What is the absorbance of the permanganate in the diluted waste solution?

Answers

Answer 1
Not to be confused with tetration. This article is about volumetric titration. For other uses, see Titration (disambiguation). Acid–base titration is a quantitative analysis of concentration of an unknown acid or base solution. Titration, also known as titrimetry,[1] is a common laboratory method of quantitative chemical analysis that is used to determine the unknown concentration of an identified analyte. Since volume measurements play a key role in titration, it is also known as volumetric analysis. A reagent, called the titrant or titrator[2] is prepared as a standard solution. A known concentration and volume of titrant reacts with a solution of analyte or titrand[3] to determine concentration. The volume of titrant reacted is called titration volume

Related Questions

Which product(s) would be obtained by the dehydration of 2-heptanol? of 2-methyl-l-cyclohexanol?

Answers

Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O

The dehydration of 2-heptanol would yield 2-heptene as the major product along with 1-heptene as a minor product, while the dehydration of 2-methyl-1-cyclohexanol would yield 1-methyl-1-cyclohexene as the major product along with other isomeric alkenes as minor products.

The products obtained by the dehydration of 2-heptanol and 2-methyl-1-cyclohexanol can be predicted based on the rules of alkene formation during dehydration reactions.

For 2-heptanol, the dehydration follows Zaitsev's rule, which states that the more substituted alkene is the major product. In this case, dehydration of 2-heptanol would yield a mixture of alkenes, with the most substituted alkene, 2-heptene, as the major product, and the less substituted alkene, 1-heptene, as a minor product. The reaction can be represented as follows:

[tex]\[ \text{CH}_3\text{CH}(\text{OH})\text{CH}_2\text{CH}_2\text{CH}_2\text{CH}_3 \rightarrow \text{CH}_3\text{CH}=\text{CHCH}_2\text{CH}_2\text{CH}_3 + \text{CH}_3\text{CH}_2\text{CH}=\text{CHCH}_2\text{CH}_3 \][/tex]

For 2-methyl-1-cyclohexanol, the dehydration would also follow Zaitsev's rule. However, since the hydroxyl group is on a cyclohexane ring, the dehydration would lead to the formation of an alkene within the ring. The most substituted alkene that can be formed is 1-methyl-1-cyclohexene. The reaction can be represented as follows:

[tex]\[ \text{C}_6\text{H}_{11}\text{CH}(\text{OH})\text{CH}_3 \rightarrow \text{C}_6\text{H}_{11}\text{C}(\text{CH}_3)=\text{CH}_2 + \text{isomeric alkenes} \][/tex]

In summary, the dehydration of 2-heptanol would yield 2-heptene as the major product along with 1-heptene as a minor product, while the dehydration of 2-methyl-1-cyclohexanol would yield 1-methyl-1-cyclohexene as the major product along with other isomeric alkenes as minor products.

The light emitted by an incandescent element produces:
~a unique continuous spectrum
~an emission line spectrum
~a spectrum identical to the hydrogen atom
~a spectrum of one unique wavelength

Answers

It produces a line emission spectrum. I hope that helps.

Answer:  an emission line spectrum

Explanation:  An emission line spectrum is produced form the light emitted by the incandescent lamp.

Line Spectrum is produced when the electron that has been excited to the higher energy state levels moves between the molecular energy levels while returning to the ground state.

Incandescent lamp is the lam that generates electricity when electrical current runs through it.

The bond enthalpy in no is 632 kj/mol and that of each no bond in no2 is 469 kj/mol. explain the difference in bond enthalpies between the two molecules. 1. the bond type does not explain the difference. 2. no has a singl

Answers

Bond enthalpy or bond energy is the amount of energy that is needed in order to break or take out one mole of the substance. The bond energy is varied between the compounds NO and NO₂ because of the different configuration of the atoms in order to form the compound.

That being said, it is also noted that the bonds will have different lengths and the molecules will have different shape and are also composed of different numbers of atoms. 
Final answer:

The bond enthalpy is the energy required to break a chemical bond. The bond enthalpy of NO2 is lower than NO because NO2 has a double bond which is stronger and thus requires more energy to break compared to the single bond in NO.

