Answer : The volume of water added = 9.411 ml
Solution : Given,
Absorbance decreases by 32% upon dilution means,
Let, initial absorbance = 100 [tex]Lmol^{-1}Cm^{-1}[/tex]
then final absorbance = 100 - 32 = 68 [tex]Lmol^{-1}Cm^{-1}[/tex]
initial concentration = 1.2 M
initial volume = 20 ml = 0.02 L ( 1 L = 1000 ml )
According to Beer-Lambert law, the absorbance is directly proportional to the concentration of an absorbing species.
A ∝ C
[tex]\frac{A_{inital}}{A_{final}}=\frac{C_{initial}}{C_{final}}[/tex]
Now put all the given values in this formula, we get
[tex]\frac{100}{68}=\frac{1.2}{C_{final}}[/tex]
[tex]C_{final}[/tex] = 0.816 M
Now, calculating the number of moles,
Moles = concentration × volume
Moles = 1.2 × 0.02 = 0.024 moles
Now, Calculating the final volume by this formula.
[tex]C_{final}=\frac{moles}{V_{final}}[/tex]
[tex]V_{final}[/tex] = [tex]\frac{0.024}{0.816}[/tex] = 0.0294 L = 29.411 ml
The inital volume is 20 ml and final volume is 29.411 ml.
Volume of water added = final volume - initial volume = 29.411 - 20 = 9.411 ml
Final answer:
Approximately 9.38 mL of water was added to the original 20.0 mL of a 1.20 M copper(II) ion solution to achieve a 32.0% reduction in absorbance.
Explanation:
When diluting a solution, the concentration is reduced, and this often leads to a decrease in the absorbance of the solution if the compound being measured absorbs light. Since the absorbance of the copper(II) ion solution decreases by 32.0% upon dilution, we can calculate the volume of water added using the formula C1V1 = C2V2, where C1 and V1 are the initial concentration and volume and C2 and V2 are the final concentration and volume. The initial absorbance does not need to be known since we have the percent decrease and initial volume.
Let's assume the initial absorbance, A1, correlates linearly with concentration, which drops to 68.0% of its original value. Consequently, the final concentration, C2, is also 68.0% of C1. Substitution yields:
C2 = 0.68 × 1.20 MV2 = 20.0 mL + volume of water added (which we will call Vw)Now applying the dilution formula:
1.20 M × 20.0 mL = (0.68 × 1.20 M) × (20.0 mL + Vw)24.0 MmL = 0.816 M × (20.0 mL + Vw)Rearranging and solving for Vw:
24.0 MmL = 16.32 MmL + 0.816 M × VwVw = (24.0 MmL - 16.32 MmL) / 0.816 MVw = 9.38 mLTherefore, approximately 9.38 mL of water was added to the original 20.0 mL of a 1.20 M solution of Cu2+(aq) to achieve the 32.0% reduction in absorbance.
Which of these statements about enzymes is true?
a.) enzymes increase the rate of a reaction by decreasing the gibbs free energy change of the reaction.
b.) enzymes decrease the rate of a reaction by increasing the gibbs free energy change of the reaction.
c.) enzymes increase the rate of a reaction by decreasing the activation energy of the reaction.
d.) enzymes increase the rate of a reaction by decreasing the activation energy of the reaction and the gibbs free energy change of the reaction.
e.) enzymes do not change the rate of a reaction?
Enzymes increase the rate of a reaction by decreasing the activation energy required for the reaction but do not change the Gibbs free energy change of the reaction. Option C is correct.
Among the statements about enzymes, the true one is that enzymes increase the rate of a reaction by decreasing the activation energy of the reaction. Enzymes are biological catalysts that specifically bind to substrates and help convert them to products more efficiently by lowering the energetic barrier, which is the activation energy required for the reaction to proceed.
However, it is important to note that while enzymes do lower the activation energy, they do not alter the Gibbs free energy change (AG) of the reaction. The Gibbs free energy change is a thermodynamic property that determines the spontaneity of a reaction and remains unchanged regardless of whether enzymes are present.
