WILL UPVOTE

This is all the info it gives me so sorry.



The formula for rate is r=dt.

Solve for d.

Enter your answer in the box.



Thanks!

Answers

Answer 1
divide both sides by t. answer is d=r/t

Related Questions

Laura was making a recipe that said the ingredients were for 6 people, but she needed to make it for 8 people. the recipe called for 2 2/3 cups of milk and 1/4 cup oil. how many of these liquid ingredients did she need for 8 people?

Answers

3 cups of milk and 2/4 cups of oil

Answer:

[tex]3\frac{5}{9}[/tex] cups of milk and [tex]\frac{1}{3}[/tex] cups of oil for 8 people .

Step-by-step explanation:

Cups of milk for 6 people = [tex]2 \frac{2}{3} =\frac{8}{3}[/tex]

Cups of milk for 1 people = [tex]\frac{\frac{8}{3}}{6}=\frac{4}{9}[/tex]

Cups of milk for 8 people = [tex]\frac{4}{9} \times 8= \frac{32}{9}[/tex]

Cups of oil for 6 people = [tex]\frac{1}{4}[/tex]

Cups of oil for 1 people = [tex]\frac{\frac{1}{4}}{6}= \frac{1}{24}[/tex]

Cups of oil for 8 people = [tex]\frac{8}{24}=\frac{1}{3}[/tex]

Hence [tex]3\frac{5}{9}[/tex] cups of milk and [tex]\frac{1}{3}[/tex] cups of oil for 8 people .

how is a tangent different from a chord

Answers

Answer:

A tangent is a line, ray, or line segment that intersects a circle at exactly one point (called the point of tangency) and contains no points inside the circle. A chord is a segment with both endpoints on a circle. Tangents intersect the circle at one point, while a chord intersects at two.

I've checked this answer, E counted it as correct. Hope this helped!!!

A tangent touches a circle at one point, while a chord connects any two points on the circle's circumference.

A tangent and a chord are both important concepts in geometry, but they have distinct characteristics.

A tangent is a line that intersects a circle at exactly one point, touching the circle's circumference at that point.

It never crosses the circle. Tangents are perpendicular to the radius that intersects the point of tangency.

On the other hand, a chord is a line segment connecting any two points on a circle's circumference. Unlike tangents, chords can intersect the circle at multiple points.

The diameter is a special case of a chord that passes through the center of the circle.

Hence,

Tangents touch a circle at one point, while chords connect two points on a circle's circumference.

To learn more about the circle visit:

https://brainly.com/question/24810873

#SPJ6

A square sheet of art paper has an area of 625 square inches. what is the minimum side length of an easel that supports the whole sheet of paper?
a.-25
b.25
c.15
d.35(-25 or 25?)

Answers

the of the question the letter B

Paul plans to put concrete on a rectangular portion of his driveway. The portion is 12 feet long and 6 inches high. The price of concrete is $98 per cubic yard. The total cost of the concrete Paul needs is $108.89. Which of the following is closest to the width of the portion of the driveway on which Paul plans to put concrete?

[1 foot = 12inches; 1 yard = 3 feet]

3 feet

5 feet

8 feet

10 feet

Answers

The width needed is 5 feet.

Answer:

The answer is b. 5 feet

Step-by-step explanation:


What is the solution to the following bernoulli de?
\[t^2 dy/dx+y^2=ty\]

Answers

So, from your equation t^2 dy/dx+y^2=ty

Dividing boths side by t^2 we get
dy/dx+y^2/t^2=y/t
After re arranging 

dy/dx−y/t=−y^2/t^2

after substituting we get
w=−y^−3


If x = a + bi and y = –a – bi, x + y = 0

Answers

That would be the inverse property of addition. When you add the opposite of a number to that number, your sum will be zero. -a is the opposite of a and -bi is the opposite of bi. When you add x + y (aka the opposites) your total is absolutely nothing!  

Answer:

inverse property

Suppose that a drop of mist is a perfect sphere and that, through condensation, the drop picks up moisture at a rate proportional to its surface area. Show that under these circumstances the drop's radius increases at a constant rate. ...?

