Which of these tables represents a non-linear function?

Which Of These Tables Represents A Non-linear Function?
Which Of These Tables Represents A Non-linear Function?

Answers

Answer 1

Answer:

The third table

Step-by-step explanation:

A linear function must increase or decrease at a constant rate. All the tables either add 1 or subtract 1 each time x increases except for the third one which at one point adds two. This is not a consistent increase and therefore is not linear

Answer 2

Answer:

3ed tabel

Step-by-step explanation:

adds 1 to both sides so its a non leirn


Related Questions

If ƒ(x) = 2x, then ƒ -1(x) =

-2x
½x
x - 2

Answers

Answer: second option

Step-by-step explanation:

To find the inverse function of the given function f(x):

[tex]f(x)=2x[/tex]

You need to:

Substitute [tex]f(x)=y[/tex] into the function:

 [tex]y=2x[/tex]

Now, you need  to solve for "x", to do this, you must divide both sides of the function by 2:

[tex]\frac{y}{2}=\frac{2x}{2}\\\\\frac{y}{2}=x[/tex]

Now, replace "x" with "y" and replace "y" with "x":

[tex]\frac{x}{2}=y[/tex]

Therefore, substituting [tex]y=f^{-1}(x)[/tex] you get:

[tex]f^{-1}(x)=\frac{x}{2}[/tex] or  [tex]f^{-1}(x)=\frac{1}{2}x[/tex]

what is (24-6)+19÷2​

Answers

27.5

Follow the order of operations and start by solving the parentheses.

18 + 19 / 2

Now, do the division.

18 + 9.5

Finally, solve the addition.

27.5

A ball is dropped from the top of a building. the height of the ball after x bounces can be represented by the expression 40(0.75)^x.

What does the in the expression 40 represent??

Answers

Answer:

I believe 40 is the height from which the ball was dropped

In the expression \( 40(0.75)^x \), the number 40 represents the initial height from which the ball is dropped. This initial height refers to the height of the ball above the ground before it experiences any bounces.
The expression itself describes a geometric sequence where the height of the ball after each bounce is a certain fraction of the height from the previous bounce. In this particular case, after each bounce, the ball reaches a height that is 75% (or 0.75 times) of the height of the previous bounce.
To break it down further:
- \( 40 \) is the initial height (in meters, feet, or another unit of measurement) where the ball was dropped from the top of the building.
- \( 0.75 \) is the common ratio, representing the fact that the ball loses 25% of its height with each bounce. It means that the ball only reaches 75% of the height it reached after the previous bounce.
- \( x \) is the number of bounces.
So, after the first bounce (when \( x = 1 \)), the height of the ball would be \( 40 \times 0.75 \). After the second bounce (when \( x = 2 \)), the height would be \( 40 \times 0.75^2 \), and so on for each subsequent bounce, following the pattern of a geometric sequence.

Write an addition equation or a subtraction equation to describe the diagram

Answers

The addition equation or a subtraction equation to describe the diagram is (-9)—(-4) = -13

What is an arithmetic operation?

It is defined as the operation in which we do the addition of numbers, subtraction, multiplication, and division. It has a basic four operators that is +, -, ×, and ÷.

We have a line graph shown in the picture.

The small arrow represents the length of 4 but as it is indicating negative direction, so we take -4

Similarly, the big arrow represents the length of 9 as it is indicating negative direction, so we take -9

The sum of the lengths:

(-9)—(-4) = -13

Thus, the addition equation or a subtraction equation to describe the diagram is (-9)—(-4) = -13

Learn more about the arithmetic operation here:

brainly.com/question/20595275

#SPJ2

Find -8 * -1/2

1/16
16
-1/4
-4

Answers

Answer:

4

Step-by-step explanation:

Given in the questions

-8 * [tex]\frac{-1}{2}[/tex]

Step 1

[tex]\frac{-(-1)8}{2}[/tex]

Step 2

[tex]\frac{8}{2}[/tex]

Step 3

4

Answer:

16

Step-by-step explanation:

I had it on a test and i got it right this is 100% correct.

What is the probability of choosing a number from 1-25 that is a multiple of 4

Answers

Answer:

6/25, or 0.24

Step-by-step explanation:

There are 25 numbers from which to choose, each equally likely to be chosen.

Multiples of 4 that are between 1 and 25 are {4, 8, 12, 16, 20, 24}

There are 6 such multiples of 4, out of 25 numbers total.

Thus, the probability of choosing a number from 1-25 that is a multiple of 4 is 6/25, or 0.24.

See attachment below. Please answer. Thank you.

Answers

Hi

The probability of landing a green side up is 2 / 6 .

Hope this helps

Answer:

C. 2/6

Step-by-step explanation:

We know that a block has 6 sides.

There are 2 green sides.

Now all we do is put the number of green sides over the number of sides the block has.