Explanation:

The bond enthalpy, or energy, is a measure of the strength of a chemical bond. It is identified by the energy required, in joules or kilojoules per mole (kJ/mol), to break a chemical bond. In this case, we are comparing the bond enthalpy of NO, a molecule with a single bond, and that of NO2, a molecule with double bonds between the atoms.

The bond enthalpy in NO is 632 kJ/mol and that of each NO bond in NO2 is 469 kJ/mol. The difference in bond enthalpies is due to the difference in the number of electron pairs in the bond. The strength of a bond between two atoms increases as the number of electron pairs in the bond increases. Simply put, a single covalent bond (as in NO) is typically weaker than a double bond (as present in NO2), and therefore, requires less energy to break. Hence the bond enthalpy is lower for NO2 as it is harder to break its double bond.

It's important to remember that the exact values of bond enthalpy also depend on the specific atoms in the bond and their electronegativity, which is why there are some discrepancies seen in bond enthalpies in different molecules.

Learn more about Bond Enthalpy here:

https://brainly.com/question/29633366

#SPJ11

What are the benefits of stationary weather collection

Answers

accuracy i think but i may be wrong

When chromium chloride crcl2 is dissolved in water the temperature of the water decreases answers?

Answers

When the temperature of water decreases by dissolving crcl2, the reaction is endothermic reaction.
The two types of reaction that are opposite to each other are endothermic and exothermic reaction. Endo means inside and Exo means outside and thermic refers to heat.
So, in Exothermic reaction, heat is released and the temperature increases and in endothermic reaction, heat is absorbed and and the temperature decreases. So, this reaction or process is endothermic because by adding CrCl2, the temperature decreases.

Which of the following represents a chemical change?

Bending a wire
Freezing of water
Fireworks exploding
Melting of a wax candle

Answers

There are several differences between a physical and chemical change in matter or substances. A physical change in a substance doesn't change what the substance is. In a chemical change where there is a chemical reaction, a new substance is formed and energy is either given off or absorbed. In this question, the right answer would be Fireworks Exploding, because fireworks are completely changing. bending a wire doesnt change the wire, freezing water doesnt change the properties of water, and melting doesnt change the properties either.

Explosion of fireworks represents a chemical change because explosion causes chemical reaction due to which chemical properties change.

How do chemical changes occur?

Chemical changes occur when chemical reactions take place.During chemical reactions, bonds between atoms break due to which properties change.

Bending of wire only causes change in physical property that is shape and there is no change in chemical properties or constituents of wire.Freezing of water changes the state of water to solid but does not change it's properties.

Melting of wax candle  only changes the state of candle from solid to molten form it does not alter its chemical properties.During explosion of fireworks there is chemical change taking place along with which large amount  of energy is released.

Learn more about chemical change ,here:

https://brainly.com/question/23693316

#SPJ6

The Lewis structure for ethylene, C2H4, is shown. How many valence electrons do the two carbon atoms in the molecule share with each other in the double bond?

Answers

So,

The Lewis structure for ethylene is two carbons double-bonded to each other, and two hydrogens single-bonded to each carbon atom.

Each bond symbolizes two shared valence electrons.  Since the carbon atoms are double-bonded, they share four (4) valence electrons (the other electrons are in lower energy levels and do not appear because they typically don't react when higher energy-level electrons are on top of them).


the correct answer is 2


Do strong acid and strong base have similar effects on protein solubility and denaturation

Answers

Both strong acid and strong base will alter the solubility and the nature of a protein. This is because, adding a strong acid or base to a protein will drastically change the pH of the protein and this will leads to formation of precipitation and denaturation of the protein.

which has prokaryotic cells

Answers

An organism is said to have a prokaryotic cell if its cell is a very simple one that does not contain any true nucleus and which do not have membrane bound organelles. Prokaryotes are usually unicellular organisms, examples are bacteria. One key feature of prokaryotic cell is a piece of circular, double stranded DNA which is usually found in the cell.

Prokaryotic cells are found in bacteria and archaea.

What is Prokaryotic cells

Prokaryotic cells are a type of cell that lacks a nucleus and other membrane-bound organelles. They are found in bacteria and archaea, which are two domains of microorganisms.

Prokaryotic cells are structurally simpler compared to eukaryotic cells, which are found in plants, animals, fungi, and protists.