Answers

the statement tells you:

dm/dt = k A = 4 pi k r^2 where k is a constant, and r is the radius of the raindrop

use the chain rule to write:

dm/dt = dm/dr x dr/dt

since the raindrop is a sphere (of presumably uniform density), its mass is

m= density x volume = rho x 4 pi r^3/3 where rho is the density of water

so, we have that dm/dr = 4 rho pi r^2, subbing this back we get

dm/dt = 4 pi k r^2 = 4 rho pi r^2 dr/dt

the r^2 on both sides cancel, leaving dr/dt, the rate at which the radius increases, to be constant

From the given condition, the rate of change of radius is constant.

What is rate of change?

How quickly something evolves over time is referred to as its rate of change (ROC).

Given:

Suppose that a drop of mist is a perfect sphere and that, through condensation, the drop picks up moisture at a rate proportional to its surface area.

Let V be the volume of the sphere & S be the surface area.

According to the question,

dV/dt = kS

Since,

V = 4/3πr³

dV/dt = 4πr²dr/dt

S = 4πr²

Putting these values to the above expression,

4πr²dr/dt = k4πr²

dr/dt = k

Therefore, the rate of change of radius is constant.

To learn more about the rate of change;

https://brainly.com/question/29518179

#SPJ2

1. Miguel tosses a coin three times. which diagram represents the sample space of the three tosses?

Answers

The only diagram that has the possibility that each coin toss could come up H or T is answer "c."

Tree diagram can be used to represent the sample space. The correct option is option C.

What is a tree diagram?

In probability, a tree diagram can be used to represent the sample space. Tree diagrams represent a series of independent events or conditional probabilities.

As it is given that the coin is tossed three times, therefore, the number of stages in the tree diagram will be three, where each time the coin is tossed will result in either heads or tails.

Now, the tree diagram of the coins can be drawn as shown below.

Further, comparing it with our diagram, the only possible option is option c where the number of levels in the tree is three and each toss result in either heads or tails.

Hence, the correct option is option C.


Learn more about Tree Diagram:

https://brainly.com/question/3269330

108/250 in simplest form in a whole number.

Answers

You cannot express 108/250 in a whole number but it can be simplified to 54/125

Josephine started a business selling cosmetics. She spent $4500 to obtain her merchandise, and it costs her $200 per week for general expenses. She earned $550 per week in sales. What is the minimum number of weeks it will take for Josephine to make a profit? Write an inequality to model the problem.

A.)550w > 4500 + 200w

b.)200w > 4500 + 550w

c.) 550w < 4500 + 200w

d.)200w 4500 + 550w
...?

Answers

Answer:

a

Step-by-step explanation:

Final answer:

Josephine will need at least 13 full weeks to start making a profit. The correct inequality that models this economic scenario is 550w > 4500 + 200w.

Explanation:

The minimum number of weeks it will take for Josephine to make a profit in her cosmetics business can be determined by setting up an inequality where the total earnings must be greater than the sum of the initial investment and the running costs. We define w as the number of weeks. Josephine earns $550 per week, so her earnings after w weeks are 550w. The initial investment is $4500 and the weekly expense is $200, so the total expenses after w weeks are 4500 + 200w. To make a profit, the earnings must be greater than the expenses:

550w > 4500 + 200w

To solve for w, we need to collect like terms:

550w - 200w > 4500

350w > 4500

Dividing both sides by 350:

w > 4500 / 350

w > 12.86

This means Josephine will need to work for at least 13 full weeks to make a profit.

{-4y-11x=36
{20=-10x-10y

Answers

Solve this by method of elimination where you make one term equal and then cancel it out.

36=-4y-11x  (Equation 1)
20=-10x-10y (Equation 2)

Reorganize the terms.
36=-11x-4y (Equation 1)
20=-10x-10y (Equation 2)

Multiply Equation 1 by 5 and Equation 2 by 2 to make y equal.
180=-55x-20y
40=-20x-20y

Now subtract Equation 2 from Equation 1. It is a bit messy but it looks like:
180-40=-55x-(-20x)-20y-(-20y)
180-40=-55+20x-20y+20y
140=-35x

We have now removed y from the equation, so we can now solve for x. Divide each side by -35 to find x.

