in velocity / timeGiven: final velocity = 200 mph = 200 * 0.44704 = 89.408 m/sInitial velocity = 0 m/sTime = 30 secondsacceleration = (89.408 - 0) / 30 = 2.98027 m/s².Finally, use the equation:distance = initial velocity * time + (1/2) * acceleration * time²Given: initial velocity = 0 m/sacceleration = 2.98027 m/s²time = 30 secondsdistance = 0 * 30 + (1/2) * 2.98027 * (30)² = 0 + 44.7039 = 44.7039 meters

Therefore, the runway must be at least 44.7039 meters long for the 727 jet to take off.

Put these greenhouse effect events in order, starting with light's origin.

1. Visible and shortwave radiation heat Earth
2. Earth radiates longwave radiation
3. Longwave radiation is reflected downward
4.. Longwave radiation heats Earth

Answers

Incident infrared radiation is blocked. Visible and ultraviolet radiation heat  Earth. Earth radiates infrared radiation. Infrared radiation is blocked and heats Earth. Visible and shortwave radiation heat Earth.Earth radiates longwave radiationLongwave radiation is reflected downward Longwave radiation heats Earth

1. Visible and shortwave radiation heat earth.

2. Earth radiates longwave radiation.

3. Longwave radiation is reflected downward.

4. Long wave radiation heats earth.


A group of atoms with aligned magnetic poles are known as which of the following?
A. current
B. poles
C. domains
D. fields ...?

Answers

A magnetic domain is a group of atoms aligns with magnetic poles. Domains are usually light and dark stripes visible within each grain.

Answer:

The correct answer is option C. "domains".

Explanation:

The regions within a magnet at which the magnetization is in a uniform direction are known as magnetic domains. These domains are group of atoms with aligned magnetic poles, this means that the magnetic moments of the atoms are aligned and that their point to the same direction. The magnetic domains are the ones that give the magnetic behavior of ferromagnetic materials.

looters break a statue into pieces. how do you expect the weathering of pieces of rock to change

Answers

This definitely has to do with erosion. We can expect that the statue will weather faster because of more surface area.I hope this is what you were looking for

Felipe drives his car at a velocity of 28 m/s. He applies the brake, which slows the vehicle down at a rate of 6.4 m/s2 and causes it to slow to a stop. How long does it take for the car to stop? Round your answer to the nearest tenth.
I'm supposed to use derived formulas to find the answer but I don't know which one to use.

Answers

So after ~4.4 seconds, car will stop.
The answer is: 4.4 seconds

What happens to light that shines on an object but is not transmitted?

A. It is scattered or refracted.

B. It is polarized or absorbed.

C. It is reflected or refracted.

D. It is reflected or absorbed.

Answers

The answer is it is reflected or absorbed, so D. 

What type of machine is a seesaw?



A.
simple machine

B.
compound machine

Answers

Answer: Option (A) is the correct answer.

Explanation:

A seesaw is a simple machine which has a long board and on a fixed part it is balanced in the middle.

For example, a seesaw on which children play in the park is balanced at the middle on a fixed point so that children sitting on both the sides can move up and down with the same force.

Thus, we can conclude that seesaw is a simple machine type of machine.

Seesaw is classified as a simple machine. The correct option is( A)

What is simple machine ?

A seesaw is categorized as a basic machine since it functions using the levering principle. One of the six traditional simple machines, together with the inclined plane, wedge, screw, wheel and axle, and pulley is the lever.

The lever in the case of a seesaw is a long, rigid beam that pivots on a fulcrum. A back-and-forth motion is possible because of the effort put in on one end of the seesaw, which forces the other end to rise and fall.

Therefore, The correct option is ( A)

Learn more about simple machine here :brainly.com/question/31090053

#SPJ6

The formula for degrees Celsius is: C = 5/9 (F − 32), where F stands for degrees Fahrenheit.