Learn more about prokaryotic cells at

https://brainly.com/question/25774476

#SPJ6

What is the difference between a white and red reaction integumentary system?

Answers

In the integumentary system, the white reaction is caused by vasoconstriction, which is the narrowing of blood vessels. The red reaction is caused by vasodilation, which is the widening of blood vessels.

The white reaction and the red reaction are two types of skin reactions that can occur in response to an injury or irritation.

The white reaction is usually a temporary reaction that goes away on its own within a few minutes or hours. The red reaction can last longer, depending on the severity of the injury or irritation. The triple reaction is usually caused by a more severe injury or irritation than the white or red reactions. It can also be a sign of an allergic reaction.

Learn more about integumentary system, here:

https://brainly.com/question/21442141

#SPJ12

Final answer:

The integumentary system undergoes changes as a person ages, resulting in a thinner epidermis and slower wound healing. Both the white and red reactions are affected by these changes.

Explanation:

The integumentary system undergoes changes as a person ages, leading to a thinner epidermis and slower wound healing. These changes are reflected in both the white and red reactions of the integumentary system. The white reaction refers to decreased mitosis in the stratum basale, resulting in a thinner epidermis. The red reaction relates to the reduced ability of the dermis to regenerate, leading to slower wound healing.

Learn more about Difference between white and red reaction in the integumentary system here:

https://brainly.com/question/5812878

#SPJ6

Describe the preparation of 40 liters of 0.02 m phosphate buffer, ph 6.9

Answers

By following these steps, you can prepare 40 liters of 0.02 M phosphate buffer with a pH of 6.9 using solid Na3PO4 and 1M HCl:

Step 1: Calculate the amount of Na3PO4 required

Step 2: Prepare the Na3PO4 solution

Step 3: Calculate the amount of HCl required

Step 4: Adjust the pH

To prepare 40 liters of 0.02 M phosphate buffer solution with a pH of 6.9, starting from solid Na3PO4 and 1M HCl, we can follow these steps:

Step 1: Calculate the amount of Na3PO4 required

The phosphate buffer will be prepared using the following equilibrium reaction:

Na3PO4 + 3HCl → 3NaCl + H3PO4

We need to calculate the amount of Na3PO4 required to make a 0.02 M solution in 40 liters.

First, calculate the moles of phosphate ions required:

Moles of phosphate ions = Molarity × Volume

Moles of phosphate ions = 0.02 mol/L × 40 L = 0.8 moles

Since Na3PO4 dissociates into three moles of phosphate ions, the moles of Na3PO4 needed will be one-third of the moles of phosphate ions:

Moles of Na3PO4 = 0.8 moles / 3 = 0.2667 moles

Step 2: Prepare the Na3PO4 solution

Weigh out the calculated amount of Na3PO4 and dissolve it in water to make up the 40 liters of solution.

Step 3: Calculate the amount of HCl required

The pH of the buffer is adjusted using HCl. To achieve a pH of 6.9, we need to calculate the amount of 1M HCl needed.

Step 4: Adjust the pH

Add the calculated amount of 1M HCl to the Na3PO4 solution while monitoring the pH using a pH meter or pH paper. The pH should be adjusted to 6.9 by adding small amounts of HCl at a time and then checking the pH until the desired pH is reached.

By following these steps, you can prepare 40 liters of 0.02 M phosphate buffer with a pH of 6.9 using solid Na3PO4 and 1M HCl.

The probable question may be:

Describe the preparation of 40 liters of 0.02 M phosphate buffer, pH 6.9, starting from solid Na3PO4 and 1M HCl.

How much water must be added to 12.0 mL of 1.65 M LiCl to dilute the solution to 0.495 M LiCl?

Answers

To solve this problem, we use the formula:

M1 V1 = M2 V2

To calculate for the total final volume V2:

 

V2 = M1 V1 / M2

V2 = 1.65 M * 12 mL / 0.495 M

V2 = 40 mL

 

Since final volume is 40 mL so water needed is:

water volume = 40 mL – 12 mL

water volume = 28 mL

The instrument that is commonly used to measure the intensity of radioactivity is called a _____.

Answers

Geiger counter, hope this helps food luck
Geiger Counter is the answer

A neutral atom of potassium (K) has an average mass of 39 amu and 19 electrons. How many neutrons does it have?

