Look at the DNA segment below. GATCGT Which of the segments below would be complementary to the segment above during DNA replication?

Answers

Answer 1

Answer:

CTAGCA

Explanation:

During DNA replication, the DNA double helix is unwound by DNA helices. Each original strand is then used as a template,  by the DNA polymerase, to synthesize a new strand. Base pairing rules apply in the synthesis. Cytosine pairs with Guanine while Adenine pairs with Thiamine.


Related Questions

Who created the modern model of the solar system by discovering that the plantes move in elipses? a. Galileo c. Ptolemy b. Kepler d. Copernicus Please select the best answer from the choices provided

Answers

Answer:

B-Kepler

Explanation:

The correct answer is B. Kepler

Explanation:

Johannes Kepler was an important astronomer and mathematician during the 17th century mainly known for his proposals related to the planetary motion that was the base for modern models of the solar system as well as other works such as the theory of universal gravitation by Newton. In his theory, Kepler proposed three main laws that stated the orbit of planets were elliptical rather than perfectly circular, the orbital period dependent on the axis or longest diameter of the orbit and each orbit had two foci. Additionally, this model differs from Copernicus because Copernicus had proposed orbits were circular. Therefore, the astronomer that created the modern model of the solar system and discovered orbits were elliptical was Kepler.

Gene mutations can be passed on to future generations and drive natural selection. Choose the best description of how gene mutations are involved in evolution.

A. Gene mutations often skip generations, with advantageous traits showing up several generations after the gene mutation was first introduced.
B. All gene mutations are passed to future generations and over many generations will contribute to the evolution of new species.
C. Gene mutations can be dominant or recessive for an organism. Dominant genes will be adaptive for future generations, but recessive genes won't.
D. Gene mutations can be helpful, harmful, or neutral for an organism's survival. Only mutations that are helpful in the organism's environment would influence its survival and reproduction.

Answers

Answer:

D

Explanation:

Natural selection, which powers evolution, favors traits in a population that offers an advantage in an environment. Mutations on genes that give advantage will, therefore, be preserved while those that are deleterious will be eliminated. For these mutations to be passed down generations, they have to be borne in gametes.

"The correct option is D. Gene mutations can be helpful, harmful, or neutral for an organism's survival. Only mutations that are helpful in the organism's environment would influence its survival and reproduction.

To understand why option D is the best description of how gene mutations are involved in evolution, let's analyze each option:

A. Gene mutations often skip generations, with advantageous traits showing up several generations after the gene mutation was first introduced.

- This statement is not entirely accurate. While it is true that some gene mutations may not have an immediate effect and can be carried in a population for several generations before becoming prevalent, this is not a general rule for how gene mutations contribute to evolution.

B. All gene mutations are passed to future generations and over many generations will contribute to the evolution of new species.

- This statement is incorrect because not all gene mutations are passed on to future generations. Many mutations are neutral or harmful and may be eliminated from the population through natural selection. Only those mutations that confer some advantage are likely to be passed on and potentially contribute to the evolution of new species.

C. Gene mutations can be dominant or recessive for an organism. Dominant genes will be adaptive for future generations, but recessive genes won't.

- This statement is misleading. Whether a gene is dominant or recessive does not determine its adaptiveness. A recessive gene can be beneficial, harmful, or neutral, just like a dominant gene. The adaptiveness of a gene mutation depends on its effect on the organism's fitness in a given environment.

D. Gene mutations can be helpful, harmful, or neutral for an organism's survival. Only mutations that are helpful in the organism's environment would influence its survival and reproduction.

- This statement is the most accurate description of the role of gene mutations in evolution. Mutations that are beneficial (helpful) in a particular environment can increase an organism's chances of survival and reproduction, thereby passing those mutations on to future generations. This process of natural selection can lead to the accumulation of advantageous traits in a population over time. Neutral mutations may persist in the population without affecting fitness, while harmful mutations are likely to be selected against.

In summary, option D correctly captures the essence of how gene mutations contribute to evolution by influencing the survival and reproductive success of organisms based on the environmental context."

Testosterone is synthesized primarily by the

Answers

Testosterone is synthesized primarily by the Leydig cells.

Hope this helps!

Have a great day! :D

☆ Dont forget to mark brainliest ☆

Which is a renewable source of energy

Answers

Answer:

Solar energy, oxygen, fresh water,  and biomass.