Part 1: Solve the equation for F and show all steps.
Part 2: Determine how many degrees Fahrenheit 20 degrees Celsius is.

Answers

C = 5/9 (F-32)Part 1.  C=5F/9-(5/9)325F/9=C+160/9F=(9/5)C+(9/5)(160/9)F=(9/5)C+32for part 2:
F=(9/5)20+32F=36+32=68 degrees Fahrenheit

To solve for F in the conversion formula, multiply both sides by 9/5 followed by adding 32 to isolate F. When converting 20 degrees Celsius using the formula, the result is 68 degrees Fahrenheit.

Part 1: Solving the equation for F

To solve the equation C = 5/9 (F - 32) for F, perform the following steps:

Multiply both sides by 9/5 to get rid of the fraction on the right side: 9/5 × C = F - 32.

Add 32 to both sides of the equation to isolate F on one side: 9/5 × C + 32 = F.

Part 2: Converting 20 degrees Celsius to Fahrenheit

To find out how many degrees Fahrenheit 20 degrees Celsius is, plug 20 into the rearranged equation:

F = (9/5) × 20 + 32.

Therefore, F = 36 + 32 = 68 degrees Fahrenheit.

A horizontal rope is tied to a 50.0kg box on frictionless ice. What is the tension in the rope if,

A. the box is at rest
B. the box moves at a steady 5.0m/s
C. the box has v_x=5.0m/s and a_x=5.0m/s²

Answers

A.
The tension is 0 because there is no net force.

B.
The tension is once again 0 because the acceleration is 0 which means there is no net force.

C.
F = ma
F = 50 kg x 5 m/s²
F = 250 N

A).

The tension in the rope when box is at rest is [tex]\fbox{\begin\\0\text{ N}\end{minispace}}[/tex].

Further Explanation:

The box, is tied to a horizontal rope, is placed on the surface of frictionless ice. The box is at rest and therefore, the velocity and acceleration of the box are zero.

Given:

The mass of the box, placed on the surface of frictionless ice, is [tex]50\text{ kg}[/tex].

The velocity of the box is [tex]0\text{ m/s}[/tex].

Concept:

The net force on the box, tied to the rope and placed on the surface of the frictionless ice, is equal to the product of mass of the box and the acceleration of the box.

The net force on the box is:

[tex]F=ma[/tex]                       ...... (1)

Here, [tex]m[/tex] is the mass of the box, [tex]a[/tex] is the acceleration of the box and [tex]F[/tex] is the net force on the box.

The box is placed on the surface of ice which is frictionless. Therefore, the net force on the box is equal to the tension produced in the rope.

The tension produced in the rope:

[tex]\fbox{\begin\\T=ma\end{minispace}}[/tex]                         ...... (2)

Here, [tex]T[/tex] is the tension produced in the rope.

Calculation:

Substitute the values in the equation (2).

[tex]\begin{aligned}\\T&=50\text{kg}\times0\\&=0\text{ N}\end{aligned}[/tex]

Thus, the tension in the rope when box is at rest is [tex]\fbox{\begin\\0\text{ N}\end{minispace}}[/tex].

B).

The tension in the rope when box is moving at a steady speed of [tex]5\text{ m/s}[/tex] is [tex]\fbox{\begin\\0\text{ N}\end{minispace}}[/tex].

Further Explanation:

The box is moving at the steady speed of [tex]5\text{ m/s}[/tex]. The acceleration of the box is zero because the rate of change of velocity with respect to time is zero.

Given:

The velocity of the box is [tex]5\text{ m/s}[/tex].

Calculation:

Substitute the values in the equation (2).

[tex]\begin{aligned}\\T&=50\text{kg}\times0\\&=0\text{ N}\end{aligned}[/tex]

Thus, the tension in the rope when box is moving at a steady speed of [tex]5\text{ m/s}[/tex] is [tex]\fbox{\begin\\0\text{ N}\end{minispace}}[/tex].

