Why are common names not always useful to biologists?

Answers

Answer 1

Answer:

One reason why many common names are not always useful to biologists is because "They can apply to more than one animal," since terms like "cat" and "dog" refer to large families of animals, not specific ones.

Answer 2
Common Names Ain't always useful to Biologists because of the following Reasons:

1. Different Languages have Different Names for The Same thing, hence it's difficult for Biologists.

2. The Animals we Call as Cats belong to a large family, with similar characterestics.

3. Using a Standardised System Will Involve Lesser Confusion.

This system of Scientific Names is referred to as Nomenclature.

Related Questions

which of the following is the most likely outcome of global warming

Answers

Answer:

Ongoing effects include rising sea levels due to thermal expansion and melting of glaciers and ice sheets, and warming of the ocean surface, leading to increased temperature stratification. Other possible effects include large-scale changes in ocean circulation.

Explanation:

explain the concept of conservation of natural resources

Answers

Answer:

The Earth's natural resources include air, water, soil, minerals, fuels, plants, and animals. Conservation is the practice of caring for these resources so all living things can benefit from them now and in the future.

Answer:

he or she is right

Explanation:

Match the following. 1. the process involving the division of the nucleus in a reproductive cell; responsible for genetic recombination meiosis 2. the process involving the division of the nucleus of a body cell ovum 3. the condition of having oogametes—gametes of different sizes and shapes; usually have eggs and sperm sexual reproduction 4. (pl. ova) the egg cell; a female gamete oogamy 5. the form of production of new individuals by two parents in which the offspring obtains half of its hereditary information from each parent mitosis 6. a small, flagellated male gamete that swims to the egg to fertilize it sperm

Answers

Answer:

1. Meiosis: The process involving the division of the nucleus in a reproductive cell...

2. Mitosis: the process involving the division of the nucleus of a body cell

3. Oogamy: the condition of having oogametes...

4. Ovum: the egg cell...

5. Sexual Reproduction: the form of production of new individuals by two parents....

6. Sperm: a small flagellated male gamete...

Explanation:

1. Meiosis is a type of cell division that produces gametes, or reproductive cells. The process produces haploids, which have half the number of chromosomes as the parent. Genetic recombination occurs in meiosis, where there is an exchange of genetic information between the chromosomes, which bring about genetic diversity.

2. Mitosis is also a type of cell division, but unlike in meiosis, they produce clones of the parent cell. They produce diploids and this occurs in body cells. The purpose of mitosis is for growth, repair and asexual reproduction.

3. Oogamy is a form of sexual reproduction. What you would observe with oogamy is that one sex cell or "gamete" is bigger than the other gamete and the bigger gamete is non-motile or it can't move, while the other can. The egg cell for example is larger than the sperm cell, but it cannot move, while the sperm cell can.

4. The female gamete is called the ovum, plural form would be ova. This is also known as the egg cell. It is non-motile, so that means it cannot move. It's main purpose is to be fertilized by the sperm cell.  

5. Sexual reproduction is the fusion of two gametes, which produces a fertilized egg, or a zygote. These gametes are haploid cells, which are produced in meiosis, and they each have half the genetic information of their parent cell. Thus the offspring produced will be genetically different from their parents.

6. The sperm cell is the male gamete. It has a flagella, which is like a tail that helps it move.  It's main purpose is to fertilize an egg cell.

1.Meiosis

2.Mitosis

3.Oogamy

4.Ovum

5.Sexual Repoduction

6.Sperm

Name any 3 methods of irrigation and briefly describe them.

Answers

3 methods of irrigation are drip, surface, and sprinkler. Sprinkler irrigation applies water to soil, surface irrigation transports it to the channels where it floods the field, and drip irrigation exposes the roots to more supplies of water.

Nutrients can also be provided through irrigation to the crops. The different sources of water for irrigation are wells, lakes, ponds, canals, tubewells and even dams.

What is irrigation?

Irrigation is defined as the process of applying water to the crops artificially to realize their water requirements.

The three important methods of irrigation are sprinkler, surface, and drip/micro.

