HELP PLS ANSWER ASAP DUE TOMARROW

HELP PLS ANSWER ASAP DUE TOMARROW

Answers

Answer 1

Answer:

they need to sell 15,000 because 42 percent of 15,00 is 6,300+2500=800

the inequality should be. 2500+0.42s≥8,800

and the number line should have a closed point on 15,000 with the line pointing to the right


Related Questions

On her way to visit her parents, Jennifer drives 265 miles in 5 hours. What is her average rate of speed in miles per hour?

Answers

Answer:

53 miles per hour

Answer:

53 miles

Step-by-step explanation:

Total Distance: 265

Then, take that number and divide by 5. 265/5

= 53

If two sides of one triangle are proportional to two sides of another and included angles are equal, then the triangles are similar. True False

Answers

Yes the triangles are similar. It’s true

Answer:

True

Step-by-step explanation:

It was correct on my quiz

Travis are 2/3 of a small pizza Kai are 11/15 of a small pizza who ate more?

Answers

Answer:

11/15

Step-by-step explanation:

If you convert them to a decimal 11/15 would be more

11/15 hope this helps you pass :)

If the greatest value of n is 8, which inequality best shows all the possible values of n? (5 points) n < 8 n ≤ 8 n > 8 n ≥ 8

Answers

It is n is less or equal to 8
The second one

Wyatt ate 1/12 of a banana. Shane ate 7/12 of a banana. How much more did Shane eat than Wyatt?

Answers

Answer:

7/12 - 1/12 = 6/12

Step-by-step explanation:

Answer:

The answer should be 6/12 or 1/2

what is the mode for the data set 49,47,46,40,48,41,44,49,45,42,43

Answers

Mode: the number that occurs the most in a set of data.

Although it's optional, I always like to order the numbers from least to greatest so it makes it easier to see what number repeats more than anything else.

Least to greatest - 40,41,42,43,44,45,46,47,48,49,49

The mode for this set of data is 49. The mode is 49 because 49 is the only number that occurs more than once. No other numbers in this set of data appear twice except 41.

30 points! I will give brainliest.


Consider the expression 6r – r + 8(15 – r) + 23 – 6 .


Part A Is –3r + 137 equivalent to the given expression? Write your answer in the space provided .

Answers

6r -4 +8(15-r) + 23

expand brackets

6r -4 +120 -8r + 23

collect like terms

120 + 23 - 4 = 139

6r - 8r = -2r

139 - 2r

139 - 2r = -3r + 137

-137 from both sides

-2r = -3r -2

add 3r

R = -2

sub in both equations and see if you get the same value

-3r + 137

-3 (-2) + 137

6 +137 = 143

139 - 2r

139 - 2(-2)

139 + 4

143

yes they are equal

Final answer:

After simplifying the given expression by combining like terms and using the distributive property, we find that the simplified form is indeed -3r + 137, which means it is equivalent to the original expression.

Explanation:

To determine if the expression -3r + 137 is equivalent to the given expression 6r – r + 8(15 – r) + 23 – 6, we need to simplify the given expression.

Let's simplify the given expression step-by-step:

Combine like terms: 6r - r = 5r.Distribute the 8 within the parentheses: 8(15) - 8(r) = 120 - 8r.Combine the constants: 23 - 6 = 17.Add the constant from step 3 to the constant from step 2: 120 + 17 = 137.Combine the results from steps 1 and 2: 5r - 8r = -3r.Add the results from steps 4 and 5 to get the simplified expression: -3r + 137.

Therefore, the simplified form of the given expression is indeed -3r + 137, which means it is equivalent to the given expression.

Sean uses the point (10, 8) to represent the location of his house and uses the point (1, 3) to represent the
location of the gym. Each unit on the graph represents 1 mi. How far is the gym from Sean’s house? Round to
the nearest tenth. Show your work.