140=-35x
-4=x

We have the equation 20=-10x-10y. Substitute -4 for x to solve for y.

20=-10x-10y
20=-10(-4)-10y
20=40-10y
-20=-10y
2=y

x=-4
y=2

You invest $2000 in a bank account that has 5% annual interest rate, compound ed continously. how much will you have in 5 years?

Answers

total = $2000(1.05)^5
money = $2552.56

In 2005 at camp at 450 campers five years later the number of campers rose to 750 right now when you're equation that represents the number of campers that attend camp

Answers

Final answer:

To represent the number of campers attending the camp, use the equation y = mx + c, where y represents the number of campers, m represents the rate of increase, x represents the number of years, and c represents the initial number of campers. Using the given information, solve for the rate of increase (m) and initial number of campers (c). Substitute the values in the equation to find the number of campers attending the camp right now.

Explanation:

To represent the number of campers attending the camp right now, we can use the equation: y = mx + c, where y represents the number of campers attending the camp, m represents the rate at which the number of campers increase, x represents the number of years since 2005, and c represents the initial number of campers in 2005.

From the information provided, we know that in 2005 there were 450 campers and five years later, in 2010, the number of campers rose to 750. We can use these two points to find the values of m and c.

Using the formula: (y2 - y1) / (x2 - x1) = m, we can calculate the value of m as: (750 - 450) / (2010 - 2005) = 60. Therefore, the rate of increase is 60 campers per year. Now, we can substitute the values of m and c in the equation to find the number of campers attending the camp right now. y = 60x + 450.

Final answer:

The linear equation representing the number of campers attending camp each year, starting from 2005 with 450 campers and increasing by 60 campers per year, is C = 450 + 60t, where C is the number of campers and t is the number of years after 2005.

Explanation:

In 2005, there were 450 campers at a camp. Five years later, the number of campers increased to 750. To represent the growth in the number of campers, we can write a linear equation. Assuming the number of campers increases at a constant rate each year, we first find the rate of increase.

Rate of increase per year = (Number of campers in 2010 - Number of campers in 2005) / (2010 - 2005)

Rate of increase per year = (750 - 450) / (5)

Rate of increase per year = 300 / 5 = 60 campers per year

Let's denote C as the number of campers and t as the number of years after 2005. The equation that represents the number of campers is:

C = 450 + 60t

This equation indicates that starting with 450 campers in 2005, every year there are 60 more campers attending the camp.

Eric reflected parallelogram ABCD across the x-axis. If angle A is 125° and angle B is 55°, what is the degree measurement of angle A'?

Answers

the answer simple;
the degree measurement of angle A' = 125°



Answer:

Angle A= Angle A' = 125°

Step-by-step explanation:

We have given that : Eric reflected parallelogram ABCD across the x-axis.

                                  If angle A is 125° and angle B is 55°

To find :  Degree measurement of angle A'

Solution :

As it is reflected parallelogram , and by property of reflection it form congruent parallelogram

since it is congruent then measures of angle remain same

by this statement the measure of angle of parallelogram ABCD

remain same or equal to parallelogram A'B'C'D'

⇒Angle A= angle A' = 125°

Use substitution to solve the system
5x+4y=12
Y=2x-10

Answers

ok so do you know the steps for substitution

Substitute the 2x-10 in for I in the first equation:
5x+4(2x-10) =12

Distribute the 4:
5x+8x-40=12

Add 40 to both sides and combine the x terms:
13x=52

Divide by 13:
x=4

Plug the 4 into either equation for the x value:
y=2(4)-10
y=8-10
y=-2

Answer:
X=4
Y=-2

To check you can plug them into either one of the equations.

five less than a number is at least -28 written as an inequality.

Answers

I believe it would be (if x was the number):
x - 5 ≥ -28. Hope this helps!
Final answer:

To write the inequality 'five less than a number is at least -28' in mathematical symbols, we need to assume the number is 'x' and express 'five less than a number' as 'x - 5'. We then represent 'at least -28' as '≥ -28'. By combining these expressions, we get the inequality x - 5 ≥ -28. To solve it, we add 5 to both sides to isolate the variable 'x' and obtain x ≥ -23.