Explanation:

There were no answer choices.

Hope this helps!

Brainliest is appreciated. :D

Explanation:

there are quite a few but since u did not give any question choices here are a few:solar,hydro,biomass,geothermal these are only some

Hope it helps!

The male gametophytes of flowering plants are also referred to as _____.male sporophytes,embryo sacs,endosperm,pollen grains,megaspores

Answers

Answer:

pollen grains

Explanation:

Pollen grains are structures in the seed plants (spermatophytes) which contain vegetative cells  but also reproductive cells - microgametophytes. Microgametophytes produce 2 male gametes or sperm cells. Vegetative cells produce pollen tube which is involved in the transfer of sperm cells to the ovule (female structure that forms female gametes). Pollen grains are different in shape, size and color, but all of them are enveloped with hard coat that has protective role.

Answer:

Pollen grains

Explanation:

Pollen grains are make gametophytes

-I took the course :)

Timothy is planning to leave home to go on a long trip. His mother told him to take his cell phone in case of emergency. What is one way that cell phone technology may not be beneficial in this situation?

Answers

Answer:

d) Timothy may not have cell phone service in some areas

Explanation: USA Test Preps

Your mental health will suffer if you use your phone excessively. The excessive use of mobile devices over time increases anxiety, loneliness, and low self-esteem. When mobile devices aren't available, dependence on them can also lead to annoyance, aggravation, and impatience. Thus, option D is correct.

What cell phone technology not be beneficial in situation?

The causes of poor mobile phone signal can be divided into two groups: geographical distance from or obstructions between your phone and the nearest cell tower, and localized poor coverage caused by building materials or destructive interference.

It's not difficult to get a cell signal in a lifeless area. All you have to do is spend money on a signal booster for your cell phone. A cell phone signal booster enhances cell service and enables users to access services in locations with little to no service.

Therefore, Timothy may not have cell phone service in some areas.

Learn more about phone technology here:

https://brainly.com/question/23616830

#SPJ5

Lisa, a beginning marathon runner, trains in hot (80 degree), humid conditions. her third marathon occurs in hot (80 degree), dry conditions. while running, she consumes the same amount of water as she does in her previous races. close to the finish line, she gets a headache and collapses in seizures and slips into a coma. which hypothesis best fits what happened to lisa?

Answers

Answer: AND Explanation.

Lisa consumed too much water in too short of a time. This led to water leaking into the brain and disrupting the cerebrospinal fluid concentrations, impairing neural tissue activity

Lisa gets a headache, collapses in seizures, and slips into a coma, so based on the information provided, the most likely hypothesis for what happened to Lisa is that she experienced heat stroke, as presented in Option A.    

What is heat stroke?

Heat stroke is a serious and potentially life-threatening condition that occurs when the body's temperature regulation mechanisms fail, can happen when a person exercises in hot and humid conditions, in Lisa's case, she was used to training in hot and humid conditions, but her third marathon occurred in hot and dry conditions. Lisa's collapse, seizures, and slip into a coma suggest that her body temperature had risen to a dangerously high level, so she must be treated.

Hence, based on the information provided, the most likely hypothesis for what happened to Lisa is that she experienced heat stroke, as presented in Option A.

Find out more about heat stroke here.

https://brainly.com/question/2107818

#SPJ6

The question is incomplete, complete question is below

Lisa, a beginning marathon runner, trains in hot (80 degree), humid conditions. her third marathon occurs in hot (80 degree), dry conditions. while running, she consumes the same amount of water as she does in her previous races. close to the finish line, she gets a headache and collapses in seizures and slips into a coma. which hypothesis best fits what happened to lisa?

a)heat stroke

b)homeostasis

the study of the earth's air and weather is called ____

Answers

Answer:

the study of the earth's air and weather is called Meteorology.

Explanation:

Meteorology is the scientific study of the atmosphere that focuses on weather processes and forecasting.

Meteorological phenomena is observable weather and then explained by the science of meteorology.

Those events are bound by the variables that exist in Earth's atmosphere. These variables are  temperature, pressure, water, and the gradients and interactions of each variable.

The majority of the observed weather is located in the troposphere of Earth.

Although meteorologists now use computer models it is still  common to use techniques and conceptual models that were developed before computers.