Answers

Answer:

[tex]10.3\ mi[/tex]

Step-by-step explanation:

we know that

the formula to calculate the distance between two points is equal to

[tex]d=\sqrt{(y2-y1)^{2}+(x2-x1)^{2}}[/tex]

we have

[tex]A(10,8)\\B(1,3)[/tex]

substitute the values

[tex]d=\sqrt{(3-8)^{2}+(1-10)^{2}}[/tex]

[tex]d=\sqrt{(-5)^{2}+(-9)^{2}}[/tex]

[tex]d=\sqrt{25+81}[/tex]

[tex]d=\sqrt{106}[/tex]

[tex]d=10.3\ mi[/tex]

What are the solutions to the equation 3x-4y-8=12

Answers

Answer:

y= 3      

  --- X +1

   4

Step-by-step explanation:

-4y=-3x-12+8

-4y=-3x+4

---      ---  -

4        4    4

y= 3      

  --- X +1

   4

Can someone please tell me if my answers are correct??

Answers

#2 Has 1 Line of symmetry

Answer:

I think they are all correct but 2 and 4 might be wrong. (I don't see the shapes very well.)

I can't see that well but on #2, can't you half it? If you can, it has 1 line of Symmetry. If you can't, it has no lines of symmetry  

On #4, you might be able to half it from the lower left corner and the upper right corner. If it works, there is 1 line of symmetry, if it doesn't it has none

factor please help 30z^2-53z+12

Answers

Answer:

(2z - 3)(15z - 4)

Step-by-step explanation:

To factor the quadratic

Consider the factors of the product of the coefficient of the z² term and the constant term which sum to give the coefficient of the z- term

product = 30 × 12 = 360 and sum = - 53

The factors are - 45 and - 8

Use these factors to split the z- term

30z² - 45z - 8z + 12 ( factor the first/second and third/fourth terms )

= 15z(2z - 3) - 4(2z - 3) ← factor out (2z - 3)

= (2z - 3)(15z - 4) ← in factored form

Find the equation of the line that is parallel to the line x + 5y = 10 and passes through the point (1, 3). A) y = − 1/5 x + 16/5 B) y = −5x − 5/16 C) y = 5x + 10 D) y = 1/5 x − 2

Answers

Answer:

A

Step-by-step explanation:

Parallel lines have the same slope. Find the slope by converting the equation x + 5y = 10 into y = mx+b form. It becomes y = -1/5x + 2. The slope is -1/5.

Substitute -1/5 and the point (1,3) into the point slope form.

[tex]y - y_1 = m(x-x_1)\\y - 3 = -\frac{1}{5}(x - 1)\\y - 3 = -\frac{1}{5}x + \frac{1}{5}\\y = -\frac{1}{5}x + \frac{16}{5}[/tex]

Answer:

It's aaaaaaaaaaaaaaaaaaaaaaa!!!

Step-by-step explanation:

Determine the translation.
A translation by___ units to the (right/left) and ___ units (up/down)

Answers

it went to the right 4 units and up 2 units

determine the domain and range of the function f(×)=
[tex]2 \sqrt[3]{108} 2x[/tex]

Answers

Answer:

Simplifies to:

748.245949x

Twenty-five percent of 200 is what number?

Answers

Answer:

12.5

Step-by-step explanation:

25/200

Answer:

50

Step-by-step explanation:

0.25 x 200 = 50

A triangle has side lengths measuring 2x + 2 ft, x + 3 ft, and n ft. Which expression represents the possible values of n, in feet? Express your answer in simplest terms. x – 1 < n < 3x + 5 n = 3x + 5 n = x – 1 3x + 5 < n < x – 1

Answers

Answer:

[tex]x-1<n<3x+5.[/tex]

Step-by-step explanation:

If a, b and c are the lengths of the triangle's sides, then

[tex]a+b>c,\\ \\a+c>b,\\ \\b+c>a.[/tex]

Since

[tex]a=2x+2,\\ \\b=x+3,\\ \\z=n,[/tex]

then

[tex]2x+2+x+3>n\Rightarrow n<3x+5,\\ \\2x+2+n>x+3\Rightarrow n>1-x,\\ \\x+3+n>2x+2\Rightarrow n>x-1.[/tex]

Thus,

[tex]x-1<n<3x+5.[/tex]

Triangle inequality theorem of a triangle says that the sum of any of the two sides of a triangle is always greater than the third side. The correct option is A, 3x + 5 > n > x - 1.