10
19
20
58

Answers

Answer is 20. Since potassium has 19 electrons you know that it then has 19 protons because there is no charge change. So to get the number of neutrons, you take the average mass of 39 and subtract the number of protons and that leaves you with 20 neutrons.

A neutral atom of potassium (K) has an average mass of 39 amu and 19 electrons. It has 20 neutrons. Thus, the correct option for this question is C.

What are Electrons?

Electrons may be characterized as the type of subatomic particles which are consistently revolving within the orbitals around the nucleus. These subatomic particles are negatively charged in nature. J.J. Thomson is known as the discoverer of these subatomic particles.

It is clearly mentioned in the question that an atom is neutral which means the number of positively charged particles (protons) is equal to the number of negatively charged particles (electrons). So, the number of protons is also 19.

Now, the number of neutrons is determined by the following formula:

The number of neutrons = Atomic mass - Number of protons.

                                  = 39 - 19 = 20.

Therefore, a neutral atom of potassium (K) has an average mass of 39 amu and 19 electrons. It has 20 neutrons. Thus, the correct option for this question is C.

To learn more about Neutrons, refer to the link:

https://brainly.com/question/26952570

#SPJ5

If 32.0 g of MgSO4⋅7H2O is thoroughly heated, what mass of anhydrous magnesium sulfate will remain?

Answers

find moles of MgSO4.7H2O

molar mass = 246
so moles  = 32 / 246  = 0.13 moles.

When heated, all 7 H2O from 1 molecule will be gone. 
total moles of H2O present = 7 x 0.13 = 0.91
mass of those H2O = 0.91 x 18  = 16.38g

so mass of anyhydrous MgSO4 remain = 32 - 16.38 = 15.62 g

After heating, approximately 15.65 g of anhydrous magnesium sulfate will remain from the original 32.0 g of magnesium sulfate heptahydrate.

Identify the Molar Masses:

Molar mass of MgSO₄ = 24.31 (Mg) + 32.07 (S) + 4 × 16.00 (O) = 120.37 g/molMolar mass of 7H₂O = 7 × 18.02 (H₂O) = 126.14 g/molTherefore, the molar mass of MgSO₄·7H₂O = 120.37 g/mol + 126.14 g/mol = 246.51 g/mol

Calculate the Moles of MgSO₄·7H₂O:

Moles of MgSO₄·7H₂O =
246.51 g/mol32.0 g​≈0.129 mol

Determine the Moles of Anhydrous MgSO₄:

Upon heating, all the water is removed, leaving anhydrous MgSO₄.The moles of anhydrous MgSO₄ are equal to the moles of MgSO₄·7H₂O because heating just removes water.

Calculate the Mass of Anhydrous MgSO₄:

Mass of MgSO₄ = Moles × Molar Mass
=0.129 mol × 120.37 g/mol ≈ 15.65 g

Write orbital diagrams (boxes with arrows in them) to represent the electron configurations of carbon before and after sp hybridization.

Answers

Carbon has an electron configuration of 1s^2 2s^2 2p^2. During sp hybridization, one s and one p orbital of carbon combine to form two sp hybrid orbitals.


Final answer:

The electron configuration of carbon atom in its ground state is 1s² 2s² 2p². After sp hybridization, one 2s electron gets excited to the 2p orbital forming four unpaired electrons ready for bonding. These form two sp hybrid orbitals, leaving the remaining two 2p orbitals with single electrons.

Explanation:

The electron configuration for a carbon atom (C) in its ground state is 1s² 2s² 2p², represented by an orbital diagram with two arrows in the 1s box, two in the 2s, and two single arrows in two of the three 2p boxes, indicating paired and unpaired electrons respectively.

During sp hybridization, one of the 2s electrons gets excited and moves to the 2p orbital, leading to four unpaired electrons ready for bonding. These mix to form two sp orbitals. In the electron configuration diagram, the two sp hybrid orbitals would have a single electron each, leaving the remain two 2p orbitals also with single electrons. Remember, these are depicted as boxes, each with a single upward arrow.

The distinction between the carbon atom's electron configurations before and after sp hybridization is essential in understanding its bonding behaviour and the formation of diverse organic compounds.