Explanation:

To write the inequality, we need to translate the phrase 'five less than a number is at least -28' into mathematical symbols. Let's assume the number is represented by 'x'. 'Five less than a number' can be written as 'x - 5'. The phrase 'at least -28' means the number has to be greater than or equal to -28, which can be written as '≥ -28'.

Putting it together, the inequality is: x - 5 ≥ -28.

To solve this inequality, we can add 5 to both sides to isolate the variable 'x'. This gives us: x ≥ -28 + 5, which simplifies to x ≥ -23.

Learn more about Writing an inequality with given conditions here:

https://brainly.com/question/32122011

#SPJ2

If the sum of a number and 6 is multiplied by 5, the result is same as 9 times the number decreased by 2. find the number.

Answers

Let's do an equation. 5(x+6)=9x-2. Now distribute into parentheses. 5x + 30=9x-2. Now -5x on both sides. New equation is 4x-2=30. Add 2 on both sides. 4x=28. Now divide by 4. X=8. Your number is 8

How do you find the x-intercepts and y-intercepts of trinomials. E.g.(x^2-10x+25) How do you find the x-intercepts and y-intercepts of trinomials. E.g.(x^2-10x+25)

Answers

Final answer:

To find the x-intercepts, set the trinomial equal to zero and solve for x. Substitute x = 0 to find the y-intercept.

Explanation:

To find the x-intercepts of a trinomial, you need to set the trinomial equal to zero and solve for x.

In the example given (x^2-10x+25), you would set the trinomial equal to zero as follows:

x^2-10x+25 = 0

Now, you can factor the trinomial or use the quadratic formula to solve for x. In this case, the trinomial can be factored as (x-5)(x-5) = 0.

So, the x-intercept is x = 5.

The y-intercept can be found by substituting x = 0 into the trinomial. In this case, when x = 0, the trinomial becomes y = 25.

So, the y-intercept is (0, 25).

Over the past year, your friend Maura has been saving up for an epic road trip to travel across the country this summer. Her goal is to squeeze in as many sights as she can with her available budget of $2000.
Give an example of a sound financial decision Maura might make to support this goal. Why is it sound? Then give an example of a poor financial decision Maura might make considering her goal. Why is it a poor decision?

Answers

"Give an example of a sound financial decision Maura might make to support this goal. Why is it sound?"

She could choose to carefully budget her trip and avoid overspending at all costs. This prevents going into debt. She should also save up extra money in the event of an emergency.

Then give an example of a poor financial decision Maura might make considering her goal. Why is it a poor decision?

Not having a plan would be a poor decision on her part. She could end up spending too much and not realize how much money she has left.


I hope I helped!

logx + log(3x-13) = 1

Answers

x = 5
Condense the left side.
log x(3x-13)=1
Put a base 10 on each side to clear the log.
x(3x-13)=10
3x^2-13x-10=0
Factoring you get x=5 and x=-2/3. The domain for log is x>0 so the -2/3 is an extraneous solution.

The solutions for [tex]\log x + \log (3\cdot x - 13) = 1[/tex] are [tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex], respectively.

In this question, we are going to solve for [tex]x[/tex] with the help of Logarithm Properties, which are described in the image attached below.

[tex]\log x + \log (3\cdot x - 13) = 1[/tex]

[tex]\log [x\cdot (3\cdot x - 13)] = 1[/tex]

[tex]\log (3\cdot x^{2}-13\cdot x) = 1[/tex]

[tex]10^{\log(3\cdot x^{2}-13\cdot x)} = 10^{1}[/tex]

[tex]3\cdot x^{2}-13\cdot x = 10[/tex]

[tex]3\cdot x^{2}-13\cdot x -10 = 0[/tex]

This is a Second Order Polynomial, which can be solved by Quadratic Formula:

[tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex]

The solutions for [tex]\log x + \log (3\cdot x - 13) = 1[/tex] are [tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex], respectively.

Please see this question related to Logarithm Properties for further details:

https://brainly.com/question/12983107

Which fraction shows a correct way to set up the slope formula for the line that passes through the points (3,7) and (5,7)?