C).

The tension produced in the rope when the box is moving with velocity [tex]5\text{ m/s}[/tex] and it has acceleration [tex]5\text{ m}/\text{s}^2[/tex] is [tex]\fbox{\begin\\250\text{ N}\end{minispace}}[/tex].

Given:

The acceleration of the box is [tex]5\text{ m}/\text{s}^2[/tex].

The velocity of the box is [tex]5\text{ m/s}[/tex].

Calculation:

Substitute the values in the equation (2).

[tex]\begin{aligned}T&=50\text{ kg}\times5\text{ m}/\text{s}^2\\&=250\text{ N}\end{aligned}[/tex]

Thus, the tension produced in the rope when the box is moving with velocity [tex]5\text{ m/s}[/tex] and it has acceleration [tex]5\text{ m}/\text{s}^2[/tex] is [tex]\fbox{\begin\\250\text{ N}\end{minispace}}[/tex].

Learn more:

1.  Conservation of energy brainly.com/question/3943029

2.  The motion of a body under friction brainly.com/question/4033012

3. A ball falling under the acceleration due to gravity brainly.com/question/10934170

Answer Details:

Grade: High School

Subject: Physics

Chapter: Kinematics

Keywords:

Acceleration, frictionless surface, steady speed, tension in the rope, tension in the string, net force, ice-box system, 250N, 250 newton, 250 Newton, 0 N, 0 newton, 0 Newton, rope mass system, string mass system.

Laissez-faire situations are characterized by a high degree of government involvement (t or
f.

Answers

the answer to this is false, I hope that helped

False

The Laissez-faire is a french term which means 'let you do' or leave alone. With regards to economics it refers to the least control of government in trade and business of the country. With regards to the polity, it refers to the least interference of government in the life of individual. So Laissez-faire situations are actually characterized by a least government involvement.

what is the energy of a photon whose frequency is 5.2 x 10 to the 15th s -1? Cassie(:

Answers

E=hf
Where h is constant
h - Planck constant
f - frequiency

E equals 6.626 times 10 in the minus 34th times 5.2 times 10 in the 15th

Equals 3.44552 time 10 in the minus 18th

A 30.0 g arrow is shot by William Tell though an 8.00 cm thinck apple sitting on top of his son's head. If the arrow enters the apple at 30.0 m/s and emerges at 25.0 m/s in the same direction, with what force has the apple resisted the arrow?
...?

Answers

Final answer:

The resistive force of the apple on the arrow is 46.875 N in the direction opposite to the arrow’s travel, calculated using the work-energy theorem and the change in kinetic energy of the arrow as it passes through the apple.

Explanation:

To find this force, we can use the work-energy theorem which states that the work done on an object is equal to its change in kinetic energy. Since the arrow slowed down, the apple did work against the arrow's motion.

The change in kinetic energy (ΔKE) of the arrow can be calculated using the kinetic energy formula KE = 1/2 mv², where m is the mass of the arrow and v is its velocity. By finding the difference in kinetic energy at the entry and exit points of the arrow through the apple, we can determine the work done by the apple, which is equal to the force times the distance the force acted (in this case, the thickness of the apple).

ΔKE = 1/2 m(vf² - vi²) where vi = initial velocity and vf = final velocity.
ΔKE = 1/2 × 0.030 kg × (25.0² - 30.0²) m²/s²
ΔKE = -3.75 Joules (since the kinetic energy decreased).

The work done by the apple, W = ΔKE = -3.75 J (the negative sign indicates the force acted opposite the arrow's direction).
Using work (W) = force (F) × distance (d), we get:
F = W/d
F = (-3.75 J) / (0.080 m)
F = -46.875 N

So, the resistive force of the apple on the arrow is 46.875 N in the opposite direction of the arrow’s travel.

Final Answer:

The force exerted by the apple resisting the arrow is 30.0 N.