Water flows over the soil by gravitation force for surface irrigation. Sprinkler irrigation, also known as spray irrigation, is a means of dispensing water in a regulated manner, comparable to rainfall. Pumps, valves, pipes, and sprinklers may be used to disperse the water. Irrigation sprinklers can be used in a variety of settings, including residential, industrial, and agricultural.Drip irrigation entails laying tubing with emitters next to the plants on the ground. The emitters trickle water into the root zone of the soil slowly. Plant production and quality improve as moisture levels are maintained at an appropriate level.

For more information regarding irrigation, visit:

https://brainly.com/question/903241

#SPJ2

Match the following items
1. Rr
2. rr
3. Identical alleles
4. Unlike alleles
5. RR
()homozygous, recessive
()homozygous definition
()heterozygous, dominant cell
()heterozygous definition
() homozygous, dominant cell

Answers

Answer:

2. homozygous, recessive

3. homozygous definition

1. heterozygous, dominant cell  

4. heterozygous definition  

5. homozygous, dominant cell

Explanation:

Which part of a cell carries the genetic material? Cell membrane Cell wall Chloroplast Nucleus

Answers

Answer:

nucleus carries the genetic material

nucleus. contains DNA.


Select the words that correctly complete the statement.
_____ is an example of optimal health. To gain optimal health, the first step is to ______
1 ) the absence of disease
1) a high protein diet
1) sufficient sleep
1) taking a variety of vitamins and mineral supplements
1) the perfect body

2) eat healthy
2) establish practical goals
2) establish priorities
2) establish realistic goals
2) improve intellectual health

Answers

The absence of disease is an example of optimal health. To gain optimal health, the first step is to eat healthy.

According to the question;

We are required to select the words that correctly complete the statement.

For the first blank space;

A very good indicator of optimal health is; The absence of disease.

For the second blank space:

To gain optimal health, it is pertinent that one eats healthy.

Read more:

https://brainly.com/question/20519649

Secondary pollutants are more harmful than primary pollutants.

Answers

The statement is generally true: secondary pollutants are often more harmful than primary pollutants.

Primary pollutants are substances that are directly released into the environment from human activities or natural sources. These pollutants include emissions from vehicles, industrial processes, and natural events like volcanic eruptions. While primary pollutants can have detrimental effects on human health and the environment, they are usually present in relatively high concentrations near their sources and can be easier to identify and control.

On the other hand, secondary pollutants are not directly emitted but are formed through chemical reactions involving primary pollutants and other atmospheric components. These reactions occur in the atmosphere under specific conditions, such as sunlight, temperature, and the presence of other reactive substances. Examples of secondary pollutants include ground-level ozone (formed from the reaction of nitrogen oxides and volatile organic compounds), smog, and some forms of particulate matter.

Secondary pollutants are often more harmful than primary pollutants for several reasons. Firstly, they can be present in lower concentrations, making them harder to detect and control. Their formation is dependent on specific atmospheric conditions, which can vary spatially and temporally, leading to localized and unpredictable exposure. Secondly, secondary pollutants can have more adverse health effects due to their chemical properties. For example, ground-level ozone is a strong respiratory irritant and can contribute to respiratory problems and other health issues. Thirdly, secondary pollutants can persist in the atmosphere for longer periods, leading to the potential for long-range transport and widespread impacts.

While the general statement holds true, it is important to note that the harm caused by pollutants depends on various factors, including their concentration, duration of exposure, individual susceptibility, and the specific pollutant in question. Nevertheless, the formation and presence of secondary pollutants can contribute significantly to the overall environmental and health risks associated with air pollution.

To learn more about pollutants, here

https://brainly.com/question/29594757

#SPJ6

ext ©
Introduction to Biology: Mastery Test
How is a scientific law different from a scientific theory?
OA.
A theory becomes a law after a long period of time has passed.
OB.
A theory is used for biology and chemistry and a law is used for physics.
HEEGES
U
C.
A theory is why something happens and a law is how something happens.
Co
Island
SA
BO
D.
A theory cannot be disproved but a law can be disproved.
nit
ES​

Answers

Final answer:

A scientific law describes a generalized pattern in nature and is often expressed as a mathematical equation, while a scientific theory provides a comprehensive explanation for a group of related phenomena. Scientific laws describe what happens, and theories explain why and how it happens.