2/6 is our answer.

Evaluate -a+(-b) where a= 6.05 and b= 3.611

Answers

Answer:

-6.05-3.611=-9.661

Step-by-step explanation:

Answer: -9.661

i used khan academy and make sure to add the - sign otherwise it will be wrong

Solve the inequality 3(x-1)<-3(2-2x)

Answers

i believe the answer would be x > 1?

Answer:

x > 1

Step-by-step explanation:

3(x-1)<-3(2-2x)

=> 3x +3 < 6x

=> 1<x

What is the term used to describe the distribution of a data set with one mode? a. Multimodal b. Unimodal c. Nonmodal d. Bimodal

Answers

Answer: B. Unimodal

Unimodal- having or involving 1 mode

ANSWER QUICKLY PLEASE ITS URGENT

Solve the equation.

X^2 = 0.49

Answers

Answer:

x = 0.7

Step-by-step explanation:

To solve this, simply find the square root of 0.49

x^2 = 0.49

(Finding the square root will cancel out the ^2 on x, to get x alone)

x = 0.7

You can double check this too to see if this is the right answer.

0.7 x 0.7 = 0.49

I hope this helps!!! :)

0.7 x 0.7 = 0.49 i think this is it

Can y’all help me plz

Answers

Answer:

trey

Step-by-step explanation:

he reads one page per every 2.5 minutes

Answer:

Roderick

Step-by-step explanation:

Just divide the number of pares by the time it too then to read them.

A local clothing shop is marking down all of its summer clothes by 75%. sarah would like to purchase a swimsuit that is originally priced at $80. when she gets to the register, she signs up for a loyalty cars that saves her an additional 10%. how much did she spend on the swimsuit and what total percent did she receive off?


a. Find the markdown price of the swimsuit.

b. Then, find the markdown of the loyalty card.

c. Subtract to find the final price.

Answers

Answer:

$18.00

Step-by-step explanation:

75% of 80$ is 60$ .    

80$-60$=20$

10%of20$=2$

20$-2$=18$

18$

She spend $18 on the swimsuit and she gets total 77.5 percent off.

Given local clothing shop is marking down all of its summer clothes by 75%.

And Sarah would like to purchase a swimsuit that is originally priced at $80.

So, the markdown price of swimsuit will be ( $80 - 75 % of $80).

Now 75% of $80 is equals to $60.

So the markdown price of swimsuit will be ($80 - $60) or $20.

Again, when she gets to the register, she signs up for a loyalty cars that saves her an additional 10%.

So 2% of $20 dollar will be $2.

Now the final markdown price of swimsuit will be ($20-$2) or $18 .

Total discount she get is of ($80 - $18) or $62.

The percent amount she gets off = [tex]\frac{62}{80} \times100%[/tex] %.

=[tex]0.775 \times100[/tex]%.

[tex]=77.5[/tex]%.

She spend $18 on the swimsuit and she gets total 77.5 percent off.

For more details on percentage follow the link:

https://brainly.com/question/16797504

Write the word sentence as an equation. Number c increased by 6 is the same as 23

Answers

C+6=23 just go step by step dawg

given h(x)=(3x-4), f(x)=(-7x+2), g(x)=(9x+1), which of the following is equivalent to 2x+3?

Answers

The function 2x + 3 is equivalent to g(x) + f(x) if the g(x) = (9x + 1) and f(x) = (-7x + 2)

What is a function?

It is defined as a special type of relationship, and they have a predefined domain and range according to the function every value in the domain is related to exactly one value in the range.

We have a function:

h(x) = (3x - 4)

f(x) = (-7x + 2)

g(x) = (9x + 1)

Find h(x) + g(x):

= (3x - 4) + (9x + 1)

= 12x -3

Find g(x) + f(x):

= (9x + 1) + (-7x + 2)

= 2x + 3

Thus, the function 2x + 3 is equivalent to g(x) + f(x) if the g(x) = (9x + 1) and f(x) = (-7x + 2)

Learn more about the function here:

brainly.com/question/5245372

#SPJ2

If it rains ​tomorrow, the probability is 0.6 that John will practice his cello. If it does not rain ​tomorrow, there is only a 0.4 chance that John will practice. Suppose the chance of rain tomorrow is 70​%.
What is the probability that John will practice his cello​?

Answers

The final probability is the weighted average of the playing probabilities calculated over the possible weather options:

P(john practices cello; given that it rains) * P(it rains) +

P(john practices cello; given that it does not rain) * P(it does not rain) =

0.6 * 0.7 + 0.4 * 0.3 = 0.54

The probability is 54%

The probability that John will practice his cello is 54%.

Given information:

If it rains ​tomorrow, the probability is 0.6. If it does not rain ​tomorrow, there is only a 0.4 chance. And, the chance of rain tomorrow is 70​%.