Learn more about sp Hybridization here:

https://brainly.com/question/30198266

#SPJ12

Assuming ideal gas behavior, what is the pressure in atm exerted by 1.57 mol Cl2(g) confined to a volume of 1.50 L at 273K?

Answers

The formula for ideal gas law is:

P V = n R T

where

P is pressure = ?

V is volume = 1.50 L

n is number of moles = 1.57 mol

R is gas constant = 0.08205746 L atm / mol K

T is temperature = 273 K

 

P = 1.57 mol * 0.08205746 L atm / mol K * 273 K / 1.50 L

P = 23.45 atm

What is the process that changes the composition of rocks by dissolving them called?

Answers

Weathering & Erosion

SELECT ALL THAT APPLY. Which of the following statements about Charles's law are true?



A. Real gases may be expected to deviate from Charles's law at high pressures.
B. Ideal gases may be expected to deviate from Charles's law at high pressures.
C. Real gases may be expected to deviate from Charles's law near the liquefaction temperature.
D. Ideal gases may be expected to deviate from Charles's law near the liquefaction temperature.

Answers

A. Real gases may be expected to deviate from Charles's law at high pressures.

C. Real gases may be expected to deviate from Charles's law near the liquefaction temperature.

Answer is:

A. Real gases may be expected to deviate from Charles's law at high pressures.

C. Real gases may be expected to deviate from Charles's law near the liquefaction temperature.

At high pressure gas molecules are close to one another and near the liqueffaction temperature energy is very low.

Charles' Law (The Temperature-Volume Law) - the volume of a given amount of gas held at constant pressure is directly proportional to the Kelvin temperature:  

V₁/T₁ = V₂/T₂.  

When temperature goes down, the volume also goes down.


which of the following identifies the number and location of protons in a lithium atom

Answers

Final answer:

A lithium atom always contains three protons located in its nucleus, defining its atomic number as 3, regardless of the isotope.

Explanation:

The number and location of protons in a lithium atom is universally three within its nucleus. This constant feature defines the element lithium (Li) and gives it an atomic number of 3. Lithium atoms can, however, have different numbers of neutrons, resulting in isotopes with different mass numbers such as Lithium-6 (three neutrons) and Lithium-7 (four neutrons). Despite these differences, the number of protons remains constant at three, which is a characteristic trait of the lithium element.

How many cl atoms are in 0.0728 g of pcl3?

Answers

The answer is there are 9.57 x 10²⁰ number of Cl atoms are in 0.0728 g of PCl₃.

Number of moles = mass / molar mass

Mass of PCl₃ = 0.0728 g and molar mass of PCl₃ = 137.33g/mol

Number of moles of PCl₃ = 0.0728 / 137.33 = 5.3 x 10⁻⁴

In one mole there are Avogadro’s number of molecules that is 6.02 x 10²³

So, in 5.3 x 10⁻⁴ moles of PCl₃, there are =5.3 x 10⁻⁴ x 6.02 x 10²³ = 3.19 x 10²⁰

Now there is 3 atoms of Cl in PCl₃ so in 3.19 x 10²⁰ molecules of PCl₃, number of Cl atoms = 3.19 x 10²⁰ x 3 = 9.57 x 10²⁰ atoms

Final answer:

To find the number of chlorine atoms in a given mass of PCl3, you calculate the number of moles of PCl3, using its molar mass. Then, multiply the number of moles by three (since there are three chlorine atoms in each molecule of PCl3), and then use Avogadro's number to convert the number of moles to atoms. The resulting number is 9.56 x 10^20 Cl atoms.

Explanation:

First, determine the molar mass of PCl3. Phosphorus (P) has an atomic mass of about 31g/mol, and Chlorine (Cl) has an atomic mass of about 35.5 g/mol. Since there are three chlorine atoms in PCl3, the molar mass of PCl3 becomes 31 + 3 * 35.5 = 137 g/mol.

Then, calculate the number of moles in 0.0728 g of PCl3. This is done by dividing the mass of the sample by the molar mass of PCl3: 0.0728 g / 137 g/mol = 0.000531 moles of PCl3.