The study of the earth's air and weather is known as meteorology, which involves predicting weather patterns and phenomena.

The study of the earth's air and weather is called meteorology. Meteorology is a branch of atmospheric science that focuses on the atmosphere and atmospheric phenomena to understand and predict earth's weather. Meteorologists use thousands of measurements, including air pressure and temperature, to generate weather forecasts. The related field of climatology examines climate, which encompasses averaged weather conditions over long periods, such as decades or centuries, focusing on patterns and effects on a broader temporal scale.

The amino acids for beta hemoglobin found in five animal species were compared to the amino acids found in human (Homo sapiens) beta hemoglobin. The number of sequence differences was recorded.
Based on the molecular data, what inference could you make about the anatomy of these species compared to human anatomy?
A) Anatomically, lemurs are most like humans.
B) Anatomically, gorillas are most like humans.
C) Anatomically, none of the species are similar to humans.
D) Anatomically, only the lemur differs from humans in any way.

Answers

Answer:

anatomically, gorillas are most like humans

Explanation:

Answer:

The correct answer is option B.

Explanation:

Hi!

Let's solve this!

According to the data, we will analyze each of the options:

A) Anatomically, lemurs are like humans. This option is incorrect.

B) Anatomically, gorillas are more like humans. This option is correct since gorillas and humans are similar

C) Anatomically, none of the species is similar to humans. This answer is incorrect since gorillas are similar to humans.

D) Anatomically, only the lemur differs from humans in some way. This answer is incorrect.

After the analysis, we conclude that the correct answer is option B.

Gender stratification refers to the ranking of males and females according to their access to power, property, and prestige based on their sex.

True
False

Answers

Gender stratification refers to the ranking of males and females according to their access to power, property, and prestige based on their sex. false

Calcium is necessary to initiate muscle contraction. Which of the following molecules binds calcium?A. tropomyosinB. troponinC. actinD. myosin

Answers

Answer:

b. troponin

Explanation:

Troponin is a globular protein present in striated muscle, cardiac muscle and skeletal muscle.

This protein is constituted by troponins T, I and C

The subunit C (Tn C) is the one that is responsible for binding Ca2 + calcium ions (each mole of protein binds two mole of Ca2 +).

Plants make their own food and are called producers. What do plants need to make their own food? A) soil, air and water B) soil, sunlight, and water C) sunlight, fertilizer, and water D) energy from the sun, air, and water

Answers

Answer:

D

Explanation:

A plant needs to use the energy from the sun to make glucose and other nutrients it needs. Air is needed for glycolysis and photosynthesis to occur. Water is needed by all living things to stay alive.  

D because u need air water and sunlight for photosynthesis aka to make their own food

NEED HELP!! Which of the following describes the most likely impact that exposure to pollutants in the atmosphere would have on one’s personal health?

It would stop cell-mediated immune responses.
It would lead to upper respiratory infections and pneumonia.
It would increase the release of red blood cells.
It would decrease one’s ability to produce antibodies.

Answers

Answer:

I think it would lead to upper respiratory infections and pneumonia is the right answer

Explanation:

It would be the second one down because if you consider places like china where they have super low air quality due to high pollution they tend to have upper respiratory issues which is why many of them wear masks.

In which of the following cases does an atom have a positive charge?

A. There are more electrons than neutrons.
B. There are more protons than electrons.
C. There are more electrons than protons.
D. There are more neutrons than electrons.

Answers

Answer:

B. There are more protons than electrons.

Explanation:

When the number of protons is greater than that of the electrons, such an atom becomes positively charged.

An atom is made up of three main subatomic particles which are the protons, neutrons and electrons.

The electrons are negatively charged particles that moves round a central nucleus in an atom. They occupy the bulk of the volume in an atom. They are considered weightless relative the nucleons ie protons and neutrons.

The protons and neutrons are massive particles that occupy a tiny centre region in an atom. They are called nucleons and this is where the bulk of the mass of an atom concentrates. Protons have positive charges on them whereas neutrons have no charge on them.

In a neutral atom, the number of protons and electrons are thesame. Here, the positive charges cancels out the negative charges.

For a cation which is a positively charged ion, the number of protons are greater than the number of electrons. A cation must have lost an electron to have tripped the balance.