Explanation:

The force exerted by the apple resisting the arrow can be calculated using Newton's second law of motion, which states that force (F) is equal to the change in momentum (Δp) divided by the time interval (Δt) over which the change occurs. Since the arrow's mass (m) is given as 30.0 grams and its initial and final velocities (v_i and v_f) are 30.0 m/s and 25.0 m/s, respectively, the change in momentum is calculated as Δp = m * (v_f - v_i). First, convert the mass to kilograms (1 g = 0.001 kg) to get 0.030 kg. Then, substitute the values into the formula:

Δp = 0.030 kg * (25.0 m/s - 30.0 m/s) = 0.030 kg * (-5.0 m/s) = -0.150 kg m/s.

The negative sign indicates that the momentum of the arrow decreases. As the arrow changes momentum, Newton's third law of motion tells us that the apple exerts an equal and opposite force on the arrow. Therefore, the force exerted by the apple on the arrow is 0.150 kg m/s divided by the time interval over which the change occurs. The time interval isn't provided, but for the purpose of this calculation, let's assume it's instantaneous (Δt = 0).

F = Δp / Δt = -0.150 kg m/s / 0 = -0.150 kg m/s² = -0.150 N.

However, this negative force indicates the force exerted by the arrow on the apple. To find the force exerted by the apple resisting the arrow, we take the magnitude of this force, which is 0.150 N. Thus, the force exerted by the apple resisting the arrow is 0.150 N, or 30.0 N in magnitude when considering the absolute value.

when a bullet is fired, does gunpowder only travels back towards the shooter

Answers

It seems that you have missed the necessary options for this question, but anyway the correct answer for this would be FALSE. It is not true that when a bullet is fired, gunpowder only travels back towards the shooter. Though gunpowder residue can remain on the shooter's hand for a few hours. Hope this answer helps.

Answer:

false

Explanation:

Which of the following statements is true for a cell placed in beaker containing an isotonic solution?

Select one of the options below as your answer:



A.
Water molecules flow from the cell into the beaker.




B.
Water molecules flow from the beaker into the cell.




C.
Water molecules flow in both directions at the same rate.




D.
There is no movement of water molecules.
....i dont even know how to nswer this one becasue i dont know wht and isotonic solution means

Answers

An isotonic solution is a solution in which concentration or solute is equal to that of a cell placed in it. Thus, the system is in dynamic equilibrium, and so water molecules flow in both directions.
The correct answer is C. water molecules flow in both directions at the same rate.

As we learn more, _________ are often revised. scientific laws scientific theories observation experiments

Answers

Here is the answer that would best complete the given statement above. As we learn more, SCIENTIFIC THEORIES are often revised. Scientific theories are considered as the substantial explanation of some aspect of the natural world which are gathered through scientific method. Hope this is the answer that you are looking for.

Answer:

Scientific theories

Explanation:

. An engineer wants to determine an efficient method for condensing large amounts of steam into liquid water. Which constant should she use?
A. - (triangle)H Vapor
B. - (triangle)H Fusion

Answers

The scientist should use the constant l (triangle)H Vapor, the Latent heat of vaporization.

What is Latent heat of vaporization, ◇Hvapor?

The latent heat of vaporization is the amount of heat required to change a unit mass of a liquid to vapor at its boiling point and vice versa.

Since the scientist wants to determine an efficient method for condensing large amounts of steam into liquid water, he should use (triangle)H Vapor.

Learn more about latent heat of vaporization at: https://brainly.com/question/9849439

#SPJ2

Energy and work are measured in the SI unit called

Answers

Answer : joule

I attached a picture that may help :)

Which of the following determine an object's velocity?

A.
speed and direction
B.
direction and acceleration
C.
speed and mass
D.
speed, direction, and acceleration

Answers

a. speed and direction......

Speed and direction are the factors that affect an object's velocity.

What do your mean by velocity?