What is triangle inequality theorem?

Triangle inequality theorem of a triangle says that the sum of any of the two sides of a triangle is always greater than the third side.

Suppose a, b and c are the three sides of a triangle. Thus according to this theorem,

(a+b) > c

(b+c) > a

(c+a) > b

Given the three sides of the triangle 2x + 2 ft, x + 3 ft, and n ft. Now using the triangle inequality theorem we can write,

2x + 2 + x + 3 > n  → 3x + 5 > n

2x + 2 + n > x + 3 → n > -x + 1

x + 3 + n > 2x + 2 → n > x - 1

Since x can not be a negative term therefore, we can write,

3x + 5 > n > x - 1

Hence, the correct option is A, 3x + 5 > n > x - 1.

Learn more about Triangle Inequality Theorem:

https://brainly.com/question/342881

#SPJ5

how many solutions can be found for the equation 4X equals 4X

ZERO
ONE
TWO
INFINITELY MANY

Answers

infinitely many, because x can be anything and the equation will still be valid

Answer: Simplifying

4x = 4x

Add '-4x' to each side of the equation.

4x + -4x = 4x + -4x

Combine like terms: 4x + -4x = 0

0 = 4x + -4x

Combine like terms: 4x + -4x = 0

0 = 0

Solving

0 = 0

Couldn't find a variable to solve for.

This equation is an identity, all real numbers are solutions.

(p+q)*(p-q) can you show the process

Answers

Answer:

p²-q²

Step-by-step explanation:

(p+q)×(p-q)

=p×(p-q)+q×(p-q)

=p×p-p×q+p×q-q×q

=p²-p×q+p×q-q²

=p²-q²

Question 1 options:
x2 +x − 4 = 0
You will solve this using the Quadratic Formula.

First, what are the values of a, b, and c?

a =

Answers

Answer:

x = 1.56  or x = -2.56

Step-by-step explanation:

From the equation;

x2 +x − 4 = 0

a = 1 , b = 1, and c = -4

x = (-b ± √(b² -4ac))/2a

  = (-1 ± √(1²- 4×1×-4))/2

  = ( -1 ± √(17)/2

  = (-1 ± 4.12)/2

  = (-1 + 4.12)/2 or (-1 - 4.12)/2

  x = 1.56  or x = -2.56

choose the system of inequalities that best matches the graph below.

a) y<2x+2, y<x
b) y<2x, y<_x
c) y<_x-2, y>-x
D) y<2x+2, y> -x

Answers

Answer:

D) [tex]y\:<\:2x+2[/tex], [tex]y\:>\:-x[/tex]

Step-by-step explanation:

The blue boundary line has a y-intercept of 2 and a slope of  2.

It has equation : [tex]y=2x+2[/tex]

Since the boundary line is not solid and the lower half plane of this line is shaded, its inequality is

[tex]y\:<\:2x+2[/tex]

The blue boundary line passes through the origin and has slope [tex]-1[/tex].

Its equation is [tex]y=-x.[/tex]

Since the boundary line is not solid and the right half-plane is shaded, its inequality is [tex]y\:>\:-x[/tex]

The correct choice is D.

The correct choice is D: y < 2x + 2, y > -x.

The blue boundary line is represented by the equation y = 2x + 2.

Since the lower half-plane is shaded, the inequality is y < 2x + 2.

The blue boundary line also passes through the origin and has a slope of -1, which gives it the equation y = -x.

Since the right half-plane is shaded, the inequality is y > -x.

So, the correct choice is D: y < 2x + 2, y > -x.

for such more question on boundary line

https://brainly.com/question/29141753

#SPJ3

Could someone please help me

Answers

Answer:

c

Step-by-step explanation:

I think its c but I could be wrong

rewrite the function f(x)=x^2-6x-60 by completing the square​

Answers

To rewrite f(x) = x^2 - 6x - 60 by completing the square, you add and subtract (6/2)^2 within the equation and refactor to get f(x) = (x - 3)^2 - 69, with the vertex at (3, -69).

