You are paid $82.50 for 7 1/2 hours of work. What is your rate of pay?

Answers

Answer 1
$82.50/7.5= $11 dollars an hour

all you have to do is take the total, and divide it by how long you work, in order to get how much you made per hour.  

hope this helped!
Answer 2
Rate of pay is 11 dollars

Related Questions

What's 4.50+4.50+2.39+2.39+1.99? What's the answer minus 25?? pls halp meh '-'

Answers

4.50+4.50=9.00=9
+
2.39+2.39=4.78
+
1.99
=
15.77

15.77-25=-9.23

What is the numerator of the fraction equivalent to 25/135 that has a denominator of27

Answers

It's 5 because 5/27 is equal to 25/135

Jeffrey is planning to tile his bathroom. He is taking measurements before he goes to the hardware store to buy the tile. What is the best unit of measure for Jeffrey to use?

Answers

Square feet because it is an ideal unit to measure rooms.

Answer:

i think the answer would be square feet

Step-by-step explanation:


Solve for x.

7(x - 3) = 4(x + 5)

Answers

7(x-3) = 4(x+5)

distribute:

7x-21 = 4x+20

add 21 to both sides

7x = 4x +41

subtract 4x from both sides

3x = 41

divide both sides by 3

x = 41 /3 = 13.67 ( repeating 6's) so it can be 13 2/3 as a fraction

the answer is 13 2/3



find f(-5) if f(x) = ???????

Answers

f(x) = Ιx+1Ι

x = -5

Ι-5Ι = 5

so equation is 5+1

answer is 6

Antonio purchased adult and child tickets for the fair. Tickets cost $29.35 for each adult and $17.45 for each child. Let x represent the number of adult tickets purchased and y represent the number of child tickets purchased. Write an expression to represent the total cost of the tickets Antonio purchased.


$29.35y + $17.45x

$29.35x + $17.45y

($29.35 + $17.45)(x + y)

($29.35 - $17.45)(x + y)

Answers

The Correct Answer for your problem is: B

29.35x + 17.45y Is the correct selection. 

Which equation best represents the line graphed above?

Answers

x=2 because for any y value the x value is always 2
the answer is y=2. i hope it helps

Terry bought 2 1/2 dozen chocolate chip cookies. She paid $15 for her purchase. If there were 12 cookies in each dozen, what was the cost per cookie?


$0.17


$0.83


$1.25


$0.50

Answers

Your answer Is $0.50 have a nice day my friend 

What is the smallest number greater than 100 that is :
a)divisible by two ?
b)divisible by ten?
c)divisible by four ?

Answers

I'd start by listing out the multiplies of all three past 100, like this:
102, 104, 106, 108, 110, 112, 114, 116, 118, 120, 122, 124, 126, 128, 130
104, 108, 112, 116, 120, 124, 128, 132, 136
110, 120, 130, 140
Now it's just a matter of finding the number that is the same for all three of them, which is 120.

The smallest number greater than 100 divisible by 2 is 102, divisible by ten is 110, divisible by four is 104.

What is Divisibility Test?

It is an easy method of determining the divisibility of a number by a particular divisor, by just observing the number and not actually dividing it.

The number is 100

A smallest number greater than 100 has to be found which is divisible by 2.

All even numbers are divisible by 2, a number which has 0, 2, 4, 6, 8 at its ones position are divisible by 2.

The smallest number from 100 which is divisible by 2 is 102.

A smallest number greater than 100 has to be found which is divisible by 10.

A number is divisible by 10, if it has 0 at its ones position.

The number after 100 which has 0 at its ones position is 110.

A smallest number greater than 100 has to be found which is divisible by 4.

If last two digit of a number forms 00 or are divisible by 4, then the number is divisible by 4.

The smallest number from 100 which is divisible by 4 is 104.

To know more about Divisibility Rule

https://brainly.com/question/10703980

#SPJ5

To which graph does the point (8, −2) belong?

Answers

When you're given a list like that, the easiest way to find the answer is to just test the point in each one! Plug in -2 for y and 8 for x, and see which of the inequalities those values satisfy.

What is the expanded equivalent of cos(a – b)?

Answers

cos A cos B - sin A sin B
That should be your answer  Hope this helps

The expanded equivalent of cos(a – b) is  cos(a)cos(b)+sin(a)sin(b).

Given that,

The equation is cos(a - b).We need to find the expanded equivalent of the above equation.

Based on the above information, the calculation is as follows:

= cos (a - b)

=  cos(a)cos(b)+sin(a)sin(b)

Therefore we can conclude that the expanded equivalent of cos(a – b) is  cos(a)cos(b)+sin(a)sin(b).