For anions which are negatively charged ions, the number of electrons are greater than those of protons.

Answer:

The answer is B

Explanation:

Features that result directly from wave erosion include-

A.) Cliffs
B.) Breakwaters
C.) Spits
D.) Beaches

Answers

Answer:it’s A

Explanation:I promise I just had the answer on a test a got it right

The powerful waves of the water collide with the rocks and erode the sediments resulting in the formation of the cliffs. Thus, option A is correct.

What is wave erosion?

Wave erosion is the type of deterioration of the rocks and sediments because of the high and powerful wave energies that split and break the large rocky structures into smaller and vertical walls of rock layers.

The cliffs are formed of vertical rock layers that are the result of wave erosion as the powerful water energy splashes the rocks over and over to create the structure.

Therefore, the cliffs result from wave erosion.

Learn more about wave erosion here:

https://brainly.com/question/12739135

#SPJ2

WILL GIVE BRAINLIEST
Refer to the illustrations showing a sarcomere in two different stages to answer the question.
What does Stage 1 represent?


A. a muscle that is rotating

B. a muscle that is fully at rest

C. a muscle that is fully contracted

Answers

When the muscle is at rest, myosine heads are not interacting with actin. Stage 1 in the image represents a muscle that is fully at rest (Option B).

What are the components of the Sarcomere?

In the sarcomere, we can identify the following components,

A-band. This band reflects the length of the thick filament, including a small portion of the thin filament.

I-band. This is the area located between the ends of the adjacent thick filaments. It is composed only of thin filaments.

H-zone. This is the area located between the ends of the thin filaments. It is only composed of a portion of the thick filaments.

Z-band is the vertical line placed at the end of each sarcomere. In adjacent sarcomeres, Z-band can be found in the middle of the I band.

How does muscle contraction occur?

At rest    

At rest, tropomyosin is inhibiting the attraction strengths between myosin and actin filaments.

Tropomyosin is obstructing binding sites for myosin on the thin filament.

Contraction

During contraction, binding sites between myosine and actin become unblocked.

Myosin heads join to the uncovered actin-binding points forming cross-bridges. A power stroke initiates when this binding occurs. While the power stroke happens, myofilaments slide impulsed by chemical energy collected in myosin heads.

The muscular fiber gets shorter because the sarcomere reduces in length. The H line and the I band get shorter. Z-bands are pulled toward each other, shortening the sarcomere and the I-band, producing muscle fiber contraction. A band keeps constant in length.

Stage 1 in the image represents a muscle that is fully at rest (Option B). Binding sites between myosin and actin are blocked.

You can learn more about muscle contraction at

https://brainly.com/question/17960840

https://brainly.com/question/25018104

Whow do plants help maintain the quality of the atmosphere?

Answers

Answer:

By releasing the oxygen during the photosynthesis, and releasing the CO2 during the cellular respiration

Explanation:

The balance of gases in the atmosphere must be maintained.

Photosynthesis is a process performed by the plants (also some algae and bacteria) in which the energy of sunlight is transformed into chemical energy usable by those plants. Necessary components of this set of reactions are sunlight, water and CO2, while resulting products are glucose and oxygen. Products of photosynthesis are then used in the metabolic processes known as cellular respiration. During the cellular respiration, glucose and oxygen are used for the production of ATP, CO2 and water. Cellular respiration is performed in all living organisms.

The plants are living organisms that are producers. They are able to perform the process of photosynthesis. Through this process, the plants are included in numerous natural cycles, such as the oxygen cycle, carbon cycle, nitrogen cycle, water cycle. By using all these gases and the water, the plants manage to balance the atmosphere's composition and keep it healthy and in good condition that enables the other organisms to live. Basically, the plants are taking in the water in these gases for the process of photosynthesis, thus to produce their own food. As they use them, they release some of them in the atmosphere, some in the soil, while some are stored in them. The oxygen and the water vapor are some of the ones that are released into the atmosphere. This keeps the oxygen levels fairly constant in the atmosphere, and considering that the oxygen is crucial for the living organisms, this is very important. The water vapor is released into the atmosphere and it contributes to the formation of clouds, thus precipitation, clearing the air in the process. The carbon is mostly stored in them, so they manage to keep its levels stable and control the Greenhouse effect.