Explanation:

The difference between a scientific law and a scientific theory is a fundamental aspect of scientific knowledge. A scientific law uses concise language to describe a generalized pattern in nature that is supported by scientific evidence and repeated experiments, often expressed in the form of a mathematical equation. In contrast, a scientific theory is a well-supported explanation of observations; it is more complex and dynamic, explaining a group of related phenomena rather than describing a single action. For instance, Newton's second law of motion, which can be summarized by the equation F = ma, is an example of a scientific law, while the Theory of Evolution is an example of a scientific theory.

Therefore, option C, stating that a theory is why something happens and a law is how something happens, accurately reflects the difference between a scientific law and a scientific theory. Scientific laws describe what happens under certain conditions in nature, often mathematically, while theories provide the explanation behind these observations, elaborating on why and how the phenomena occur.

Halogens are destructive to ozone because they are highly reactive with oxygen. Please select the best answer from the choices provided T F

Answers

Answer:

True

Explanation:

Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.

When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.

The Correct Answer Is: TRUE (Just Took The Test)

When listing the levels of organization in organisms from smallest to most complex, which level is just below organs in
complexity?

Answers

When listing the levels of organization in organisms from smallest to most complex, which level is just below organs in
complexity?

Answer:

tissues

Explanation:

I hope this helps you.

which is an example of a decomposer?
A. Bear
B.Algae
C.Grass
D.Bacteria
Answer: D Bacteria

Answers

Answer:

D.Bacteria

Explanation:

A & B are primary producers

D is a secondary consumer

The answer is D. Bacteria.

Bacteria breaks down dead organisms, keeping our planet from being buried in dead organisms. Thus, bacteria bear and important task in being a decomposer.

Hope this helps!

11. What's a recharge area?
A. The part of an aquifer where groundwater meets a lake or stream
B. The part of an aquifer where surface water reaches the water table
C. The part of an aquifer that's located between two aquicludes
D. The part of an aquifer that's located at a lower elevation

Answers

Answer:

B. The part of an aquifer where surface water reaches the water table

Explanation:

The recharge area of an aquifer, is the area where the aquifer comes in touch with the surface water. At this area, the aquifer is receiving new and fresh water reserves from the surface, thus replenishing the water that it has lost.  Most of this water comes from the rainfall and runoff, though rivers and streams can also contribute to it. The recharging of the aquifer is crucial for its existence, as it constantly loses water, and the recharging in giving back water to it, thus balancing the lost and gained water in it.

Answer:

B

Explanation:

What is the most likely explanation for how speciation occurs

Answers

Answer:

when populations of a species that share the same habitat become reproductively isolated from each other.

Explanation:

Answer:

Natural selection is one explanation how speciation occurs.

Explanation:

Natural selection is a key mechanism of evolution, in which survival and reproduction differences affects the evolution process.

It's important to say that Natural Selection is related with only phenotype's act, because it's due to environmental changes, adapting to those variables in order to survive.

Which is a function of nucleic acids​

Answers

Answer:

Nucleic acids are important because they make up genetic information in living things. There are two types of nucleic acid and they are DNA and RNA. DNA is the basic instructions for living things. It is passed down from parent to offspring and is found in the nucleus of the cell.

Explanation:

Answer:

store genetic information

Explanation:

The study of DNA provides evidence that all living things are related through
evolution by showing that all species

Answers

Answer:

it's d has the same genes

The answer is option B - The study of DNA provides evidence that all living things are related through evolution by showing that all species read the genetic code in the same way.

All species read the genetic code in the same way, indicating a common ancestry and supporting the theory of evolution.

The study of DNA provides substantial evidence that all species are related through evolution by showing that all species read the genetic code in the same way. This is apparent from the universal use of the same set of genetic instructions across different forms of life, demonstrating a common ancestry. By comparing genetic sequences, scientists have mapped out the relationships among various species, constructing what is known as the "tree of life."

This tool illustrates the connections between organisms, with many sharing significant genetic traits and DNA sequences, such as humans and chimpanzees sharing about 98% of their genes, indicating a recent common ancestor.

When a scientist is conducting research about all the plants and wildlife in the Mojave Desert as well as the desert’s resources, such as water and soil, the scientist is studying

Answers

Answer:

ecosystem

Explanation:

In this case, we have a situation where the scientist is describing an ecosystem. The ecosystem represents all the living organisms (flora and fauna), their environment, and the interactions that they all have between each other. In this case, we have the plants and animals being described, thus the flora and fauna, as well as the water and soil, thus their environment, so we have description of an ecosystem, or more specifically, the desert ecosystem of the Mohave Desert.