Learn more: brainly.com/question/12736770

A measurement is given as the length of an onion cell is 0.4mm to the nearest tenth of a millimeter. Find the minimum & maximum possible measurements

Answers

The least number which approximates to 0.4mm to the nearest tenth is 0.35 while the largest number which approximates to 0.4mm to the nearest tenth is 0.449

Therefore, the minimum & maximum possible measurements are 0.35 and 0.449 respectively.
0.35mm-0.45mm The actual length of the onion cell must be something that rounds to .4mm. Anything lower than 0.35mm would be closer to .3mm and anything over .45 would be closer to .5mm.

I brought 1 1/4 lbs of grapes. 2 1/2 lbs of cherries and 2lbs of bananas. How much total pounds of fruit did i buy?

Answers

First, add the whole numbers together:
1 + 2 + 2 = 5
Now, add the fractions together:
1/4 = 2/8
1/2 = 4/8
2/8 + 4/8 = 6/8 or 3/4
Add your two amounts together to get:
5 3/4 lbs of fruit

Hope this helps!! :)
1 + 2 + 2 = 5

1/4 + 1/2

1/4 + 2/4 = 3/4

The answer will be 5 3/4

Hope I helped

what is the value for x (5x+15) (3x-3)

Answers

Final answer:

The value of x in the expression (5x+15) (3x-3) is 15x^2 + 30x - 45.

Explanation:

The expression (5x+15) (3x-3) represents the multiplication of two binomials. To find the value of x, we can use the distributive property to simplify the expression:

Multiply the terms within the first set of parentheses: 5x * 3x = 15x^2.Multiply the terms within the second set of parentheses: 5x * -3 = -15x.Multiply the terms between the parentheses: 15 * 3x = 45x.Multiply the constant terms within the parentheses: 15 * -3 = -45.

Putting it all together, we have 15x^2 - 15x + 45x - 45. Combining like terms, the expression simplifies to 15x^2 + 30x - 45.

So, the value for x in the given expression is 15x^2 + 30x - 45.

If the decay of 742 mg of an isotope is described by the function A(t)= 742e-0.03t, where t is time in years. Find the amount left after 84 years. Round your answer to the nearest mg. 

Answers

57.701 mg before rounding

Answer:

The amount left after 84 years is 59.70 mg.                        

Step-by-step explanation:

Given : If the decay of 742 mg of an isotope is described by the function [tex]A(t)= 742e^{-0.03t}[/tex], where t is time in years.

To find : The amount left after 84 years?

Solution :

The function of decay of 742 mg of an isotope is given by,

[tex]A(t)= 742e^{-0.03t}[/tex]

We have to find the amount left after 84 years.

i.e. put t=84 in the given function,

[tex]A(84)= 742e^{-0.03\times 84}[/tex]

[tex]A(84)= 742e^{-2.52}[/tex]

[tex]A(84)= 59.701[/tex]

Therefore, The amount left after 84 years is 59.70 mg.

Solve and justify each step
SHOW WORK

Solve: -4(n+5)>3n+8

Answers

-4n-20>3n+8

-7n-20>8

-7n<28
n<-4

Lyle shot three times as many baskets as cliff, while kyle shot 12 more baskets than cliff. if lyle and kyle shot the same number of baskets, how many baskets did each of them shoot?

Answers

Final answer:

Cliff shot 6 baskets, Lyle shot 18 baskets, and Kyle also shot 18 baskets.

Explanation:

Let's represent the number of baskets Cliff shot as C.

Lyle shot three times as many baskets as Cliff, so Lyle shot 3C baskets.

Kyle shot 12 more baskets than Cliff, so Kyle shot C + 12 baskets.

Since Lyle and Kyle shot the same number of baskets, we can set their expressions equal to each other: 3C = C + 12.

Solving this equation, we find that C = 6.

Therefore, Cliff shot 6 baskets, Lyle shot 3C = 3(6) = 18 baskets, and Kyle shot C + 12 = 6 + 12 = 18 baskets.

Learn more about mathematics here:

https://brainly.com/question/27235369

#SPJ12

Please help!
This graph shows the amount of rain that falls in a given amount of time.


What is the slope of the line and what does it mean in this situation?


Select from the drop-down menus to correctly complete each statement

The slope of the line is ___

This means that ___ mm of rain falls every ___

Answers

the slope is 5/2. count up 5 then go right 2. this means that 5 mm of rain falls every 2 hrs

To find the slope, we use the formula for slope,

[tex]m=\frac{y_{2}-y_{2}} {x_{2}-x_{1}}[/tex]

Letting the point (2,5) be [tex](x_{1},y_{1})[/tex] and the point (4,10) be [tex](x_{2},y_{2})[/tex].