To rewrite the function f(x) = x^2 - 6x - 60 by completing the square, follow these steps:

Write the equation in the form x^2 - bx = c.Find (b/2)^2, which is the number to be added to both sides to complete the square. For our equation, (6/2)^2 = 9.Add and subtract this number inside the equation. So you have: f(x) = x^2 - 6x + 9 - 9 - 60.Rewrite the quadratic part as a binomial square: f(x) = (x - 3)^2 - 69.

The function is now in the completed square form. The vertex of this parabola is at (3, -69).

In a classroom,
3
-
10
of the students are wearing blue shirts , and
3
-
5
are wearing white shirts. There are 30 students in the classroom. How many students are wearing shirts other than blue shirts or white shirts?

Answers


so first you have to make a common denominator of 30 to see how many people in the class.

3/10 • 3 = 9/30
3/5 • 6 = 18/30

then you have to add them together.

18 + 9 = 27

then you subtract 30 from 27.

30 - 27 = 3

so 3 students are wearing shirts other than blue or white

Answer:

i did this question b4 but completely forgot the answer ://

Step-by-step explanation:

15 A store manager receives a delivery
of 2 boxes of lightbulbs. Each box
contains 25 lightbulbs. The store
manager tests all the lightbulbs and
finds that 2 of them are defective.
Based on these results, what can
the store manager predict about the
next delivery of lightbulbs?
A A delivery of 3 boxes will contain
3 more defective lightbulbs than
a delivery of 2 boxes.
B A delivery of 4 boxes will contain
2 more defective lightbulbs than
a delivery of 2 boxes.
C A delivery of 5 boxes will contain
10 more defective lightbulbs than
a delivery of 2 boxes.
D
A delivery of 6 boxes will contain
3 more defective lightbulbs than
a delivery of 2 boxes.

Answers

Answer:

B

Step-by-step explanation:

For each box, there is 1 defective lightbulb. Therefore, a delivery of 4 boxes will have 4 defective lightbulbs. A delivery of 2 boxes has 2 defective lightbulbs. 4 defective lightbulbs subtracted by 2 defective lightbulbs equals 2 more defective lightbulbs in 4 boxes than 2. Therefore, it is B.

Which value is equivalent to x-7/7-x

Answers

Answer:

[tex]\large\boxed{\dfrac{7-x}{x-7}=-1}[/tex]

Step-by-step explanation:

[tex]\dfrac{7-x}{x-7}=\dfrac{-(x-7)}{x-7}\\\\\text{cancel}\ (x-t)\\\\\dfrac{7-x}{x-7}=\dfrac{-1}{1}\\\\\dfrac{7-x}{x-7}=-1[/tex]

Answer:

-1

Step-By Step:

The Answer on Ed

What is the product ?
(4y-3)(2y^2+3y-5)

Answers

Answer:

8y^3 + 6y^2 - 29y + 15

Step-by-step explanation:

8y^3 + 12y^2 - 20y - 6y^2 - 9y + 15

then

8y^3 + 6y^2 - 29y + 15 is the product

Best regards

Answer:

=8y^3+6y^2−29y+15

Step-by-step explanation:

(4y−3)(2y^2+3y−5)

=(4y+−3)(2y^2+3y+−5)

=(4y)(2y^2)+(4y)(3y)+(4y)(−5)+(−3)(2y^2)+(−3)(3y)+(−3)(−5)

=8y^3+12y^2−20^y−6y^2−9y+15

=8y^3+6y^2−29y+15

need help with this ​

Answers

Answer:

x       y

15     -1

12     0

9       1

6       2

3       3

0       4

Step-by-step explanation:

This is a function table. For a linear function, find the average rate of change between the listed points called slope. Then use the slope to fill in other inputs and outputs for the function.