Calculation of probability:

= 0.6 (0.7) + 0.4 (0.3)

= 0.54

= 54%

Learn more about the probability here: https://brainly.com/question/3974756

The circumference of heileen’s basketball is 30 inches. What is the approximate diameter of the basketball?

Answers

Answer:

9.55 in

Step-by-step explanation:

The formula for the circumference of a circle (or the circum. of a basketball) is C = πd, where d is the diameter.

Here C =30 in  =  πd, so  

d = (30 in) / π

   = 9.55 in, approx.

Answer:

d = 9.554 inches.

Step-by-step explanation:

Formula

C = 2*pi*r

r = the radius

C = the Circumference.

Givens

Circumference = 30 inches.

pi = 3.14

Solution

C = 2*pi * r

30 = (2*r) * 3.14      (you'll see why I've done that in a minute. Divide by pi.

30/3.14 = 2*r

9.554 = 2r

The diameter of the basketball = 2 * radius. So the answer for the diameter = 9.554 inches.

Help please ASAP!!!!!!!!!

Answers

Answer:

b. -33

Step-by-step explanation:

The question is about finding the determinant of a 2×2 matrix

General formula; when given matrix A =[  b  c ]

                                                                  [ d   e]

the determinant of A = (e×b)-(c×d)

Evaluate

(3  -3)

(-5  -6)  = (-6×3) - ( -5×-3)

            = (-18)- ( 15) = -33    

Imagine a friend ask to borrow $100 and agrees to pay you back in one month. You agree and in one month pays you back. Do you lose money​

Answers

Answer:

It depends on whether you are accounting for inflation. If not taking that into  account, you do not lose money because your friend pays you the full amount back.

find the slope (4,4) (4,9)​

Answers

Answer:

Undefined

Step-by-step explanation:

Slope form:

m (slope) = (y₂ - y₁)/(x₂ - x₁)

Let:

(x₁ , y₁) = (4 , 4)

(x₂ , y₂) = (4 , 9)

Plug in the corresponding numbers to the corresponding variables.

m = (9 - 4)/(4 - 4)

Simplify

m = (5)/(0)

m = undefined

Undefined is your answer, for there cannot be a 5/0. You cannot have 5 parts of nothing.

~

if area of a circle is equal to volume of sphere with equal radii, find the radius.​

Answers

Answer:

r = 3/4

Step-by-step explanation:

Area of circle = Volume of sphere.

pi*r^2 = 4/3 pi r^3                   Divide by pi r^2

1 = 4/3 r                                    Divide by 4/3

1//4/3 = 4/3 r / 4/3

3/4 = r

Over the last month, a florist used 736 flowers to make 46 different arrangements. If each of the arrangements used the same number of flowers, how many flowers were in an arrangement? PLzz help its fro math homework

Answers

16 flowers per arrangement

Solve Y-37 equals 82

Answers

you can use inverse operations and add 37 to 82 and get y=119

Y= 119 because if you add 82 and 37 you get 119

To check: 119-37=82

A piece of wood that is 3/4 meter long is being cut into smaller pieces that are each 1/10 meter long.Which equation could be solved as the first step to find the number of pieces,n, that can be made?

Answers

Since the smaller pieces are all equal.

Then, X1=X2=X3...=1/10.

Therefore, the sum of the whole pieces should give you 3/4 back.

X1+X2+X3...=3/4

Therefore, (3/4÷n)=1/10

where n is the number of all the pieces.

I hope this helps

A recipe for cake needs to 1/4 cup of cake you are making 1/2 of the recipe how many cups of flour do you need?

Answers

Answer:

1/8

Step-by-step explanation:

If you need 1/4 cup for the full recipe and you're making half, you have to divide 1/4 by 2. Dividing 1/4 by 2 is the same as multiplying 1/4 by 1/2 since you take the reciprocal (opposite or flip) of 2. 1/4 times 1/2 is 1/8. I hope this helps!

Answer:

1/8

Step-by-step explanation

(1/4)÷2 is the same as saying (1/4)×(1/2)

Multiply the numerators (1×1)

Multiply the denominator (4×2)

and you get (1/8)

the slope of the line below -5 which of ths following is the point slope form of the line?​

Answers

The right answer is y + 8= -5 (x-2).

Answer:

[tex]y+8=-5(x-2)[/tex]

Step-by-step explanation:

Slope of the line =-5

To get point slope form of the line , we use the point that passes through the line. LEts pick the point (2,-8)

Point slope form of a line is

[tex]y-y_1=m (x-x_1)[/tex]

(x1,y1) is (2,-8) and slope m = -5

[tex]y-(-8)=-5(x-2)[/tex]

[tex]y+8=-5(x-2)[/tex] is the equation of the line in point slope form.