Answers

The slope of a line through the points (3,7) and (5,7) is 0, indicating a horizontal line.

To calculate the slope of a line passing through two points, you can use the formula m = (y2 - y1) / (x2 - x1), where (x1, y1) and (x2, y2) are the coordinates of the two points. In this case, the points are (3,7) and (5,7). Using the slope formula, we get:

m = (7 - 7) / (5 - 3) = 0 / 2 = 0

So, the slope of the line that passes through these points is 0, which means the line is horizontal.

Solve the equation.

6 = 2(x + 8) - 5x

A. 2/3
B. 3 1/3
C. - 2/3
D. -3 1/3

Answers

I hope this helps you
6=2x+16-5x
6=(2x-5x)+16
6-16=2x-5x
-10=-3x
X=10/3

Determine if the equations are intersecting, parallel, or coincident. bx - ay = 2 ax + by = 3

Answers

The equations are parallel because the slopes of the two lines are equal. 
The equations are parallel

Answer:

Intersecting

Step-by-step explanation:

After having singled out y on one side of both equations you should have.

Y=b/a• x - 2/-a

And

Y= -a/b • x + 3/b

As you can see they have opposite reciprocals which is an intersection

Given the equation Square root of 2x plus 1 = 3, solve for x and identify if it is an extraneous solution.

^ I really don't understand this topic, whatsoever. Could someone help?

Answers

The answer is 4.

Square root of 2x plus 1 = 3:
[tex] \sqrt{2x+1} =3[/tex]

Square both sides:
[tex]( \sqrt{2x+1} )^{2} =3^{2} \\ \\ 2x+1=9 \\ 2x = 9 - 1 \\ 2x =8 \\ x = 8:2 \\ x =4 [/tex]

By squaring both sides and solving for [tex]\(x\),[/tex] we find [tex]\(x = 4\)[/tex] as the solution, which is not extraneous upon substitution into the original equation.

To solve the equation [tex]\(\sqrt{2x + 1} = 3\),[/tex] we need to isolate[tex]\(x\).[/tex] Here's how:

1. Square both sides of the equation to eliminate the square root:

[tex]\[ (\sqrt{2x + 1})^2 = 3^2 \][/tex]

[tex]\[ 2x + 1 = 9 \][/tex]

2. Subtract 1 from both sides to isolate [tex]\(2x\)[/tex]:

[tex]\[ 2x = 9 - 1 \][/tex]

[tex]\[ 2x = 8 \][/tex]

3. Divide both sides by 2 to solve for [tex]\(x\)[/tex]:

[tex]\[ x = \frac{8}{2} \][/tex]

[tex]\[ x = 4 \][/tex]

Now, we have [tex]\(x = 4\)[/tex]. To determine if it's an extraneous solution, we need to check if it satisfies the original equation.

Substitute [tex]\(x = 4\)[/tex] into the original equation:

[tex]\[ \sqrt{2(4) + 1} = 3 \][/tex]

[tex]\[ \sqrt{9} = 3 \][/tex]

[tex]\[ 3 = 3 \][/tex]

Since the equation holds true, [tex]\(x = 4\)[/tex]is a valid solution, not an extraneous one.

Therefore, the solution to the equation [tex]\(\sqrt{2x + 1} = 3\) is \(x = 4\),[/tex]and it is not an extraneous solution.

Are the graphs of −5y=2x+3 and y=25x+4 parallel, perpendicular, or neither?

Answers

parallel graphs have the same slope. perpendicular has opposite reciprocal slopes. These equations have slopes of -2/5 and 25 so they are neither.

The graphs of the system of equations −5y=2x+3 and y=25x+4 are neither parallel nor perpendicular.

What is a linear equation?

It is defined as the relation between two variables, if we plot the graph of the linear equation we will get a straight line.

If in the linear equation, one variable is present, then the equation is known as the linear equation in one variable.

It is given that:

The system of equations is:

 −5y=2x+3 and y=25x+4

The slope of parallel graphs is the same. The reciprocal slopes of a perpendicular are opposite.

These equations are neither because they have slopes of 25 and -2/5.

Thus, the graphs of the system of equations −5y=2x+3 and y=25x+4 are neither parallel nor perpendicular.