The displacement that an object or particle experiences with respect to time is expressed vectorially as velocity. A vector quantity, that is. The change in an object's displacement with respect to time is known as velocity.

Displacement / Time = Velocity

The information is ,

Let V be the symbol for an object's velocity.

The measurement of V is now determined as

The concept of speed describes how quickly an object is traveling across a specific distance.

An object's speed just indicates how swiftly or slowly it is moving. It doesn't say which way the object is moving. Speed and direction are both referred to by the word velocity. A vector is an amount of velocity.

Now that the displacement is a vector quantity with direction, the equation for velocity is displacement / time.

As a result, an object's velocity is determined using its speed and direction.

Click here to learn more about velocity.

https://brainly.com/question/19979064

#SPJ6

The Enlightenment period supported reason over religious beliefs.

Please select the best answer from the choices provided

T F

Answers

true it help support reglions

 i think the answer would be true

What are two ways that we use electromagnetic waves??

Answers

-- SEE things, by the electromagnetic visible light that they either radiate or reflect. -- Warm the leftover meatloaf in the microwave. -- Open the garage door from inside the car using the remote. -- Lay outside and get a tan. -- Watch the game on TV. -- Do ANYTHING with your smartphone
-- Get an X-ray to see if your ankle is broken or just sprained. -- Listen to the weather report on the radio. -- Do ANYTHING with GPS.

The strength of the force of gravity depends on a. the masses of the objects and their speeds. b. the masses of the objects and the distance between them. c. the weight of the objects and their speeds. d. the masses of the objects and their weights.

Answers

Gravitational force = Gxm1xm2 /r^2 This equation depends only upon object's masses and distance between them. So option b is correct

Frequency is measured in units called?

Answers

The frequency, f, of a wave is the number of waves passing a point in a certain time. We normally use a time of one second, so this gives frequency the unit hertz (Hz), since one hertz is equal to one wave per second.

The frequency of a wave is the inverse of time period. Hence, its unit is s⁻¹ which is equivalent to Hz unit. The standard unit of frequency is Hz.

What is frequency ?

Frequency of an event is the number of cycles of that event per unit time. For a wave frequency is the number of wave cycles per second. Hence, frequency is the inverse of time period.

Frequency of a wave is directly proportional to the energy of the wave and inversely proportional to the wavelength. Hence, the high frequency waves are shorter waves.

The unit of frequency is called Hertz (Hz) which is equal to s⁻¹ because, it is the frequency is inverse of the time period of the wave. Therefore, frequency is measured in units called Hertz.

Find more on frequency:

https://brainly.com/question/14316711

#SPJ2

Den pushes a desk 400 cm across the floor. He exerts a force of 10 N for 8 s to move the desk.

What is his power output? (Power: P = W/t)

a. 1.25 W
b. 5 W
c. 40 W
d.500 W

Answers

We Know, P = W/t
P = F * s/t
Here, F = 10N
s = 400cm = 4m
t = 8 sec.

Substitute their values in to expression,
P = 10 * 4/8
P = 10 * 1/2
P = 5 Watt

So, your final answer is 5 W

Hope this helps!

Answer: The correct option is Option b.

Explanation:

Power is defined as the rate of work done by an object.

Mathematically,

[tex]P=\frac{W}{t}[/tex]    .....(1)

And work done is the product of force exerted on the object times the displacement covered by that object.

Mathematically,

[tex]W=F.s[/tex]

Putting this value in above equation, we get:

[tex]P=\frac{F.s}{t}[/tex]

where,

P = power = ?W

F = Force exerted = 10N

s = Displacement = 400cm = 4m   (Conversion factor: 1m = 100 cm)

t = Time taken = 8s

Putting values in above equation, we get

[tex]P=\frac{10\times 4}{8}\\\\P=5W[/tex]

Hence, the correct option is Option b.

Why is a protective apron or lab coat important to use when working with acids?