Hence, C. is the correct option.
A child goes to the kitchen sink to rinse the glass from which he just drank grape juice. as the water runs into the glass, the juice residue turns from ppurple to light blue what is happening
Suggest a reason for why the phosphorus-containing side product from the horner-emmons wittig reaction is more water-soluble than the triphenylphosphine oxide side product obtained from the standard wittig reaction.
~Hey guys, can somebody answer this for me, thanks :) ~
The average distance between Earth and Mars is about 2.08*10^8 km. How long would it take to transmit television pictures from Mars to Earth?
The time required by an electromagnetic wave having a speed equal to that of light to travel a distance of 2.08 × 10⁸ km is 693. 3 seconds.
What is transmission of waves?Transmission of wave is the movement of waves from one medium to the other. Waves are the propagation of energy or matter. Waves are associated with certain wavelength and frequency.
The speed of an electromagnetic wave is equal to the speed of light, that is 3 × 10⁵ m/s. The time taken by a wave to cover a distance is dependant on the distance and air resistance.
It is given that the distance between moon and earth is 2.08 × 10⁸ km. The speed of light energy is 3 × 10⁵ m/s. Thus the time to cover this distance is calculated as follows:
Time = distance / speed
= 2.08 × 10⁸ km / 3 × 10⁵ m/s
= 693.3 seconds.
Hence, the television pictures from mars will take 693.3 seconds to reach earth.
To find more about electromagnetic waves, refer the link below:
https://brainly.com/question/3101711
#SPJ2
What is the formula weight of magnesium nitrate, mg(no3)2? express your answer to four significant figures and include the appropriate units?
The formula weight of a compound is simply equal to the total molar mass.
The molar mass of each elements are:
Mg = 24.305 g/mol
N = 14.0067 g/mol
O = 15.999 g/mol
So the total molar mass is:
formula weight = 24.305 + 2 (14.0067) + 6 (15.999)
formula weight = 148.3 g/mol
Final answer:
The formula weight of magnesium nitrate, Mg(NO3)2, is 148.341 g/mol when calculated using the atomic weights of magnesium, nitrogen, and oxygen and summing them up according to the numbers of atoms in the compound.
Explanation:
The formula weight of magnesium nitrate, Mg(NO3)2, is calculated by adding together the atomic weights of all the atoms in the compound.
The atomic weight of magnesium (Mg) is 24.305 g/mol, nitrogen (N) is 14.007 g/mol, and oxygen (O) is 15.999 g/mol. Given that there are two nitrate groups, we multiply the weights of nitrogen and oxygen accordingly.
Multiply the atomic masses with the number of atoms: 1x24.305 g/mol Mg, 2x14.007 g/mol N, 6x15.999 g/mol O.Add all the numbers from step one:Therefore, the formula weight of magnesium nitrate is 148.341 g/mol, expressed to four significant figures with the appropriate units (g/mol).
What is the angle between the carbon-sulfur bond and the carbon-nitrogen bond in the thiocyanate ( SCN− ) ion?
Answer:
Angle between the carbon-sulfur bond and the carbon-nitrogen bond in the thiocyanate ion[tex]SCN^-[/tex] is 180°.
Explanation:
The hybridization of carbon atom is sp hybridized. The shape of the sp hybridized carbon is linear which means that angle between sulfur carbon a bond and carbon nitrogen bond is 180 °.
Where as [tex]sp^3[/tex] hybridized carbon has tetrahedral shape with an angle of 109.5°.
Where as [tex]sp^2[/tex] hybridized carbon has trigonal planar with an angle of 120°.
At which stage does a gas form in a gas formation reaction?
the reactants stage
the product stage
the liquid stage
the solid stage
Answer: b
Explanation:
If acetic acid is the only acid that vinegar contains (ka=1.8×10−5), calculate the concentration of acetic acid in the vinegar. express your answer using two significant figures.