Now plugging in these values in the formula for slope, we get,

[tex]m=\frac{10-5}{4-2} =\frac{5}{2}[/tex]. The slope is [tex]\frac{5}{2}[/tex].

This basically means 5 mm of rain falls in every 2 hours, or 2.5 mm of rain falls every hour ([tex]\frac{5}{2} =2.5[/tex])


ANSWER: Slope is [tex]\frac{5}{2}[/tex] and 5 mm of rain falls every 2 hours.

What is the slope of a line that is perpendicular to the line that goes through (5,4) and (-2,-3)?

Answers

First, let us solve for the slope of the line which it intersects with:

m’ = (y2 – y1) / (x2 – x1)

m’ = (-3 – 4) / (-2 – 5)

m’ = 1

 

The slope of the perpendicular line is the negative reciprocal, therefore:

m = - 1 / m’

m = - 1 / 1

m = -1

 

So the slope of the line is -1.

A sealed rectangular box measuring 8 x 6 x 18 contains 864 sugar cubes, each measuring 1 x 1 x 1. How many sugar cubes are touching the box?

Answers

Final answer:

A total of 456 sugar cubes touching the box.

Explanation:

To calculate the number of sugar cubes touching the box, we must consider the cubes that lie along each face of the box without double-counting the cubes that touch corners and edges.

The box dimensions are 8 x 6 x 18 inches, and each sugar cube is 1 x 1 x 1 inch.

For the top and bottom faces (6 x 18), we have

6*18 = 108 sugar cubes touching the box on each face, totaling 216 for both the top and bottom.

For the front and back faces (8 x 18), since we must exclude the top and bottom rows, we have

(8-2) x (18-2) = 6 x 16 = 96 sugar cubes for one face and 192 for both.

For the sides (8 x 6), excluding the top and bottom rows again, we have

(8-2) x (6-2) = 6 x 4 = 24 sugar cubes on one side and 48 in total for the two sides.

Adding all these together, we get 216 (top and bottom) + 192 (front and back) + 48 (sides) = 456 sugar cubes touching the box.

Remember, this method assumes a single layer of sugar cubes is in direct contact with the inside surface of the box.

Triangle A′B′C′ is the image of triangle ABC after a dilation. What is the scale factor of the dilation?

Answers

Unfortunately, I can't really explain it that well, but AB is 6, and A'B' is 2.
6 / 3 = 2
BC is 3, and B'C' is 1.
3 / 3 = 1
Therefore the dilation factor would be 1/3.

Hope this helps! :)

Does believing in god increases the probability that god does exist

Answers

No.

If he exists then he does. More or less people "believing" doesn't change a fact.

It's like how we can't see all colors and other creatures can see "more" colors than us; and then having us claim they don't exist. Whether we decide to believe there's more colors we can't see or not will not change the fact of whether there IS or ISNT.

KInda if you love him then he loves personally i dont believe in him but thats everyone decision

Let n be a nonzero integer. find a domain on which f (x) = (1 − xn)1/n coincides with its inverse. hint: the answer depends on whether n is even or odd.

Answers

I believe that the correct equation given is:

f(x) = (1-x^n)^(1/n)

 

From this, we can say that:

 

When n is an odd number then f(x) is cubic root function. The domain is (-infinite, +finite) 
When n is an even number then f(x) is sqrt root function. The domain is (0, +finite) 

¿A Sandra qué le gusta hacer los viernes?

A A Sandra le gusta comer papas fritas los viernes.

B A Sandra le gusta comer agua los viernes.

C A Sandra le gusta beber pizza los viernes.

D A Sandra le gusta beber galletas los viernes.

Answers

I think the answer is A it makes the most sense. 
A states that "Sandra likes to eat fries on fridays."

B states that Sandra likes to eat water on fridays? (makes no sense)
C states that Sandra likes to drink pizza on fridays? (again makes no sense)
D states that Sandra likes to drink cookies on fridays? (NO SENSE)
Best answer choice is A.
La respuesta correcta es A: A Sandra le gusta comer papas fritas los viernes. Es el unico respuesta que es lógico. La traducción para la frase es: Sandra likes to eat french fries on Friday. 

identify the like terms 3x,4y,4z,5x

Answers

the like terms are 5x and 3x because they both are apart of the x family !

Which of the following lines goes downwards from left to right?
A. Y=2x+5 b. Y=2x-6
C. Y=2x d. Y=-2x+20

Answers

"Goes downwards from left to right" is basically saying that the slope of this line is negative. We go downhill from left to right. 

y = 2x+5 has a positive slope because m = 2 is the slope (b = 5 is the y intercept)
So choice A is out

Similarly choice B is eliminated as well because the slope is also m = 2

Choice C is false as well. The slope here is m = 2 (think of y = 2x as y = 2x+0)

The only choice with a negative slope is choice D. The slope is m = -2 

This is why the answer is choice D

Side Note: I'm using slope intercept form y = mx+b where m is the slope and b is the y intercept

A rabbit lure on a greyhound racetrack is set to travel once around the track at 50 feet per second, and then its speed is increased to 65 feet per second for the second loop around the track. If the total time it takes for the lure to go around the track twice is 184 seconds, what is the distance once around the track?