Learn more about the linear equation here:

brainly.com/question/11897796

#SPJ3

HELP!!

Lily just paid off a $400 loan. She had to pay $60 in interest at a simple annual interest rate of 5%. How many years did Lily have this loan?

A. 2
B. 3
C. 4.5
D. 5

Answers

I=prt,,60=400*0.05t,,t=3 ..................

Answer:  The correct option is (B) 3.

Step-by-step explanation:  Given that Lily  just paid off a $400 loan. She had to pay $60 in interest at a simple annual interest rate of 5%.

We are to find the number of years for which Lily had this loan.

Let n be the required number of years.

Also, P = $400, S.I. = $60 and r% = 5%.

Therefore, by the formula of simple interest, we have

[tex]S.I.=\dfrac{Prn}{100}\\\\\\\Rightarrow 60=\dfrac{400\times5\times n}{100}\\\\\\\Rightarrow n=\dfrac{60}{20}\\\\\\\Rightarrow n=3.[/tex]

Thus, the required number of years is 3.

Option (B) is CORRECT.

sin10+sin20+sin40+sin50=sin70+sin80.prove it

Answers

We are going to prove it like this:
Lets use the formula sinA+sinB=2sin(A+B/2)cos(A-B/2)
 Now we are going to take the left side of equation
sin10+sin40+sin50+sin20
 Arranging =(sin50+sin10)+(sin40+sin20)
Applying the above formula. =2sin(50+10/2)cos(50-10/2)+2sin(40+20/… =2sin(30)cos(20)+2sin(30)cos(10)
=2sin30{cos20+cos10}
Again using the formula
cosA+cosB= 2cos(A+B/2)cos(A-B/2)
=2sin30{2cos(20+10/2).cos(20-10/2)}
=2sin30{2cos(15).cos(5)}
=2(1/2){2cos15.cos5} as sin30=1/2
=2cos15.cos5
Taking right side of equation sin70+ sin80
Using the formula sinA+sinB
= 2sin(A+B/2)cos(A-B/2)
=2sin(70+80/2)cos(70-80/2)
=2sin75cos5
=2sin(90-15)cos5
=2cos15.cos5 Hope this helps

Suppose f(π/3) = 3 and f '(π/3) = −7,
and let
g(x) = f(x) sin x
and
h(x) = (cos x)/f(x).
Find the h'(x)

Answers

Final answer:

To find h'(x), differentiate the function h(x) = (cos x)/f(x) using the product rule.

Explanation:

To find h'(x), we need to differentiate the function h(x) = (cos x)/f(x).

First, let's find the derivative of cos x, which is -sin x.

Next, we need to find the derivative of f(x). Since f(π/3) = 3 and f '(π/3) = −7, we know the slope of the tangent line at x = π/3 is -7.

Using the product rule, we can now differentiate h(x) = (cos x)/f(x) as follows:

h'(x) = [f(x)(-sin x) - cos x(f '(x))]/[f(x)]^2

Suppose a local vendor charges $2 per hot dog and that the number of hot dogs sold per hour is given by
x(t) = −4t^2 + 20t + 64,
where t is the number of hours since 10 AM,
0 ≤ t ≤ 4.
Find an expression for the revenue per hour R as a function of x?

Answers

 simply,  R(x)=2x as a function of x.

The area of a rectangle is 70 square inches and the length of the rectangle is 3 inches longer than the width.

The area of a rectangle is found by multiplying the length times the width.

Which equation models this situation?

w(w+3)=70w(w+3)=70

w + 3 = 70

3w = 70

w + 3w = 70

Answers

Final answer:

The correct equation to model the rectangle's area where the length is 3 inches more than the width and the area is 70 square inches is W(W + 3) = 70, which simplifies to W^2 + 3W = 70.

Explanation:

The student is asking for the correct equation to model a rectangle's area where the length (L) is 3 inches more than the width (W), and the area is 70 square inches. To find an equation that models the situation, we need to express L in terms of W. Since L is 3 inches more than W, we can write L as W + 3. The area (A) of a rectangle is found by multiplying the length by the width, so A = L x W.