The ester below can be separated into phenol and an acetate salt, via saponification: heating the ester with a strong base, such as sodium hydroxide, will produce phenol and sodium acetate. the two chemicals can then be separated by heat and filtration.
a. calculate the unsaturation number of the ester above.
b. calculate the molecular weight of the ester above
Scoring scheme: 3-3-2-1 using the ion concentration values in cells #3 & #5 in the expression, ecell#5 - ecell#3 = -(0.0257/2)ln{([fe2+(cell#5)]2[fe3+(cell#3)]2)/([fe3+(cell #5)]2[fe2+(cell#3)]2)}, calculate the theoretical cell voltage difference between cells #5 and #3.
Inside the framework of electrochemistry, the Nernst equation is used to calculate the theoretical cell voltage difference. The Nernst equation shows the variation of cell potential from its standard state and uses the ion concentration values of cell #5 and cell #3.
Explanation:The calculation of the theoretical cell voltage difference between cells #5 and #3 can be understood within the context of electrochemistry where the Nernst equation becomes a cornerstone.
The Nernst equation, written as Ecell = Ecell - (0.0257/n)*logQ, explains the variations in redox potentials (cell potentials) from the standard state values, where n denotes the number of electrons transferred, and Q represents the reaction quotient. This equation is used in practice to calculate Ecell, the potential of a redox system, which differs from its standard state value.
First, you'll need to know the ion concentration values for cells #3 and #5. Then, input those values into the expression. After computing, the resulting value represents the theoretical cell voltage difference between cells #5 and #3.
Learn more about Cell Potential here:https://brainly.com/question/31975412
#SPJ2
which state of matter undergoes changes in volume most easily?
Gas is the state of matter that can most easily undergo changes in volume. The freely moving particles of gas adapt to take up the entire volume and shape of any container it is kept in.
Explanation:The state of matter that undergoes changes in volume most easily is gas. This is because gaseous substances have the most dispersed particles among the three fundamental states of matter (solids, liquids, and gases). These particles move freely, occupying the complete shape and volume of the container in which they are kept. Thus, any change in the container's size will in-turn affect the volume of the gas. For instance, if we inflate a balloon with gas and then deflate it, the gas volume adjusts in line with the balloon's volume changes.
Learn more about State of Matter
https://brainly.com/question/31659891
#SPJ6
How many dots would a lewis dot structure for neon have?
A teacher did an experiment to show the movement of particles in solids, liquids, and gases. The experimental set-up is shown below: An inverted glass jar is shown. Small circles representing foam balls are shown inside the jar. A stretched balloon is shown tied at the mouth of the jar. A string is shown drawn out from the middle of the stretched balloon. A hand is shown pulling the drawn out string. The teacher pulled the string attached to the stretched balloon, first slowly, then fast, and finally vigorously. Which of the following is most likely correct about the pulling of the string and the corresponding state of matter being represented? Gas is represented when pulled fast, solid when pulled slowly, liquid when pulled vigorously. Gas is represented when pulled slowly, liquid when pulled fast, solid when pulled vigorously. Solid is represented when pulled slowly, liquid when pulled fast, gas when pulled vigorously. Solid is represented when pulled vigorously, liquid when pulled fast, gas when pulled slowly.
Answer is: Solid is represented when pulled slowly, liquid when pulled fast, gas when pulled vigorously.
For example, nitrogen molecules have weakest intermolecular bonds in gas phase and move fast and without order.
Cooling is change from liquids to solids. In solid state (for example ice) movement of molecules is more slow than movement of molecules in liquids (for example water).
In solid, molecules are closely packed, stiff and do not changes of shape or volume. Solid object (for example iron) does not take on the shape of its container.
Liquids have definite volume, but no fixed shape.
Gases (for example nitrogen and neon) not have definite volume and fixed shape, it depends on its container.
Answer:
Solid is represented when pulled slowly, liquid when pulled fast, gas when pulled vigorously.