Answer:

an ecosystem

Explanation:

When a human or animal consumes food, the carbon in that food is most likely to be converted into which of the following elements?

a. carbon remains carbon

b. nitrogen

c. oxygen

d. hydrogen

Answers

Answer:

The answer is A

Answer:

a. Carbon remains carbon

Explanation:

Give examples of selective advantage of organism’s body part/organ

Answers

Answer:

The characteristic of an organism that enables it to survive and reproduce better than other organisms in a population in a given environment; the basis for evolution by natural selection.

Explanation:

where do the respiratory and circulatory systems meet?

Answers

Answer:

B

Explanation:

This is the amino acid cysteine. Circle the amine group, put a box around
the carboxylic acid group and use a different colored pencil/pen to circle the side
chain (R group).


H O
| ||
NH2— C- C-OH
|
CH2
|
SH​

Answers

I attached the pic. NH2 is amine group, COOH is carboxyl group.
Final answer:

The amine group in cysteine is NH₂ found on the left side of the molecule. The carboxylic acid group is COOH found on the right side of the molecule. The R group or side chain in cysteine is CH₂-SH.

Explanation:

The amine group in an amino acid is the part of the molecule that contains nitrogen (NH₂). In the case of cysteine, this would be on the left side of the molecule. You can circle this part. The carboxylic acid group is the part of the molecule that contains a carbon atom double-bonded to an oxygen atom and also bonded to a hydroxyl group (C-OH). In cysteine, this would be towards the right side of the central carbon. You can put a box around this. The R group, or side chain, is different for each different amino acid. For cysteine, this is composed of a carbon atom bonded to a sulfhydryl group (CH₂-SH). You can use a different color to circle this part.

Learn more about Amino acid groups here:

https://brainly.com/question/33427968

#SPJ2

What is the typical source of well water?
A. A holding tank
B. A discharge zone
C. A geyser
D. An aquifer

Answers

Answer:

an aquifer

Explanation:

An aquifer is the typical source of well water

Which organelles are found only in plant cells?

Answers

chloroplasts- contains chlorophyll for photosynthesis
permanent vacuole
cell wall

Answer:

c) cell wall , vacuole

Explanation:

Which statement about natural selection is true?
A.
Natural selection and evolution are two terms for the same phenomenon.
B.
Natural selection is an outdated theory to explain how evolution took place.
C.
Natural selection is the process by which organisms with more beneficial traits are more likely to survive and reproduce.
D.
Natural selection is the process by which organisms develop variation in traits, which gives them a better chance of survival.

Answers

The answer is C. Natural selection is about ones traits being better than another’s which allow it to survive in the wilds longer.

Answer:

C.  

Natural selection is the process by which organisms with more beneficial traits are more likely to survive and reproduce

Explanation:

Natural selection is a driving force for evolution that operates of genetic variations. The individuals with beneficial genetic traits are able to survive and reproduce more as compared to the other individuals with no beneficial traits.

This differential reproductive and survival rate of organisms due to adaptive genetic traits is called natural selection.  

Waianapanapa Beach in Hawaii is a black-sand beach that was formed by
waves crashing against volcanic rock. The sand can be very hot on sunny
days. Which statement best explains why?
O
A. The black sand has no heat capacity.
B. The black sand absorbs no radiation.
O
C. The black sand is immune to insolation.
D. The black sand has a low albedo.

Answers

Answer:

The black sand has a low albedo.- D.

Answer:

d

Explanation:

good luck

The land biomes are named for their
A. Large animals?
B. Predominant vegetation
C. Average climate
D. Physical location

Answers

Predominant vegetation

New generations are better suited to their environment than the first generation. What is this called?

Answers

Answer:

Descent with modification

Explanation:

We define evolution as descent with modification from a common ancestor.

Evolution only occurs when there is a change in gene frequency within a population over time. These genetic differences are hereditary and can be passed on to the next generation - which is what really matters in evolution: long-term change. In this process, the new generations are better suited to their environment than the first generation because of descent with genetic modification.

Final answer:

New generations are better suited to their environment than the first generation due to evolution by natural selection. Individuals with advantageous traits tend to survive, reproduce, and pass these traits to their offspring, leading to better adapted future generations.