Since each mole of PCl3 contains three moles of Cl, we multiply the number of moles of the compound by three to get the number of moles of Cl: 0.000531 moles * 3 =  0.00159 moles of Cl.

Then, using Avogadro's number (6.02 x 10^23), we can convert the number of moles to the number of atoms. 0.00159 moles * 6.02 x 10^23 atoms/mol = 9.56 x 10^20 atoms.

So, there are around 9.56 x 10^20 atoms of chlorine (Cl) in a 0.0728 g sample of PCl3.

Learn more about calculating atoms here:

https://brainly.com/question/35917637

#SPJ6

What are the major species in solution when solid ammonium bromate is dissolved in water?

Answers

The major species in solution when solid ammonium bromate is dissolved in water is shown below

The major species when ammonium bromate is dissolved in water are ammonium ions, bromate ions, hydronium ions, and ammonia.

When solid ammonium bromate is dissolved in water, the major species in solution are ammonium ions (NH₄⁺) and bromate ions (BrO₃⁻). In an aqueous solution, the ammonium ion is a weak acid, which can donate a proton to water, forming hydronium ions (H₃O⁺) and ammonia (NH₃), hence making the solution slightly acidic. The bromate ion is a stable species that does not further react in water. Therefore, the major species in solution are NH₄⁺, BrO₃⁻, H₃O⁺, and some unreacted NH₃.

Retry: 1.Examine Record A. Use the three basic rules to figure out the ages of the layers. In Chart A, list the layers from youngest to oldest with the youngest layer in the first row.

Answers

Answer:

C, E, H, A, B, F, K, D, L, G, J, I.

Explanation:

Hello,

In this case we are dating each layer based on its deepness as the deeper the layer is, the farther back in time it is (older). In such a way, the youngest layer is C and henceforth by going down, we find older and older layers no matter if the layer is horizontal or diagonal, we just go down by straight line, therefore, from youngest to oldest, the order turn out into:

C, E, H, A, B, F, K, D, L, G, J, I.

Best regards.

why is it important to know a tornados velocity and not just its speed

Answers

So you know how fast it’s going and how fast it will get there.

Household object that includes metal and why

Answers

Metal objects can be found in a variety of locations throughout the house. A common location would be the garage as it is a common storage location for tools and machinery which are made of metals like steel and aluminum.

When a soda is poured into a glass and the soda bubbles, is it the result of a chemical change? explain your answer?

Answers

Yes, It is the result of the chemical change when a soda is poured into a glass and the soda bubbles, as the bubbles are Co2 escaping from a liquid. We can say that it is a chemical change because it change to another material with different properties so we can conclude that it is a result of a chemical change.

Calculate the formula mass for the compound tin(IV) sulfate.

Answers

The molecular formula for tin(IV)  sulfate is Sn(SO₄)₂.
mass of sulfur S = 32.065
as there is 2 sulfur in tin (IV) sulfate = 32.065 x 2 = 64.13
mass of oxygen = 15.999 and there are 8 oxygen atoms in the formula; 
8 x 15.999 = 127.992
mass of tin = 118.71
now add all the masses = 64.13 + 127.992 + 118.71 = 310.832 
formula mass of tin(IV) sulfate is 310.832

What is the de Broglie wavelength (in meters) of a 45-g golf ball traveling at 72 m/s?

Answers

Data:

mass = 45 g = 0.045 kg

velocity = 72 m/s

Formula:

wavelength = Planck constant / (mass * velocity)

Solution:

Planck constant is 6.63 * 10^ -34 J*s

=> wavelength = 6.63 * 10 ^ -34 J*s / (0.045 kg * 72 m/s)

wavelength = 2.05 * 10^ - 34 m

Answer: 2.05 * 10 ^  -34 m

Write the complete electron configuration for the common monatomic ion formed by the element calcium, ca.

Answers

Calcium is the 20th element in the periodic table. If the substance is neutral this means that the number of elements is equal to the number of protons. The assigning of the numbers in the electron configuration can be made using the Aufbau Principle.

The principle states that the electrons occupy the orbitals with lowest energy level. Having said this, the electron configuration therefore of the calcium is,

     Ca(20) = 1s²2s²2p⁶3s²3p⁶4s²
Final answer:

The complete electron configuration for the common monatomic ion formed by calcium (Ca) is [Ar]4s².