Answers

It helps protect against harm to skin. For example hydrochloride acid is toxic and it is a good idea to cover up when using or dealing with chemicals of all kinds.

Answer:

c

Explanation:

Cindy runs 2 kilometers every morning. She takes 2 minutes for the first 250 meters, 4 minutes for the next 1,000 meters, 1 minute for the next 350 meters, and 3 minutes for the rest.

Cindy’s average speed for the entire run is __ meters per minute. One kilometer is the same as 1,000 meters.

Hint: Average Speed = Total Distance/Total Time

Answers

It's 200 on Edmentum

Which is true about atoms?
a.atoms have no mass
b.atoms are mostly empty space
c.most of the space in an atom is taken up by the nucleus?

Answers

B).atoms are mostly empty space 

This is the only answer. Hope this helps!
B.atoms are mostly empty space


While skiing, Ellen encounters a ledge that sends her flying horizontally at a rate of 12 m/s. How far away will she land if the ledge is 7 meters high? ...?

Answers

In this problem, we must first calculate that Ellen will be on air. Using the equation of a free-falling body,

y = -g/2*t^2 + y0

When she hits the ground, y = 0. With y0 = 7 and g = 9.80,
0 = -4.90*t^2 + 7
t = 1.20 s

Thus, her horizontal displacement is then
x = vt
x = (12)(1.20)
x = 14.3 m

Two identical small cars (car A & car B) have a head-on collision. Which scenario is true?

A. Car A exerts a greater force on car B than car B exerts on car A.
B. Car B exerts a greater force on car A than car A exerts on car B.
C. The force that car A exerts on car B and the force that car B exerts on car A are the same magnitude.

Answers

C. The force that car A exerts on car B and the force that car B exerts on car A are the same magnitude.

Answer:

The force that car A exerts on car B and the force that car B exerts on car A are the same magnitude.

Explanation:

There can be two types of collision i.e. elastic and inelastic collision. Elastic collision is also known as head-on collision. In this type of collision, the momentum and kinetic energy before and after the collision remains the same.

If two identical small cars (car A & car B) have a head-on collision, then the force that car A exerts on car B and the force that car B exerts on car A are the same magnitude. It is due to Newton's third law of motion which states that there is an equal and opposite reaction when one object applies a force on another object. So, the correct option is (c).  

Which of the following is not true of mutations?

A. Mutations can't result in a change in appearance.
B. A mutation is permanent.
C. Mutations can be passed from parent to child.

Answers

the answer is
A Mutations can't result in a change in appearance
because quit contrary they can for example what would be a white mouse with a mutation in fur color can have brown fur due to the mutation

Answer:

A. Mutations can't result in a change in appearance.

Explanation:

A mutation is a sudden change in DNA that occurs at random in genetic material and can be transmitted to offspring. A mutation can also be caused by exposure to ultraviolet or ionizing radiation, chemical mutagens, or viruses. When the mutation occurs, it is permissible and continues with the individual until the day of death, as it is irreversible as it has modified the coding of DNA. When a mutation occurs, it can cause differences in the appearance of the individual, such as Down's syndrome, which changes not only the appearance, but the organism altogether. Therefore, we can consider that the answer to your question is the letter A.

If the work function for a certain metal is 1.8eV, what is the stopping potential for electrons ejected from the metal when light of wavelength 400nm shines on the metal? And what is the maximum speed of the ejected electrons? ...?

Answers

First of all the equation you need is this one
E=Ek+ϕ Ek=eV0
Please remember that the energy of a photon of wavelength lambda is given by E=hcλ

you can then calculate the maximum kinetic energy since you know the work function of the metal (1.8eV), and the wavelength of the photons (400 nm) (remembering to convert to SI units of joules for the work function). You can then find the maximum velocity of the electrons easy enough.You can obtain the stopping potential usign the next formula
Ek=eV0
Because it is a stopping voltage, V_{0}  and remember it will have the units of volts.
I think with that I can help you a lot. 
Final answer:

To find the stopping potential and the maximum speed of ejected electrons from a metal with a given work function when exposed to a specific wavelength of light, physicists use the photoelectric effect principles. Calculations involve the use of Planck's constant, the speed of light, and the electron charge to first determine the energy of incident photons and then the electrons' kinetic energy and velocity.