Explanation:
Hello,
The three states of matter could be distinguished via their molecular both arrangement and movement, in such a way, solids have an organized assembly of molecules that slightly and slowly move with respect to their equilibrium position, that is why the solid is represented when the string is pulled slowly, besides of their well-defined shape.
Secondly, liquids have a widespread longer distance between molecules and faster molecular movements which cause the liquid to have an indefinite shape, thus, the liquid is represented when the string is pulled fast.
Finally, the molecular arrangement in gases is "messy" as long as the molecules are in constant rapid motion causing both the crashing to each other and the indefiniteness of their shape. In such a way the gas is represented when the string is pulled vigorously.
Best regards.
While heating copper in the final step, the bright copper color changes to dull brown. Will percent recovery be too high, too low, or unaffected? Explain your answer
how do plate tectonics relate to the formation of crustal features on the earth
A sample of a pure compound containing C, H, and N, weighing 1.00 g, yields 2.84 g of carbon dioxide and 0.677 g of water when it reacts with excess oxygen. What is the simplest formula of the compound?
A gas mixture is made by combining 8.2 g each of ar, ne, and an unknown diatomic gas. at stp, the mixture occupies a volume of 19.44 l.what is the molar mass of the unknown gas
If 50% of radioactive element remains after 4000 years what what is the half life
A chemist dissolves of pure barium hydroxide in enough water to make up of solution. calculate the ph of the solution. (the temperature of the solution is .) be sure your answer has the correct number of significant digits.
The pH of a 4.5 × 10^-4 M Ba(OH)2 solution is calculated by first determining the hydroxide ion concentration, which is doubled due to the two hydroxide ions provided by Ba(OH)2, and then calculating the pOH followed by subtracting from 14 to get the pH value of approximately 10.95.
Explanation:Calculating the pH of Barium Hydroxide Solution
For the calculation of the pH of a 4.5 × 10-4 M barium hydroxide (Ba(OH)2) solution, it is crucial to consider that barium hydroxide is a strong base which dissociates fully in water. As Ba(OH)2 provides two moles of hydroxide ions for each mole of the substance dissolved, the hydroxide ion concentration will be twice the concentration of Ba(OH)2, which is 9 × 10-4 M (2 × 4.5 × 10-4 M).
To find the pOH of the solution, we take the negative logarithm of the hydroxide ion concentration: pOH = -log (9 × 10-4) = 3.045757491. To find the pH, subtract the pOH from 14: pH = 14 - 3.045757491, which simplifies to approximately pH = 10.95. This is a basic solution, as expected from barium hydroxide.
In laboratory settings, remember to use proper safety precautions, the correct form of chemicals, accurate measuring tools, and the appropriate methods to adjust the pH of solutions, such as adding acid or base. Moreover, for precise results, correctly label solutions and calibrate equipment such as pH meters as necessary.
Which of the following is the correct formula for barium (II) sulfate?
how many protons are in Uranium -242?
Look up the first ionization energies of silver and manganese; which of these two elements would you call more metallic based on the way we define it in this book?
The ionization energies are related to metallic character. The elements which have low ionization energies tend to behave more metallic. The first ionization energy is the best indication of whether an element behaves as a metal or nonmetal. It can also be used to compare the metallic character of two metals. The ionization energy of manganese is 717 kJ/mol and that of silver is 731 kJ/mol. The ionization energy ionization energy of manganese is smaller than that of silver so it can easily lose electron and undergo chemical reaction. The ionization energy of silver is more therefore it will take time to lose electron and undergo oxidation. Hence, as per the book, manganese is more metallic than silver
How many hydrogen atoms are in 2.80 mol of ammonium sulfide?
Answer : The number of hydrogen atoms are, [tex]134.89\times 10^{23}[/tex]
Explanation : Given,
Moles of hydrogen atoms = 2.80 mole
As we know that, the formula of ammonium sulfide is, [tex](NH_4)_2S[/tex]. In ammonium sulfide, there are 2 atoms of nitrogen, 8 atoms of hydrogen and 1 atom of sulfur.