Explanation:

Calcium (Ca) is located in the second column of the s block. We would expect its electron configuration to end with 4s². The complete electron configuration for calcium is [Ar]4s². When calcium forms a monatomic ion, it loses its two valence electrons, resulting in a 2+ charge and an electron configuration of 1s²2s²2p⁶3s²3p⁶. The calcium ion (Ca²+) is therefore isoelectronic with the noble gas argon (Ar).

what is one difference between a cell wall and a cell membrane

Answers

The cell wall is the outer most covering of the cell. The cell wall covers the cell membrane. The cell membrane is also known as the plasma membrane or plasma lemma. There is no other name for the cell wall. The cell membrane is present in almost all types of cells. The cell wall is present in bacteria, fungi, algae and plant cell. It is absent in an animal cell and protozoa. The cell membrane is a biological membrane, which is semi- permeable. It allows the passage of certain substances through them.

1.Cell wall is found in plant cell and cell membrane is found in animal cells
Other Questions
Which topic could be investigated using the scientific method, with the investigation organized around a appropriate research question? A)moral values B)the supernatural C)the natural world D)personal preference How does nuclear fission produce energy?A controlled nuclear chain reaction produces heat, driving steam turbines to produce energy.Moving water turns turbines to produce electricity.Carbon atoms are bombarded by small neutrons.An uncontrolled nuclear reaction produces heat, driving steam turbines to produce energy. HELPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPWhat happens in the resolution of "The Secret Life of Walter Mitty"?Question 10 options:Mitty finally stops daydreaming.In his imagination, Mitty finds himself in front of a firing squad.Mitty realizes that his wife is really a wise person.Mitty is introduced as a man who daydreams all the time. What quantity measures the amount of space an object occupies? Prompt: Do (a) private citizens or (b) the government have a duty to help the poor? Explain your answers using details that you have learned in this lesson. A hypothesis, or thesis statement, is an opinion that can be supported by facts. State your hypothesis using specific, precise examples from the lesson to support it. Be sure to address both parts of the question. When energia, a soft drink manufacturer, seeks to use viral ads on the internet to introduce its new beverage to the consumers even before introducing it to supermarkets, it uses a:? Explain how trilobites meet each of the 4 criteria for being an index fossil. This is the third investigatory agency created, which fell under the department of treasury during its inception: Two cars start at the same time, but travel in opposite directions. One car's average speed is 30 miles per hour (mph). At the end of 4 hours, the two cars are 400 miles apart. Find the average speed in mph of the other car. The fall of Tenochtitln in 1521 was significant becauseA.) it ended the Aztec empire.B.) it ended the Inca empire.C.) it established a Spanish colony in the Americas.D.) it gave Spain control of the fountain of youth. Can y'all help me with 7,8,9????? The deliberate and systematic destruction of an ethnic or religious group is known as What temporary land mass linking siberia and alaska is thought to have the allowed hunter gatherers to migrate from sia to north america? A softball is thrown straight up, reaching a maximum height of 20 meters, what is the ball's approximate vertical speed when it hits the ground? An attacker attempting to break into a facility pulls the fire alarm to distract the security guard manning an entry point. which type of social engineering attack is the attacker using? vishing urgency whaling authority Your friend has asked you to provide one tip for accepting constructive criticism. Which of the following is the best technique? A) Become defensive about the criticism B) Reflect upon the criticism C) Resist seeking solutions to the behavior that prompted the criticism D) Tune out the critic's criticism What is the correct order of steps in the research process?A.determining a topic, reading widely, taking notes, identifying sources, writing the outline.B.determining a topic, identifying sources, reading widely, taking notes, writing the outline.C.determining a topic, writing the outline, identifying sources, reading widely, taking notes, .D.determining a topic, taking notes, reading widely, writing the outline, identifying sources. Why were tanks developed during World War I? Wilma and Betty are playing a number game. Wilma tells Betty, "I'm thinking of a number between 1 and 10. If I take the number and add 4 to it and then multiply that by 3, I get 30." What number is Wilma thinking of? PLEASE SHOW ALL YOUR WORK TO GET BRAINLIEST AWARDSolve by using a matrix{7x+2y=5{13x+14y=-1 Steam Workshop Downloader