Explanation:

To determine the stopping potential for electrons ejected from a metal when light of wavelength 400 nm shines on it, first, we use the photoelectric equation: E(Photon) = Work Function + Kinetic Energy(Max). The energy of a single photon (E) can be found with the equation E=hc/λ, where h is Planck's constant (6.626 x 10^-34 J·s), c is the speed of light (3.00 x 10^8 m/s), and λ is the wavelength in meters. For the stopping potential, the maximum kinetic energy of the ejected electrons is equal to the electrical energy qV, where q is the charge of an electron (1.602 x 10^-19 C) and V is the stopping potential.

Using these equations and the given work function, the maximum speed of electrons can be calculated using the formula for kinetic energy: KE = 0.5 * m * v^2, where m is the mass of the electron (9.109 x 10^-31 kg) and v is the velocity.

The exact calculations for the stopping potential and maximum speed are not provided here, since we are not certain about the correctness of these specific answers.

Other Questions
The Punnett square for a non-freckled parent and a homozygous freckled parent is shown below. What is the probability that their children will have freckles? a 100% b 50% c 0% d 75% F F f Ff Ff f Ff Ff a piggy bank contains only nickels and quarters. The total value in the back is $3.80. Write an equation in standered form that models the possible combinations of nickels and quarters in the piggy bank Which of these political alliances was put together to ensure military and political protection of its members after world war 2. A. North Atlantic Treaty Organization (NATO)B. African Union (AU)C. European Union (EU)D. United Nations (UN) What is the volume of a cone with a radius of 18 cm and a height of 10 cm? Use 3.14 for pi. Round your answer to the nearest tenth A website sells used comic books. The table shows how the price of Painted Tiger, Volume 1, has changed over the last 4 months. If the price started at $7.37, what is the current price? Explain how you know that your answer is reasonable. How does the older you get the worse something has to be to make you cry thriving explain why What is the solution set of 2x2 7x 5=0?? We have four here to board, great good-for-nothings,Sprawling about the kitchen with their talkWhile I fry their bacon. Much they care!No more put out in what they do or sayThan if I wasn't in the room at all.What does the word sprawling suggest?The kitchen is spacious and comfortable.The men act with inappropriate ease in the home.The men feel awkward and uncomfortable around the narrator. what property can you use to solve 2095 #1: The theoretical yield of a reaction is 5.00 moles of potassium permanganate (KMnO4). If the reaction actually produces 695.2 g KMnO4, what is the percent yield of the reaction?A. 78% B. 83% C. 88% D. 120% What does armistice mean?? jaunita and samuel are planning a pizza party they order a rectangular sheet Pizza that measures 21 inches by 36 inches they tell the pizza maker not to cut it because they want to cut it themselves all pieces of pizza must be square with none left over what is the side length of the largest Square pieces into which Juanita and Samuel can cut the pizza A 200. N wagon is to be pulled up a 30 degree incline at constant speed. How large a force parallel to the incline force is needed? Assume no friction. ...? Which part of the eye controls the size of the pupil? A. optic nerve B. cornea C. iris D. retina If you were a water molecules in a glass of water how would you best describe your relationship with the water molecules around you Why is size an important feature of a population? True or false the cardiovascular system does not interact with any other body system What does warren suggest is more important that the "dignity of government"? Order these numbers from least to greatest. 8 7/11 , 8.17 , 8.174 , 173/20 Explain why 17:3 and 68:12 are equivalent ratios Steam Workshop Downloader