Answers

184 sec = Circumference / 50 fps + Circumference / 65 fps 
184 = 65 Circumference/3250 + 50 Circumference/3250 
184 = 115 Circumflex/3250 
598000 = 115 Circumflex 
Circumflex = 5200 ft
the answer would be 5200ft

2x7+2 ?
What does x =

Answers

The x is the variable so you have to find what the equation equals in order too find out what variable x is.  2 x7+2 = 16. So now x = 16

Carly is 3 times her brother's age. The sun of their age is no more than 24 years.

Answers

brothers age = x

 carly's age = 3x

3x +x <=24

4x<=24

x<=24/4 = 6

brothers age is x<=6

 

Carly is 18 and her brother is 6

Solve x + 9 = 18 - 2x

Answers

Add 2x to both sides,
3x+9=18
Subtract 9 from both sides. 3x=9
Divide both sides by 3. 
x=3

The solution to the equation x + 9 = 18 - 2x is x = 3.

What is the solution to the equation?

Given the equation in the question:

x + 9 = 18 - 2x

To solve the equation x + 9 = 18 - 2x, first, collect and combine the x terms on one side of the equation and the constant terms on the other side:

x + 9 = 18 - 2x

Add 2x to both sides of the equation:

x + 2x + 9 = 18 - 2x + 2x

x + 2x + 9 = 18

3x + 9 = 18

Subtract 9 from both sides of the equation:

3x + 9 - 9 = 18 - 9

3x = 18 - 9

3x = 9

Isolate x by dividing both sides by 3:

x = 9/3

x = 3

Therefore, the value of x is 3.

Learn more about equations here: brainly.com/question/14686792

#SPJ6

Other Questions
Which functional group is responsible for the sour taste of citrus fruits? A chronic problem lasts for a short period of time. True False Determine whether the statement is always, sometimes, or never true. If ABC has angles that measure 10 and 40, and DEF has angles that measure 40 and 120, then ABC DEF. PLEASE HELP ASAP!! Will give brainliest! 1)100,1000,10,000, or 100,0002)Greater or less Why was the siege of Vicksburg a major union victory how much energy is released when 2.95 kg of diethyl ether freezes? what two integers does Square Root 140 fall between? Help Ill give brainiest answer !! What is machine politics and how did it lead to corruption? Give at least two examples ( Giving a lot of points also) When was the pledge of allegiance adopted? You are given two sides of a triangle, a = 4.5 and b = 6. the angle between them is 35 degrees. write a script to find the length of the third side and the area of the triangle. hint: use trigonometric formula. Sir Walter RaleighJohn CabotHenry HudsonSir Francis DrakeThese people are associated with ___ exploration and colonization in the New World.A) British B) Dutch C) French D) Spanish The first major book describing the use of scientific disciplines in criminal investigations was written by: PLZ HELP ASAP!!!!!!!,Boris is playing on the mall escalators. One escalator goes up, one goes down, and one is out of service; otherwise, they're all identical. The up and down escalators go at the same speed. You can assume that Boris always runs at the same speed.Boris can run up the up escalator in 6 seconds. He can run up the down escalator in 30 seconds. How long does it take him to run up the out-of-service escalator? Explain your answer a candle maker has 4 1/2 pounds of wax. He wants to cut the wax into pieces that are 2/3 pound each. How many 2/3 pound pieces can he divide the wax into? Which of the of following best describe the political beliefs of Warren G. Harding and Calvin Coolidge? A). They wanted to decrease government regulations, decrease America's role in world affairs, decrease the amount of goods being imported into the US, and raise taxes.B). They wanted to increase government regulations, increase America's role in world affairs, increase the amount of goods being imported into the US, and lower taxes In To Kill A Mockingbird, what methods does Harper Lee use to present the lynch mob? (language analysis question). How are they presented and how does Lee use language technique to present them? Jose and Sarah are running in the cross country meet. Their skeletal and muscular systems work to move them through the course. As they run, they breathe faster and harder and their heart rate increases. This illustrates that body systems who was the first secretary of the treasury and the leader of the federalists when carbon undergoes sp2 hybridization it forms A study found that oxytocin metabolites are present at high levels when people are in happy relationships, and low levels during a breakup. a. True b. False Steam Workshop Downloader