Which of the following statements best describes the importance of biogeochemical cycles?

A. They explain how adaptations of organisms can change based on environmental pressures

B. They explain how energy moves through trophic levels of an ecosystem

C. They chart how biotic changes destroy unstable ecosystems

D. They show how certain compounds and elements move through the environment and are continually used and recycled

Answers

Answer:

D

Explanation:

There are different types of biogeochemical cycles such as; carbon, nitrogen, sulfur, phosphorus, and etcetera named after the respective elements being recycled. They show how these essential elements pass in different spheres of the earth (lithosphere, atmosphere, and hydrosphere) and are used and recycled by different processes.

Final answer:

The importance of biogeochemical cycles lies in their role in transporting and recycling essential compounds and elements through the environment, which supports life and maintains ecosystem health.  So the correcct option is  D.

Explanation:

The best statement that describes the importance of biogeochemical cycles is: They show how certain compounds and elements move through the environment and are continually used and recycled (Option D). Biogeochemical cycles involve the movement of elements and water through living organisms (the biosphere) and the abiotic components such as the atmosphere, hydrosphere, and lithosphere. This process is crucial for maintaining life, as it ensures that essential nutrients are available for organisms to use and return to the environment in a continuous loop.

The water cycle, carbon cycle, and nitrogen cycle are examples of biogeochemical cycles that recycle water and elements needed by organisms. These cycles are fundamental to ecosystem structure and function. They regulate the availability of resources, support life processes, and are affected by various factors, including human activities which can disturb their balance, leading to environmental consequences.

16. What happens when an electrical gradient and a chemical gradient are applying opposite forces to active transport? A. They strengthen each other. B. They triple the strength of each other. C. They negate each other. D. They weaken the power of each gradient by half.

Answers

Answer:

C

Explanation:

This especially applies when the ions responsible for the chemical gradient have charges. The diffusion of the ions will be affected by the electric potential difference across the membrane. While they may want to diffuse freely across the membrane across a concentration gradient, they can only diffuse as far as the charge balance across the membrane allows.

C. They negate each other is the correct answer ig

BEST ANSWER GETS BRANLIEST!!

A population of coastal fish show signs of die-off when there are no known predators or environmental stressors in the area. What is the most likely explanation for what has happened to this population?

The population reached carrying capacity for the area.
The population evolved with a shorter lifespan.
The population reached its emigration period.
The population evolved with new eating habits.

Answers

Answer: the most likely case would be that population reached the carrying capacity of the area.

Explanation:

Explanation:First off the population of the prey that is the "coastal fish" In this case will increase in population and acquire a greater area for their survival and will start to (die-off).when the predators in an area are reduced or get extinct this change triggers a reaction called as "tropic cascade" in the ecosystem in which the change in the predator population has affects on the food web.

For example :when the wolves were eliminatefls from the American west, there were changes in the elk population and the vegetation the elk ate.

Therefore both preys and predators balance each other.

Which of the following causes populations to shift most quickly from an exponential to a logistic population growth?a. favorable climatic conditionsb. removal of predatorsc. decreased death rated. competition for resources

Answers

I'm pretty sure its b or c

D. Competition for resources. Every population has a carrying capacity(the max amount of individuals a population can sustain). once reached, growth rate will plateau.

Under- and mal-nourishment, a major concern in developing countries can lead to increases in infection susceptibility. hiv infection. antibiotic resistance. type ii diabetes.

Answers

Infection susceptibility is correct

What type of symmetry did your starfish have

Answers

Answer:

An adult starfish has radial symmetry

Explanation:

The starfish (and all echinoderms) start out with bilateral symmetry (which is like humans who have 2 symmetrical halves) during their larval stage. However, during metamorphosis they lose this bilateral symmetry and develop some kind of radial symmetry (5 identical parts).

most starfish have pentaradial symmetry, which means that they have five arms that radiate out from a central disk.

How do we explain?

pentaradial symmetry is a type of symmetry is common in echinoderms, which are a group of animals that includes starfish, sea urchins, and sea cucumbers.

There are a few exceptions to this rule. For example, some starfish have six arms, and others have even more. There are also some starfish that have lost their arms altogether. However, pentaradial symmetry is the most common type of symmetry in starfish.