[tex]m = \frac{y_2-y_1}{x_2-x_1}=\frac{4-0}{0-12} =\frac{4}{-12} =- \frac{1}{3}[/tex]

This means for every 3 units made in the input, the function moves down 1 output.

x       y

15     -1

12     0

9       1

6       2

3       3

0       4

There are 29 pencils in a basket. 7 of these pencils are green. The rest of them are yellow.
(A) what is the ratio of yellow pencinls to green pencils?
(b) what is the ratio of all pencils in the basket to yellow pencils

Answers

[tex]\huge\boxed{22:7}\ \huge\boxed{29:22}[/tex]

First, we need to find the number of yellow pencils in the basket. We'll represent the number of green pencils with [tex]g[/tex] and the number of yellow pencils with [tex]y[/tex].

[tex]\begin{aligned}7+y&=29&&\smash{\Big|}&&\text{Start with what we already know.}\\y&=22&&\smash{\Big|}&&\text{Subtract 7 from both sides.}\end{aligned}[/tex]

Our first ratio is [tex]y:g[/tex], or [tex]\boxed{22:7}[/tex].

The second ratio is [tex](g+y):y[/tex]:

[tex]\begin{aligned}(g+y)&:y\\(7+22)&:22\\29&:22\end{aligned}[/tex]

HELP ASSAP WILL MARK BRAINIEST!!!!!!

Answers

Answer:

m= -5/4

Step-by-step explanation:

Slope can be translated to "rise over run". You go down 5 spaces and then move over 4 spaces.

Consider the expression below. Place the steps required to determine the sum of the two expressions in the correct order. 3x+6/x^2-x-6 + 2x/x^2+x-12

Answers

Answer:

1) Factor the denominator and the numerator of each fraction.

2) Simplify.

3) Find the Least common denominator (LCD).

4) Rewrite the LCD. Divide it by the denominator of the first fraction and multiply the result of the division by its numerator (The LCD is the same denominator of the second fraction, so its numerator stays the same).

5) Apply Distributive property on the numerator and on the denominator.

6) Add like terms.

Step-by-step explanation:

The steps required to determine the sum of the two expressions are:

1) Factor the denominator and the numerator of each fraction:

[tex]\frac{3x+6}{x^2-x-6}+\frac{2x}{x^2+x-12}=\frac{3(x+2)}{(x-3)(x+2)}+\frac{2x}{(x-3)(x+4)}[/tex]

2) Simplify (Remember that [tex]\frac{(x+2)}{(x+2)}=1[/tex]):

[tex]\frac{3}{(x-3)}+\frac{2x}{(x-3)(x+4)}[/tex]

3) Find the Least common denominator (LCD). In this case this is:

[tex]LCD=(x-3)(x+4)[/tex]

4) Rewrite the LCD. Divide it by the denominator of the first fraction and multiply the result of the division by its numerator. As the LCD is the same denominator of the second fraction, its numerator stays the same:

[tex]=\frac{3(x+4)+2x}{(x-3)(x+4)}[/tex]

5) Apply Distributive property on the numerator and on the denominator:

[tex]=\frac{3x+12+2x}{x^2+x-12}[/tex]

6) Add like terms:

[tex]=\frac{5x+12}{x^2+x-12}[/tex]

Answer:

x-5 edg

Step-by-step explanation:

Other Questions
For the following question, find the value of the variable(s). If your answer is not an integer, leave it in simplest radical form. Please help!! The diameter of the planet mars is approximately 6.794 10^6 meters. Which is an equivalent way to express that measure?a- 6.794 billion metersb- 679.4 million metersc- 67.94 million metersd- 6.794 million meters What is the solution to the equation g/13=52A.4B.19C.650D.676 What is the difference between micro-evolution and macro-evolution? 1. Macro evolution is a change in the gene pool and micro evolution is the formation of a new species. 2. Micro evolution is the change in the gene pool and macro evolution is the formation of a new species. 3. There is no difference. 4. Micro evolution only happens in the Galapagos island and Marco evolution only happens in Trinidad. Please please help! What is the value of x? Factor completely.4p+36p+81Question 3 options:(2p9)2(2p+9)2(4p+6)2 RateMinutesMiles0053107151220172521The table shows how many miles Brandon has traveled after the specified period of time. Find Brandon's rate in miles per minute between 15 and 20 minutes. A)1 mile per minute B)5 miles per minute C)12 miles per minute D)17 miles per minute how did the U.S. government use propaganda during ww2 Read the excerpt from "Civil Peace" by Chinua Achebe.Jonathan Iwegbu counted himself extraordinarily lucky. "Happy survival! meant so much more to him than just a current fashion of greeting old friends in the first hazy days of peace. It went deep to his heart. He had come out of the war with five inestimable blessingshis head, his wife Marias head and the heads of three out of their four children. As a bonus he also had his old bicyclea miracle too but naturally not to be compared to the safety of five human heads.What can you most clearly determine about the storys setting from this excerpt?a. The story takes place right before a war.b. The story takes place in the middle of a war.c. The story takes place right after a war.d. The story takes place years before the start of a war. sara has 24 sweets tim also has 24 sweets sara gives tim x sweets sara then eats 7 of her sweets tim then eats half of his sweetswrite an expression for the number of sweets sara and tim have now Read the excerpt below and answer the question. The Dust Bowl years spanned 1930-1936, when a million acres of farmland across the Plains became unusable due to severe drought and over-farming. When Dust Bowl conditions devastated farmers, many defaulted on their bank loans, which helped lead to the widespread bank failure. Franklin D. Roosevelt called for restoration in America with a promise that there are better days ahead. What is the best definition you can infer for the word "restoration" from the excerpt above? bringing back to former position or condition re-establish monarchy replacement giving back Which of the following is not a typical type of weather data collected? Help me please. FUN AND EASY assignment!! please check it out!!!Imagine and create a character that lived and experienced the cold war!Part B 1. What was the first time you remember hearing about the Soviet Union (or the USSR) and its conflict with the United States? Tell me about it. 2. What do you remember seeing or reading in the news about the Cold War? 3. What books did you read or movies did you watch that villainized the Soviet Union or dealt with the Cold War? How did they shape your impressions at that time? 4. What were you taught in school and at home about the Soviet Union? What did your school and family teach about nuclear threats and nuclear war? 5. Were you or any of your family members ever afraid that there would be a hot war or nuclear war between the United States and the Soviet Union? When did you feel that way? If yes, did you do anything to prepare or get ready for it? 6. What aspects of the Space Race do you remember? Was "Space Race" a phrase that you remember using at the time? What did it mean to you? 7. How was the rivalry between the United States and the Soviet Union promoted in sports? Can you think of any specific examples? 8. Do you remember the Berlin Wall coming down? How did it make you feel? How have your feelings about that era changed since 1989 and the Berlin Wall coming down? 9. How do you think future generations will remember the Cold War? What lessons should students today take away from the Cold War? 10. How does psychological warfare today compare to psychological warfare during the Cold War? 11. Where you a participant of the cold war? 12. Do you think the cold war was necessary? What helps a literary critic determine a story's complex theme? A. The public's reaction to the story B. The number of characters in a story C. The order of events within the story D. The specific details within the story What is the best definition for a paragraph's topic sentence? a sentence that begins the paragraph a sentence that helps the reader to organize her thoughts a sentence that tells the reader what will be discussed a sentence that is the first sentence of the paragraph Which of the following is the best example of kinetic energy? A book sitting on a bookshelf A golfer preparing to putt the ball A race car in position at the start line A satellite orbiting the Earth Predict how many times you will roll a number less than 5 if you roll a standard number cube 250 times PLEASE HELP ME ||Thousands of years ago the climate of the Bering land bridge was A. subarctic B. semiarid C. tropics D. tundra Lawrence is 54 years old, and he notices that now he cannot eat as much as he did when he was in his thirties without gaining weight. Why is this happening? For every decade past the age of 30, the body's basal metabolism declines by 1% to 2% due to the steady decrease of lean body mass. For every decade past the age of 30, the body's capacity for physical activity declines by 1% to 2% due to the steady decrease of lung function. For every decade past the age of 30, the body's response to the thermic effect of food declines by 1% to 2% due to the increasing internal body temperature. All of the above are reasons why Lawrence cannot eat as much in his fifties as he did in his thirties without gaining weight. Which letter indicates the amplitude of the wave?a. Ab. Bc. Cd. Dis it b? Steam Workshop Downloader