Now we have to calculate the number of hydrogen atoms.
As, 1 mole of [tex](NH_4)_2S[/tex] contains [tex]8\times 6.022\times 10^{23}[/tex] number of hydrogen atoms.
So, 2.80 mole of [tex](NH_4)_2S[/tex] contains [tex]2.80\times 8\times \times 6.022\times 10^{23}=134.89\times 10^{23}[/tex] number of hydrogen atoms.
Therefore, the number of hydrogen atoms are, [tex]134.89\times 10^{23}[/tex]
If the formula for a compound is represented by X2Y3 and the charge on the Y ion is -2, what is the charge in the X ion?
True or false the si in sih4 does not follow the octet rule because hydrogen is in an unusual oxidation stat
Final answer:
The claim that Si in SiH₄ does not follow the octet rule due to an unusual oxidation state of hydrogen is false; both silicon and hydrogen follow their expected oxidation states and the octet rule is satisfied for silicon.
Explanation:
The statement “The Si in SiH₄ does not follow the octet rule because hydrogen is in an unusual oxidation state” is false. In the molecule SiH₄, silicon follows the octet rule as it is surrounded by four hydrogen atoms (each providing one electron for bonding), resulting in silicon having eight electrons in its valence shell.
The oxidation state of hydrogen in this compound is +1, which is the usual oxidation state for hydrogen when it is bonded to nonmetals. Hence, the silicon atom in silane (SiH₄) completes its octet by forming four single bonds with four hydrogen atoms, with no need for lone pairs on the hydrogen atoms since hydrogen's valence shell is full with just two electrons.
In summary, SiH₄ is a molecule where both silicon and hydrogen atoms follow common oxidation states of +4 and +1, respectively, and the octet rule is satisfied for the silicon atom.
Give the structure corresponding to the name (s)−3−iodo−2−methylnonane.
The (s)−3−iodo−2−methylnonane belongs to organic compounds and consists of a nonane with an iodine atom attached to the third carbon and a methyl group attached to the second carbon.
Explanation:The structure corresponding to the name (s)−3−iodo−2−methylnonane is achieved by following the nomenclature system for organic compounds. Nonane is a carbon backbone with nine carbon atoms. The '2-methyl' indicates that there is a methyl, or CH3 group, attached to the second carbon from the end. The '3-iodo' indicates that there is an iodine atom attached to the third carbon from the end. Therefore, starting from one end of the nonane, we have CH3-CH2-CH(I)-CH(CH3)-CH2-CH2-CH2-CH2-CH3.
Learn more about Organic Compound Structure here:https://brainly.com/question/35316125
#SPJ3
Determine the density of a 23.4g block that when placed in 25.00mL of water causes the water to rise to a level of 28.70mL?
4.05 kg + 567.95 g + 100.1 g add the correct value using the correct sig figs and or least precise degree of precision. When i did least degree of precision i got 4718.1g, do we need to convert the kg unit to grams before getting the least degree of precision? since i used 100.1 as dop and if i had converted first the dop of 4.05 or now 4050g the dop is now only to the tens place compared to being in the tenths place
To find the least degree of precision we swould model it after the kg amount or 4.05 kg or two decimal places. So that would add 0.56795 kg (0.57 kg) and then 0.1001 kg (0.1 kg) so that our answer would be 4.72 kg.
In the other hand, the greatest degree of precision would be to conver 4.05 kg to 4050 g so that 4050g + 567.95 + 100.1 g= 4718.05 grams or 4718 g.
what does an atomic number represent atom? 20 PIONTS TO WHO EVER ANSWERS PLS HELP
A)number of protons
B)number of electrons
C)number of neutrons
D)number of protons and neutrons
Volatile liquids with lower boiling points often give better results than those with higher boiling points. suggest a reason for this.