Learn more about pentaradial symmetry at:

https://brainly.com/question/31544779

#SPJ6

Why is sweat a good coolant for the body?

a. the arterioles that transfer water to sweat move closer to the skin surface when it is hot.

b. breaking h bonds between water molecules in sweat requires energy from body heat.

c. sweat contains minerals such as sodium chloride.

d. sweat is non-polar?

Answers

I believe it would either be a or b

Sweat is a good coolant for the body because breaking hydrogen bonds between water molecules in sweat requires energy from body heat.

What is a coolant?

A coolant is a medium, usually fluid, used to draw heat from an object.

Sweat is a natural fluid from the body that exits the body through pores in the skin usually due to physical stress and/or high temperature for the purpose of regulating body temperature.

Large amounts of heat are needed to evaporate water, because hydrogen bonds need to be broken, therefore, sweating is an example of using water as a coolant.

Learn more about sweating at: https://brainly.com/question/19763172

#SPJ2

Which statement describes ozone?

A.
It forms a part of the upper atmosphere known as the ozone layer.
B.
It is a type of oxygen that is milky white in color.
C.
It consists of five oxygen atoms, making it a highly reactive molecule.
D.
A single ozone molecule can stay in the atmosphere for 100 years before it gets destroyed naturally.

Answers

A. It forms a part of the upper atmosphere known as the ozone layer.

A. Ozone forms a part of the upper atmosphere known as the ozone layer is the right statement to describe ozone.

What is ozone?

Ozone is a layer of the stratosphere that contains protective gases around the planet.

This layer is most important for the earth to prevent itself from global warming.Depletion of the ozone layer can cause the greenhouse effect.Global warming can cause the melting of glaciers, scarcity of water, etcThe reasons for the depletion of the ozone layer include the use of aerosols and CFC-releasing appliances like air conditioners and refrigerators.

Hence, option A is the right answer.

To learn more about the ozone layer, refer to:

https://brainly.com/question/14330630

#SPJ2

What does population density measure?

the different species in a community

the number of individuals in a sample

the degree of crowding of a population

the area occupied by a population

Answers

Answer: the area occupied by a population

Explanation:

A population density can be define as the number of individuals of the population of a species living in per unit area over a particular time. Population density may vary depending upon the number of live births, deaths, number of immigrated and migrated members counted in concerned period of time.

Answer:

[tex]\boxed{\mathrm{the \ area \ occupied \ by \ a \ population}}[/tex]

Explanation:

Population density is a measurement of population per land area.

[tex]\displaystyle \sf population \ density =\frac{population}{land \ area}[/tex]

The population density of a place tells us whether the place occupied by the population is densely or sparsely populated.

An ulcerated stomach lining often repairs itself once the source of inflammation has been eliminated. How is this possible?

a.) The tissue lining the stomach is an epithelium and thus capable of repair and renewal.
b.) The parasympathetic innervation of the stomach wall stimulates constant repair and renewal.
c.) The mucosa consists of a particularly vascular epithelium that facilitates efficient repair and renewal.
d.) All of the listed responses are correct.

Answers

Answer:

c.) The mucosa  consists of a particularly vascular epithelium that facilitates efficient repair and renewal

a.) The tissue lining the stomach is an epithelium and thus capable of repair and renewal

Explanation:

The cells that form the lining of the stomach are deemed to wear out regularly due to the regular food intake they handle.

Due to this constant wearing, this cells have a mechanism of rejuvinating in order to handle their work.

Answer: Option A

Explanation:

The ulcerated stomach lining often repairs itself if the inflammation is removed this is because the tissue lining the stomach has the ability to repair and regenerate.

The healthy gut of the individual takes 2 to 3 weeks to generate the new lining of stomach which will help in treating the inflammation caused in the inner lining.

hence, the correct answer is option A

In some species of jellyfish, red pigment is dominant to orange pigment. Give the genotype and phenotype between a homozygous dominant jellyfish and one that is orange.

Answers

Answer:

If you are asking for the genotypes and phenotypes of the offspring of the jellyfishes the answers are

genotype: Rr (heterozygous dominant)

phenotype: red

Explanation:

A homozygous dominant jellyfish is represented by RR. An orange jellyfish is represented by rr.