Explanation:

The phenomenon where new generations are better suited to their environment than the first generation is known as evolution by natural selection. This process occurs because the members of a population have genetic variability, which results in some individuals having traits that give them a biological advantage in specific environmental conditions. These individuals are more likely to survive and reproduce, passing on these advantageous traits to their offspring. Over time, these traits become more common within the population, making future generations progressively better adapted to their environment.

Which step of the scientific method relies more heavily on newly collected data than on creativity and innovation?
drawing a conclusion
designing an experiment
solving a problem
formulating a question

Answers

Answer: drawing a conclusion

Answer:

The best possible answer is: Drawing a conclusion.

Explanation:

in orde to write a conclusion report on an experiment you need the data collected from the experiment. Designing the experiment requires too much trial and error. formulating the question is purely a made up idea until tested. However, solving a problem depends on wether it is after the experiment or during. If it is after than you are most likely using information from the experiment, in this case it could be the right answser. If it is during then the it is about what you can do to fix something that went wrong in the experiment. I hope this helps you!

Genes that come together with different alleles are called______.
heterozygous.
homozygous.
genotype.
segregated.

Answers

Answer:

Genes that come together with different alleles are called heterozygous. ( first choice)

The correct answer is heterozygous

A food web in a rain forest is shown below. Which of the following most likely occupies the location marked X in this food web?
A. decomposers
B. primary consumers
C. producers
D. secondary consumers
E. abiotic factors

Answers

I think the answer would be decomposers
Other Questions
Which of the following groups tended to be Anti-Federalist during the ratification debates? 1) Rural residents closely tied to the commercial marketplace 2) Merchants engaged in foreign commerce 3) State politicians fearful of a strong central government 4) Urban artisans, laborers, and sailors. What important role did advanced farming technologies play in causing theIndustrial Revolution in Great Britain?OA. They required advanced skills to operate, leading to the formationof public schools.OB. They encouraged farm owners to hire more workers, reducingovercrowding in cities.C. They allowed a small rural population to provide food for a largeurban population.OD. They convinced political leaders to focus the economy morestrongly on agriculture. The features of a Coverdell Education Savings Account include all of the following EXCEPT: (A) The contributions are deductible. (B) $2,000 is the maximum contribution in any one year. (C) Withdrawals are tax free. (D) Contributions are phased out for certain taxpayers who have adjusted gross income above a certain level. During World War I, ________ was the term widely used to describe a state of war in which neither side was winning or gaining an advantage. A parallelogram has an area of 144 square centimeters. If the base measures 24 centimeters, what is the height? the length of a rectangle is 11 yd less than three times the width and the area of the rectangle is 42 yd The _____ the temperature of an object the faster the molecules vibrate.a. higherb. lower Determine whether the parabola y = -x2 + 15x + 8 opens up, down, left, or right. What does standard deviation reveal about data?A. The average of all the data pointsB. Which of the data points is most reliableC. How spread out the data points areD. The percent error included in the data Need help with reflection What is the standard form of the equation of a line for which the length of the normal segment to the origin is 8 and the normal makes an angle of 120degrees with the positive x axis The key idea of john lockes enlightenment theory was to protect and enhance the freedoms and rights of What could explain the curve in this population growth graph? a reduction in predators a natural disastera population crash a reduction in the birth rate PLEASE HELP!Which equation best represents the line? Is your received a $15,000 loan from the bank after six years she owes the bank 5000 in interest what was Angies interest-rate The measure of angle A is 4 degrees greater than the measure of angle B. The two angles are complementary.Find the measure of each angle. Please help answer this, Thank you!! The odometer in Mr. Jacksons car shows he has travel 62,222 miles what is the least number of additional miles that Mr. Jackson much travel before the odometer again shows four of the five digits the same as each other Dwight is a construction worker who will be employed for 8 months this year on a contract job, and he needs to calculate his projected yearly earnings in order to fill out a loan application. His contract states that he will make $35 an hour and that will work 45 hours per week for the duration of the contract. Part 1: how much will dwight make pero week 5/2=d2/4What does d=? A photo of a painting measured 13 x 17 inches the scale of the photo to the original painting is 1 inch to 3 inches. What is the size of this painting Steam Workshop Downloader