Therefore, the equation that models this situation is W(W + 3) = 70. To see why, let's insert the expression for L into the area formula:

A = L x W = (W + 3) x W

This simplifies to:

A = W^2 + 3W

Since we know the area A is 70 square inches, we substitute and get the equation:

W^2 + 3W = 70

Which is the correct model for the given situation.

Other Questions
Which sentence in this passage from Herman Melvilles short story "Bartleby, the Scrivener" is an example of verbal irony? The passage is this:I seldom lose my temper, much more seldom indulge in dangerous indignation at wrongs and outrages, but I must be permitted to be rash here and declare that I consider the sudden and violent abrogation of the office of Master in Chancery, by the new Constitution, as a premature act, inasmuch as I had counted upon a life lease of the profits, whereas I only received those of a few short years. But this is by the way.My chambers were upstairs at No.___ Wall Street. At one end they looked upon the white wall of the interior of a spacious skylight shaft, penetrating the building from top to bottom. This view might have been considered rather tame than otherwise, deficient in what landscape painters call "life." But, if so, the view from the other end of my chambers offered at least a contrast, if nothing more. In that direction, my windows commanded an unobstructed view of a lofty brick wall, black by age and everlasting shade, which wall required no spyglass to bring out its lurking beauties, but, for the benefit of all nearsighted spectators, was pushed up to within ten feet of my windowpanes. Owing to the great height of the surrounding buildings, and my chambers being on the second floor, the interval between this wall and mine not a little resembled a huge square cistern.CHOICESI seldom lose my temper, much more seldom indulge in dangerous indignation at wrongs and outrages.In that direction, my windows commanded an unobstructed view of a lofty brick wall, black by age and everlasting shade, which wall required no spyglass to bring out its lurking beauties, but, for the benefit of all nearsighted spectators, was pushed up to within ten feet of my windowpanes.At one end they looked upon the white wall of the interior of a spacious skylight shaft, penetrating the building from top to bottom.Owing to the great height of the surrounding buildings, and my chambers being on the second floor, the interval between this wall and mine not a little resembled a huge square cistern. Science HelpIn the carbon cycle, carbon is transferred from animals to decomposers in all of the following ways EXCEPTA)as waste.B)in dead carcasses.C)as carbon dioxide.D)in scraps of discarded food. A child takes a nap averaging three hours and gets an average of 12 hours of sleep at night. Nap time and night time sleep can each vary by 30 mins. What are the possible time lengths for the child's nap and night time sleep? ...? Match the word with its definition.words DefinitionconstructiveA) characterized as complete or broadstrategicB) characterized by productivitycomprehensive C) characterized by an organizational plan Colby graphed a scatter plot of student exam scores (y) and the number of hours each student had slept the night before the exam. She drew the trend line and calculated its equation to be y=9/2x + 60. What is the predicted score for a student who slept 6 hours the night before the exam? does 17 birds drank from the pond over a course of 2 hours describe qualitative dat Write a real-world prblem in which you would need to convert pints to cups what's is width of a rectangle with an area of 5/8 in and a length of ten inches a narrow strip of land surrounded with water on 3 sides is called? What is one of the themes in leiningen versus the atrs? if a soccer field has an area of 27 sq miles and the width is 9 miles what isvthe lenght of the soccer field a monomer is the (building block,many molecules) of a biomolecule This is eagle song book. Danny father speaks quite poignantly about friendship, what does he say? what are two things people can do to help protect Jasper national park Skill-related fitness consists of components of fitness such as a. power. b. coordination. c. agility. d. all of the above To establish a favorable balance of trade, a government must increase its imports and decrease its exports.true or false Choose the verbs either in the indicative form or the infinitive form.choosingforsakewalkedwill have been eatingwould studyto behad let What triggered the events that resulted in the formation of the Church of England The discovery that the moon is similar in composition to the outer portions of the earth most supports the _____ theory. Help!!!!Which of the following statements describes Mesopotamian architecture?A. It contains painted images on the surface of the sun-dried mud bricks.B. Building walls contain images that depict scenes of everyday life.C. The walls of important buildings are constructed from marble blocks.D. Important buildings are sufaced with glazed and baked mud bricks. Steam Workshop Downloader