Final answer:

A homozygous dominant jellyfish with red pigment would have the genotype RR and exhibit a red phenotype. An orange jellyfish, as the recessive phenotype, may have a genotype represented as oo, showing the orange pigment due to the absence of the dominant red allele. This scenario reflects Mendelian genetics rather than incomplete dominance.

Explanation:

In the scenario where red pigment is dominant to orange pigment in jellyfish, a jellyfish with a homozygous dominant genotype for the red pigment would have the genotype of RR, where both alleles contribute to the expression of the red pigment, resulting in a red phenotype. An orange jellyfish, being the recessive phenotype, would have a genotype represented potentially as oo if we assume red is dominant to orange without intermediate expression (since the question does not specify incomplete dominance as in the flower examples provided). This scenario differs from incomplete dominance observed in some plants, where a heterozygous genotype results in a phenotype that is a blend of both parent phenotypes, such as the described pink snapdragons resulting from red and white parents.

Therefore, the genotype of the homozygous dominant jellyfish would be RR, indicating it produces a significant amount of red pigment and appears red. Conversely, the orange jellyfish, representing the recessive phenotype, would have a genotype that does not produce the red pigment, which could be represented as oo, thus expressing the orange pigment due to the absence of the dominant red allele.

Parasympathetic antagonists would stimulate gastrointestinal motility. True or False

Answers

the answer should be false

What is the definition of a dihybrid cross?

Answers

Answer:

Simply saying it is cross that involves two traits

Explanation:

In dihybrid cross  the phenotypes of two genes are followed through the mating of individuals which carry multiple alleles at those gene loci. In other words, two genes controlling two different phenotypic traits are observed in dihybrid cross.

"Dihybrid cross",means

"di" indicates that there are two traits involved  for example A and B and

"hybrid" indicates that each trait has two different allele, for example A and a or B and b.

A dihybrid cross is a genetic cross between two individuals that are heterozygous for two different traits.

In genetics, a dihybrid cross examines the inheritance patterns of two traits simultaneously. Each parent in the cross is heterozygous for both traits, meaning they possess two different alleles for each trait. The purpose of a dihybrid cross is to determine the probability of offspring inheriting various combinations of these traits, and it often follows Mendel's laws of independent assortment, which state that the alleles for different traits are distributed to sex cells (and offspring) independently of one another.

Other Questions
Find the perimeter of a triangle with sides measuring 5 centimeters , 9 centimeter, and 11 centimeters Freddy does not know why his wife seems so angry and upset. he decides not to say anything to her, according to rebt, freddy express 45 minutes as a fraction of 1 hour Simplify dont show your work got it Which of the following is csc(-166) equal to?csc(14)-csc(14)-csc(-14)csc(166) What is the approximate measure of this angle? Why was the Tennis Court Oath a significant event of the French Revolution? In which way is biomass similar to fossil fuels? Which figure shows how a shape can be rotated about an axis to form a hemisphere? What is Wiesel's primary purpose in "The Perils of Indifference"?A. To tell the story of Wiesel's experiences in the concentration camps B. To thank the president for inviting Wiesel to speak at the White HouseC. To ask people to do something when they see human sufferingD. To ask people to remember what happened during the Holocaust how can personal biases and points of view influence historians when they are studying evidence What is the 6th value in the sequence with the explicit formula an= 2n14? If a media message shows favoritism it is considered to be Pacific Islanders today are working to improve their economies through all of the following areas except ___________.agriculturecomputer technologytourismfishing The sea labeled with the number 7 on the map above is the __________ Sea.A.Baltic SeaB.Bering SeaC.Sea of JapanD.Sea of Okhotsk What was Pizarros strategy for conquering the Inca?A. Create a peace agreement with AtahualpaB. Launch a surprise attack on the Inca capitalC. Allow the Inca to continue to rule themselves name this song if you take to long to hit me back i cant promise you how i will react Joe ran 3 miles yesterday and wanted to run at least 12 miles this week. Write an inequality that can be used to determine the additional number of days joe must run this week if each run is 3 miles. Then solve the inequality . Which metaphor creates the most negative mood? A. The storm was a hammer that pummeled the roof of the house.B. The storm was a melody that gently rocked the village to sleep.C. The storm was a respite from the oppressive heat of summer.D. The storm was a miracle that brought much needed rain to thevalley. Use the drop down menus to complete the statements Steam Workshop Downloader