Travis just started high school and he wants to manage his time wisely. He schedules 3/2 hours each day for homework, 1/2 of an hour each day for chores at home, and 17/2 hours each day for sleep. How many hours each day are scheduled for these activities?

Answers

hw: 3/2hrs = 3×30 = 90mins

chores: 1/2hr = 1×30 = 30mins

sleep: 17/2hrs = 17×30 = 510mins

90+30+510=630mins=10.5hrs/day

Answer:

21/2

Step-by-step explanation:

khan academy got right

Question 2(Multiple Choice Worth 4 points)

(08.06)A student wants to report on the number of movies her friends watch each week. The collected data are below:

2
14
1
2
0
1
0
2


Which measure of center is most appropriate for this situation and what is its value?

Median, 1.5
Median; 3
Mean, 1.5
Mean; 3

Answers

Answer:

In this case, the median would be the best measure since there is the outlier of 14 in the data. This set of data will have the median of 1.5.

Step-by-step explanation:

The median would be 1.5

(NEED HELP ASAP) What is the value of S4 for

Answers

Answer:

90

Step-by-step explanation:)

To obtain [tex]S_{4}[/tex] , sum the first 4 terms, using n = 1 to n = 4

[tex]S_{4}[/tex]

= 6[tex](2)^{0}[/tex] + 6[tex](2)^{1}[/tex] + 6(2)² + 6(3)³

= (6 × 1) + (6 × 2) + (6 × 4) + (6 × 8)

= 6 + 12 + 24 + 48

= 90

Answer:

90

Step-by-step explanation:

Find the approximate area of a circle thet has a diameter of 17 inches. Round your answer to the nearest hundredth

A. 26.69 in 2
B. 106.76 in 2
C. 226.87 in 2
D. 53.38 in 2

Answers

For this case we have that by definition, the area of a circle is given by:

[tex]A = \pi * r ^ 2[/tex]

Where:

A: It is the radius of the circle.

If they tell us that the diameter is 17 inches, then the radius is 8.5 inches. Substituting:

[tex]A = \pi * (8.5) ^ 2\\A = 226,865[/tex]

If we round up, we have that the area is:

226.87 square inches

Answer:

Option C

Other Questions
What are intrinsic controls also called A)homozygous B)externalC)localD)none of the above plz help 5 star reating and a thanks if someone help What happens to an oxidizing agent during a redox reaction? Need help as soon as possible! The length of a rectangle is 4 times its width. The rectangle's width is 8 m. What is the area of the rectangle? Enter your answer in the box. _______m2 The scatter plot and table show the number of grapes and blueberries in 10 fruit baskets. When you use the two data points closest to the line, which is the equation of the regression line?A.y = 2/3x + 1/3 B.y = 2/3x - 8/3 C.y = 7/24x + 7/3 D.y=7/24x + 13/6 What is a benefit of a person borrowing money to start a business? Some1 help me out on this And if you cant just give me your best opinionWhen reading a text, which of the following is usually a sign that an object is a symbol?Characters pay a lot of attention to the object(s). The object is always mentioned in a song. The object is only mentioned once in passing. The object is never mentioned. What is the length of the third side of the window frame below?(Figure is not drawn to scale.)A picture of a right triangular window frame is shown. The longest side has length labeled as 39 inches. The height of the frame is labeled as 36 inches. 15 inches 27 inches 25 inches 32 inches What were the goals/policies of the Johnson administration and how did they impact the nation Which statements describe the use of gamma rays to treat cancer? Check all that apply.Gamma rays have low energy and a source must be placed in the body.Gamma rays are absorbed by only the cancer cells.High-energy gamma rays are directed at a tumor from outside of the body.Gamma rays kill cancer cells in a tumor.Gamma rays are applied to a large area of the body. Jane entered her artworks in a state competition. Her art scores from 7 judges are listed. 9,9,8,7,9,6,8 what is Janes mean score? A.6 B.7 C. 8 D.9 When you use the distance Formula you are building a right triangle whose ____ connects two given points.... I NEED HELP ASAP I WILL GIVE BRAINLIST !!!!!!!!!Assignment water and oceans graphic organizer exploration k12 1. Where does the energy that causes evaporation come from2. What role does gravity play in the water cycle?3. Describe the flow of one molecule of water through the water cycle, beginning in the ocean. suppose that one student is randomly selected during lunch time. what is the experimental probability if students the brought lunch from house is 55 and students that order school lunch is 45 Which two of these sentences are in passive voice if dy/dt=-10e^-t/2 and y(0)=20 what is the value of y(6) A land rush happened in Oklahoma in the 1890s thanks to the discovery of which mineral? A. gold B. gypsum C. lead D. zinc Law of sines: sin(A)/a=sin(B)/b=sin(C)/c How many distinct What would the charge be on an ion of boron (B)? Steam Workshop Downloader